Homework Answers
Answer : (D) The proton changes itself into a neutron by emitting a positron and a neutrino.
Please give a positive rating by clicking on the thumbs up ? button if you get benefited from this answer? have a good day ahead. Thank you?
Add Answer to:
9. What can you tell about the following nuclear reactions? np* + e +ve p* →n+et...
1.) In a nuclear equation, a neutron can spontaneously change into a(n) alpha particle positron and...
1.) In a nuclear equation, a neutron can spontaneously change into a(n) alpha particle positron and electron beta particle and proton gamma particle 2.)Identify the following substances involved in radioactive reactions, describing how you obtained the answer: a.An element which undergoes alpha decay to form lead-208 b. The product of the alpha decay of radium-226 c.The product of beta decay of iodine-131
40. Which of the following reactions illustrates a nuclear process that occurs within a control rod in a nuclear reactor? 106 0106 12 cd + , п- 48 41. Fluorine-20 a. is expected to be a stable isotop...
40. Which of the following reactions illustrates a nuclear process that occurs within a control rod in a nuclear reactor? 106 0106 12 cd + , п- 48 41. Fluorine-20 a. is expected to be a stable isotope because its neutron/proton ratio is 11/9. b. is expected to undergo alpha decay to increase the neutron/proton ratio c. is expected to undergo beta decay to decrease the neutron/proton ratio. d. lies in the band of stability. e. probably has a half-life...
9. Select the nuclide that completes the following nuclear reaction. 1K 4+? A) EK B) 3...
9. Select the nuclide that completes the following nuclear reaction. 1K 4+? A) EK B) 3 C) A D) C E) Ca 10. Select the nuclide that completes the following nuclear reaction. | TRAI + B + ?. A) Mg B) ALC) Mg D) si E) si 11. Select the nuclide that completes the following nuclear reaction. Co B + ? A) Feb) Nic) Fe D) CO E) Fe 19 In Cd + ? In the equation above, what particle...
Nuclear Reactions and Their Applications 1. Which one of the following is an incorrect representation of...
Nuclear Reactions and Their Applications 1. Which one of the following is an incorrect representation of the indicated particle or nucleus? D) alpha particle: He B) neutron: E) proton: helium-3: He B positron: A) ip Rn? 3. Which one of the following equations correctly represents alpha decay of Rn → Po + He Rn Pb + He → Fr + B Rn + He Ra At + B C) Rn 4. Select the nuclide that completes the following nuclear reaction....
Activity 27-7. Nuclear decays II [Accompanies Section 27-6] (a) Rank the following decays in order of...
Activity 27-7. Nuclear decays II [Accompanies Section 27-6] (a) Rank the following decays in order of the change in atomic number Z that occurs in the decaying nucleus, from most positive (greatest increase in Z) to most negative (greatest decrease in Z). If any two decays cause the same change in Z, state this. Explain how you made your ranking. (i) Alpha decay (emission of a He nucleus of charge +2e) (ii) Beta-minus decay (emission of an electron of charge...
Based on this table can someone help me with number 2 ? Thank you and will...
Based on this table can someone help me with number 2 ? Thank
you and will rate
Аавьссе Аавьссос AaBbco Аавbccc Аав 1 Normal 1 No Spac... Heading 1 Heading 2 Title soc Repl ADA FEE Sele Paragraph VUE IN LILLLUER Styles gru Vuru Editin Part 1: Types of Radiation Table 1. Types of Radiation in Nuclear Reactions Demonstration Plutonium-239 Strontium-90 Radium-226 3rd 2nd 1" How far did the radiation travel? (1st = traveled the farthest and 3rd = traveled...
9. Which of the following statements about enzyme catalyzed reactions is NOT true? a. Enzymes form...
9. Which of the following statements about enzyme catalyzed reactions is NOT true? a. Enzymes form complexes with their substrates b. Enzymes lower the activation energy for chemical reactions c. Enzymes change the Key for chemical reactions d. Many enzymes change shapes slightly when substrate binds 10. To overcome an energy barrier between reactants and products, energy must be provided to get the reaction started. This energy, which is recovered as the reaction proceeds, is called: a. Activation energy b....
Problem 5. [Einstein's E = mc²] Sun is producing energy by nuclear fusion reactions converting four...
Problem 5. [Einstein's E = mc²] Sun is producing energy by nuclear fusion reactions converting four hydrogen nuclei to form one nucleus of He, i.e. 4H + He. However, mass of helium nucleus is smaller than that of four hydrogens and this difference is called mass defect. If mass of the hydrogen nucleus is my and mass of the helium nucleus Mhe mass defect of one nuclear reaction Am is equal to Am = 4 *my - Me (1) Using...
Water is a polar molecule. It has an electric dipole strength of p-6-10 30 C-n. This...
Water is a polar molecule. It has an electric dipole strength of p-6-10 30 C-n. This is roughly equivalent to a proton and an electron separated by a distance of d 4-10-11 m (about the radius of a hydrogen atom) In this problem, we will use Coulomb's law to compare the force between two protons, a proton and a water molecule, and two water molecules. Use the arrangement of the charges shown in the figure for your calculations. (a) What...
A) You will investigate the PP-I chain leading to the formation of helium and energy from the fus...
A) You will investigate the PP-I chain leading to the formation of helium and energy from the fusion of 1) Demonstrate that I u of mass (1/12)mC, atom) has an equivalent rest mass of answers Qi, Q2, and Qs in MeV. Be careful with Qi-beware of the leptons! hydrogen in the cores of lower mass main sequence stars such as our Sun. 931.4940954 MeV/c (match at least the first 4 digits past decimal) Calculate the Q value for each step...
40. Which of the following reactions illustrates a nuclear process that occurs within a control rod in a nuclear reactor? 106 0106 12 cd + , п- 48 41. Fluorine-20 a. is expected to be a stable isotope because its neutron/proton ratio is 11/9. b. is expected to undergo alpha decay to increase the neutron/proton ratio c. is expected to undergo beta decay to decrease the neutron/proton ratio. d. lies in the band of stability. e. probably has a half-life...
9. Select the nuclide that completes the following nuclear reaction. 1K 4+? A) EK B) 3 C) A D) C E) Ca 10. Select the nuclide that completes the following nuclear reaction. | TRAI + B + ?. A) Mg B) ALC) Mg D) si E) si 11. Select the nuclide that completes the following nuclear reaction. Co B + ? A) Feb) Nic) Fe D) CO E) Fe 19 In Cd + ? In the equation above, what particle...
Nuclear Reactions and Their Applications 1. Which one of the following is an incorrect representation of the indicated particle or nucleus? D) alpha particle: He B) neutron: E) proton: helium-3: He B positron: A) ip Rn? 3. Which one of the following equations correctly represents alpha decay of Rn → Po + He Rn Pb + He → Fr + B Rn + He Ra At + B C) Rn 4. Select the nuclide that completes the following nuclear reaction....
Activity 27-7. Nuclear decays II [Accompanies Section 27-6] (a) Rank the following decays in order of the change in atomic number Z that occurs in the decaying nucleus, from most positive (greatest increase in Z) to most negative (greatest decrease in Z). If any two decays cause the same change in Z, state this. Explain how you made your ranking. (i) Alpha decay (emission of a He nucleus of charge +2e) (ii) Beta-minus decay (emission of an electron of charge...
Based on this table can someone help me with number 2 ? Thank
you and will rate
Аавьссе Аавьссос AaBbco Аавbccc Аав 1 Normal 1 No Spac... Heading 1 Heading 2 Title soc Repl ADA FEE Sele Paragraph VUE IN LILLLUER Styles gru Vuru Editin Part 1: Types of Radiation Table 1. Types of Radiation in Nuclear Reactions Demonstration Plutonium-239 Strontium-90 Radium-226 3rd 2nd 1" How far did the radiation travel? (1st = traveled the farthest and 3rd = traveled...
9. Which of the following statements about enzyme catalyzed reactions is NOT true? a. Enzymes form complexes with their substrates b. Enzymes lower the activation energy for chemical reactions c. Enzymes change the Key for chemical reactions d. Many enzymes change shapes slightly when substrate binds 10. To overcome an energy barrier between reactants and products, energy must be provided to get the reaction started. This energy, which is recovered as the reaction proceeds, is called: a. Activation energy b....
Problem 5. [Einstein's E = mc²] Sun is producing energy by nuclear fusion reactions converting four hydrogen nuclei to form one nucleus of He, i.e. 4H + He. However, mass of helium nucleus is smaller than that of four hydrogens and this difference is called mass defect. If mass of the hydrogen nucleus is my and mass of the helium nucleus Mhe mass defect of one nuclear reaction Am is equal to Am = 4 *my - Me (1) Using...
Water is a polar molecule. It has an electric dipole strength of p-6-10 30 C-n. This is roughly equivalent to a proton and an electron separated by a distance of d 4-10-11 m (about the radius of a hydrogen atom) In this problem, we will use Coulomb's law to compare the force between two protons, a proton and a water molecule, and two water molecules. Use the arrangement of the charges shown in the figure for your calculations. (a) What...
A) You will investigate the PP-I chain leading to the formation of helium and energy from the fusion of 1) Demonstrate that I u of mass (1/12)mC, atom) has an equivalent rest mass of answers Qi, Q2, and Qs in MeV. Be careful with Qi-beware of the leptons! hydrogen in the cores of lower mass main sequence stars such as our Sun. 931.4940954 MeV/c (match at least the first 4 digits past decimal) Calculate the Q value for each step...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 17 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago