40 mL of 0.25 M KH2PO4 and 60 mL of 0.45 M K2HPO4
total volume is 100 mL which contains
40 mL x 0.25 moles/L of KH2PO4 = (40 x 0.25)/1000 moles = 0.01 moles in 100 mL = (0.01 x 1000)/100 = 0.1 M KH2PO4 in the final solution
60 mL x 0.45 moles/L of K2HPO4 = (60 x 0.45)/1000 moles = 0.027 moles in 100 mL = (0.027 x 1000)/100 = 0.27 M K2HPO4 in the final solution
Use the Henderson Hasselbalch equation
pH = pKa + log [A- ] / [HA]
pH = 7.20 + log (0.27) / (0.1)
pH = 7.20 + log 2.7
pH = 7.63
HCl will react with HPO42- to produce H2PO4-
net ionic equation H+(aq) + HPO42-(aq) H2PO4-(aq)
The added HCl will react with K2HPO4 as shown above
so the concentration of K2HPO4 will decrease and KH2PO4 will increase
the new concentration of K2HPO4 will be 0.027 moles - 0.0060 mol = 0.021 mole in 100 mL = 0.21 M
The new concentration of KH2PO4 will be 0.01 moles + 0.0060 mol = 0.016 mole in 100 mL = 0.16M
The pH will be
pH = pKa + log [A- ] / [HA]
pH = 7.20 + log (0.21) / (0.16)
pH = 7.20 + log 1.31
pH = 7.32
You prepared a phosphate buffer solution by mixing 40.0 mL of 0.250 M KH_2PO_4 and 60.0...
consider 100.0 ml of a buffer solution that contains [NaCH3COO]=[CH3COOH]=0.250 M a) what is the pH of this buffer? b) what should the ph of the buffer be after 50.0ml of water is added? explain c) wtite balanced net ionic for the reaction that occurs whrn 1.0 M HCl ir added to this buffer. d) after adding 10.0 ml of 1.0 M HCl what will the ph of the solution be? e) as more 1.0 M HCl is slowly added...
The Ka of lactic acid, HC3H5O3, is 1.4 ✕ 10−4. (a) Suppose buffer #1 is prepared using 40.0 mL 0.1 M HC3H5O3 and 60.0 mL 0.1 M C3H5O3− to give a final volume of 100.0 mL. What is the pH of this buffer? WebAssign will check your answer for the correct number of significant figures. 4.19 Incorrect: Your answer is incorrect. (b) Suppose a buffer #2 is prepared using 60.0 mL 0.1 M HC3H5O3 and 40.0 mL 0.1 M C3H5O3−...
1. Calculate the pH of a buffer solution prepared by mixing 0.250 L of 0.150 M acetic acid with 0.200 L of 0.250 M sodium acetate. Ka acetic acid = 1.8 x 10-5 Calculate the pH of this solution of after the addition of 0.003 L of 0.200 M HCL 2. Consider a buffer solution prepared by mixing 0.250 L of 0.150 M acetic acid with 0.200 L of 0.250 M sodium acetate. Ka acetic acid = 1.8 x 10-5...
4 points Determine the pH of a solution prepared by mixing 60.0 mL of 0.025 M HCl with 40.0 mL of 0.035 M HBr. answer in Question 7. I leo Mathull ditarit
1) Consider a buffer solution that is prepared by mixing 1000 mL of O.500 M NHs with 100.0 mL of0.400 MNH CL Record all answers to at least 3 sig figs and watch out for rounding errors. la) Calculate the pH of this buffer lb) Calculate the pll of this buffer after 200 mg of NaOH is added to the original buffer solution in la. Ic) Calculate the pH of this buffer after 50 mL of0.200 M HCI is added...
4) A solution is prepared by adding 60.0 mL of 0.070 M HCIO, and 40.0 mL of 0.060 M HBr. (a) Calculate the concentrations of all ions in solution. (b) Calculate the pH of this solution. 5.) A solution is neared hvaddin 400 ml of 0.060 M NaOH and 400 ml. of.Aso MCQH
A 1.50 L buffer solution is 0.250 M in HF and0.250 M in NaF. Calculate the pH of the solution after the addition of 0.0500 moles of solid NaOH. Assume no volume change upon the addition. The K_a for HF is 3.5 times 10^-4. 3.63 3.57 3.34 3.46 4.37 Which of the following conjugate pairs would be best for preparing a buffer solution at pH 4.0? HCN K_a = 6.2 times 10^-10 HNO_2 K_a = 7.1 times 10^-4 NaCI and...
Calculate the following: a. The pH of a 500.0 mL buffer solution containing 0.75 M HCN (Ka = 6.2 x 10^-10) and 0.55 M NaCN b. The pH of the above buffer after the addition of 100.0 mL of 1.0 M NaOH. c. The pH of the buffer if 100.0 mL of 1.0 M HCl was added to the solution in part a.
Calculate the pH of a buffer made from mixing 10.0 mL of 0.100 M NaC3H2O, and 10.0 mL of 0.100 M HC,H,O2 pH 4.76 Calculate the pH of the buffer when 5.00 mL of a 0.0100 M NaOH solution is added. pH Calculate the pH of the buffer when 5.00 mL of a 0.0100 M HCl solution is added.
Using a 0.20 M phosphate buffer with a pH of 6.2, you add 0.77 mL of 0.45 M HCl to 48 mL of the buffer. What is the new pH of the solution? (Enter your answer to three significant figures.) Using a 0.20 M phosphate buffer with a pH of 6.2, you add 0.77 mL of 0.45 M NaOH to 48 mL of the buffer. What is the new pH of the solution? (Enter your answer to three significant figures.)