Homework Answers
Add Answer to:
Aromatic reactions: 1. Reaction name: 2. Classification of the inserted substituent: 3. Major organic product (if...
19. What is the major organic product obtained from the following reaction? Huso A) 1 B)...
19. What is the major organic product obtained from the following reaction? Huso A) 1 B) II C III D) IV 20. What is the major organic product obtained from the following reaction? o ca A) I B) II C III D) IV 21. Which of the following substituents are activators in electrophilic aromatic substitution? A) CH30— B) CI— C) NO2 D) HSO3- 22. Which of the following substituents are deactivators in electrophilic aromatic substitution? A) HO– B) CH3NH –...
4. Predict the major product for the following reaction. Cly/AICI, OH 5. Predict the major product...
4. Predict the major product for the following reaction. Cly/AICI, OH 5. Predict the major product for the following reaction. OCH, HNO/H2SO4 OCH 6. Discuss ortho, meta para directors, activators and deactivators and predict products. De 9 © PL
1) Which of the following is an intermediate in the bromination of toluene? p) Ha BrH...
1) Which of the following is an intermediate in the bromination of toluene? p) Ha BrH 2 2) Under what reaction conditions would the electrophilic chlorination of aromatic compounds usually occur? A) Cl2, AlCl3 B) C12, CCl4 C) Cl2, H20 D) NaCl, H20 E) NaCI, CH3OH 3) 3) Which of the following is the strongest activating group in electrophilic aromatic substitution reactions? A) -CO2CH3 B)-NO2 C) -OCH3 D) -CH2CH3 E) -N(CH3)2 4) _ 4) In electrophilic aromatic substitution reactions the...
Draw the major organic product(s) for the following reactions. If there is no reaction, state so....
Draw the major organic product(s) for the following reactions.
If there is no reaction, state so.
- das ports row the major organic products for 1. (15 points) Draw the major organic product(s) for the following reactions. If there is no reaction, state so. NH2NH2 water. он CH3CHCH3 + H2C— C— CH3 La 1. LiAIHA c. Học -c- 2. H20 H2O/NaOH d. CH3CH2C— 0-CH2CH3 two products -C- OCH H20 two products
What major Organic product is formed after the following sequence of reactions? 1) NaH, THF 2)...
What major Organic product is formed after the following sequence of reactions? 1) NaH, THF 2) Br Br B1 (C) (b) Br Bi a. a Considering both regiochemistry and stereochemistry, what is the major Organic product of the following reaction? о ні. CH-CH, НСІ Снон HC "CH; но CH, НО CH, HCO CH-CH; CH «CH-CH, OCH; CH CH3 ОН нс СІ H; Н;С (6) (c) H.CO CH, Kotic CH.CH НО CH; Но CH.CH Сн, НП). CH,CH; ОН нс Н.С осн;...
What is the major organic product of the following reaction? Type its systematic IUPAC name in...
What is the major organic product of the following reaction?
Type its systematic IUPAC name in the box below.
What is the major organic product of the following reaction? Type its systematic IUPAC name in the box below. CH3CH20H H (cat.)
There are 3 pictures, 18 exercises in total. Topics are Benzenes and their reactions No -I...
There are 3 pictures, 18 exercises in total. Topics are Benzenes
and their reactions
No -I ab 0 CH3 Br nooit 1. Aromatic molecules contain Tt electrons. a. 4n b. 4n+2 c. An odd number d. 4n+1 c. Zero Condition needed for benzene halogenation to occur a. NaC1, 1120 b. C12, H20 c. C12, AICI3 d. NaCl, CH3OH e. C12, CC14 3. In an electrophilic aromatic substitution, the hydroxyl group orients ortho-para because a, removes electronic density from the benzene...
1.Provide the major organic product of the reaction below. 2.Provide the major organic product of the...
1.Provide the major organic product of the reaction below.
2.Provide the major organic product of the reaction shown
below.
3.Provide the major organic product of the reaction shown
below.
4.Predict the necessary starting material for the reaction
below. Give the IUPAC name.
5.
Part A
Draw the carbonyl compound needed for this synthesis.
6.Predict the product formed when
CH3-CH2-C≡C:–Na+
undergoes a reaction with the compound shown below followed by an
aqueous workup..
Interactive 3D display mode
7. When 2,2-dibromo-1-phenylpropane is...
What is the major organic product obtained from the following reaction? Br Br HO HO OH...
What is the major organic product obtained from the following reaction? Br Br HO HO OH Br Biz пилото нр 2 3 0 1 2 3 uestion 52 3.3 What is the IUPAC name of the following compound? OCH3 OCH3 cis-1,4-anisole cis-4-methoxyanisole cis-1,4-dimethoxycyclohexane para-dianisole
2. Not only does an aromatic ring itself affect the reactivity of an acid derivative (an ester, o...
2. Not only does an aromatic ring itself affect the reactivity of an acid derivative (an ester, on last year's quiz), substituents on the aromatic ring can further modify the reactivity. First, we will consider a phenyl amide with a para-acetyl substituent: CH, (a) What is the n-effect (resonance) of the para-acetyl substituent? How will that affect the reactivity of the other (amide) carbonyl in the molecule below (increase or decrease, compared to the same amide but with no p-...
19. What is the major organic product obtained from the following reaction? Huso A) 1 B) II C III D) IV 20. What is the major organic product obtained from the following reaction? o ca A) I B) II C III D) IV 21. Which of the following substituents are activators in electrophilic aromatic substitution? A) CH30— B) CI— C) NO2 D) HSO3- 22. Which of the following substituents are deactivators in electrophilic aromatic substitution? A) HO– B) CH3NH –...
4. Predict the major product for the following reaction. Cly/AICI, OH 5. Predict the major product for the following reaction. OCH, HNO/H2SO4 OCH 6. Discuss ortho, meta para directors, activators and deactivators and predict products. De 9 © PL
1) Which of the following is an intermediate in the bromination of toluene? p) Ha BrH 2 2) Under what reaction conditions would the electrophilic chlorination of aromatic compounds usually occur? A) Cl2, AlCl3 B) C12, CCl4 C) Cl2, H20 D) NaCl, H20 E) NaCI, CH3OH 3) 3) Which of the following is the strongest activating group in electrophilic aromatic substitution reactions? A) -CO2CH3 B)-NO2 C) -OCH3 D) -CH2CH3 E) -N(CH3)2 4) _ 4) In electrophilic aromatic substitution reactions the...
Draw the major organic product(s) for the following reactions.
If there is no reaction, state so.
- das ports row the major organic products for 1. (15 points) Draw the major organic product(s) for the following reactions. If there is no reaction, state so. NH2NH2 water. он CH3CHCH3 + H2C— C— CH3 La 1. LiAIHA c. Học -c- 2. H20 H2O/NaOH d. CH3CH2C— 0-CH2CH3 two products -C- OCH H20 two products
What major Organic product is formed after the following sequence of reactions? 1) NaH, THF 2) Br Br B1 (C) (b) Br Bi a. a Considering both regiochemistry and stereochemistry, what is the major Organic product of the following reaction? о ні. CH-CH, НСІ Снон HC "CH; но CH, НО CH, HCO CH-CH; CH «CH-CH, OCH; CH CH3 ОН нс СІ H; Н;С (6) (c) H.CO CH, Kotic CH.CH НО CH; Но CH.CH Сн, НП). CH,CH; ОН нс Н.С осн;...
What is the major organic product of the following reaction?
Type its systematic IUPAC name in the box below.
What is the major organic product of the following reaction? Type its systematic IUPAC name in the box below. CH3CH20H H (cat.)
There are 3 pictures, 18 exercises in total. Topics are Benzenes
and their reactions
No -I ab 0 CH3 Br nooit 1. Aromatic molecules contain Tt electrons. a. 4n b. 4n+2 c. An odd number d. 4n+1 c. Zero Condition needed for benzene halogenation to occur a. NaC1, 1120 b. C12, H20 c. C12, AICI3 d. NaCl, CH3OH e. C12, CC14 3. In an electrophilic aromatic substitution, the hydroxyl group orients ortho-para because a, removes electronic density from the benzene...
1.Provide the major organic product of the reaction below.
2.Provide the major organic product of the reaction shown
below.
3.Provide the major organic product of the reaction shown
below.
4.Predict the necessary starting material for the reaction
below. Give the IUPAC name.
5.
Part A
Draw the carbonyl compound needed for this synthesis.
6.Predict the product formed when
CH3-CH2-C≡C:–Na+
undergoes a reaction with the compound shown below followed by an
aqueous workup..
Interactive 3D display mode
7. When 2,2-dibromo-1-phenylpropane is...
What is the major organic product obtained from the following reaction? Br Br HO HO OH Br Biz пилото нр 2 3 0 1 2 3 uestion 52 3.3 What is the IUPAC name of the following compound? OCH3 OCH3 cis-1,4-anisole cis-4-methoxyanisole cis-1,4-dimethoxycyclohexane para-dianisole
2. Not only does an aromatic ring itself affect the reactivity of an acid derivative (an ester, on last year's quiz), substituents on the aromatic ring can further modify the reactivity. First, we will consider a phenyl amide with a para-acetyl substituent: CH, (a) What is the n-effect (resonance) of the para-acetyl substituent? How will that affect the reactivity of the other (amide) carbonyl in the molecule below (increase or decrease, compared to the same amide but with no p-...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 23 seconds ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 17 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 18 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 32 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago