Homework Answers
Add Answer to:
predict the products of the following reactions and balance
the resulting equations
Predict the products of...
Predict the products of the following reactions and balance the chemical equations. 1. Synthesis Reactions a)...
Predict the products of the following reactions and balance the chemical equations. 1. Synthesis Reactions a) 2Na(s) + Cl2(g) → 2NaCl (s) b) 3Mg(s) + N2(g) → Mg3N2 (8) 2. Decomposition Reactions a) 2HgO(s) → 2Hg (s)+ O2(g) b)Li2O(s)2Li (g)+ 0-2 (g) 3. Single Displacement Reactions a) Al(s) + Pb(NO3)2 (aq) → Al(NO3)2 + Pb b) Ca(s) + HNO3(aq) → 4. Double Displacement Reactions Remember to include state symbols to show if a precipitate forms. a) CaCl2(aq) +_ Li2SO4(aq) →...
need assistance with this. 3) 4) Balancing Equations Race _Catte + 302 300₂ + 4 H₂O 2A1+_ Fe3N2 + 2AIN + 3 Fe 2 Na+...
need assistance with this.
3) 4) Balancing Equations Race _Catte + 302 300₂ + 4 H₂O 2A1+_ Fe3N2 + 2AIN + 3 Fe 2 Na+ _Cl2 + 2 Naci - H202 → __H20 + _02 _CeH12O6 + __027_H2O + __CO2 _H20 + __CO2 + _C4H8 + _02 _NaClO3 → __NaCl + __02 _ (NH4)3PO4 + _ Pb(NO3); }_Pb3(PO4)4 + _ NH4NO. BF3 + _ Li2SO3 → __B2(SO3)3 + __LiF C7H17+ - 02+_ CO2 + __ H2O _ CaCO3 + __...
CHEMISTRY 2A EXAM NAME UNIT 4 - EQUATIONS Spring 2005 BALANCE THE FOLLOWING EQUATIONS and predict...
CHEMISTRY 2A EXAM NAME UNIT 4 - EQUATIONS Spring 2005 BALANCE THE FOLLOWING EQUATIONS and predict the products if none are written SO2 + -_> so, H3PO4 + Ba(OH)2 Sr + Fe2O, -----> Bi(NO3)3 + HS - - LiH + A LiAlH + H₂ Naci + O2 6. NaCIO FOR THE REACTIONS ABOVE INDICATE THE REACTION TYPE.
Using the criteria for double displacement reactions, together with the Solubility Table , predict whether a...
Using the criteria for double displacement reactions, together with the Solubility Table , predict whether a double displacement reaction will occur in each example below. If reaction will occur, complete and balance the equation,If you believe no reaction will occur,write " no reaction " K2S+ CuSO4 ---> KOH + HCl ------> CaCO3 + HCl ------> Ba(NO3)2 + Na3PO4----> BiCl3 + NaOH ------> (NH4)2SO4 + NaCl ------> K3PO4 + ZnBr2 ------> Na2CO3 + HNO3 ------->
Write out the products including the physical state and balance the following reactions by using the...
Write out the products including the physical state and balance the following reactions by using the principles of metathesis reaction: **PLEASE SHOW YOUR WORK I AM TRYING TO LEARN HOW TO DO THESE AND IT JUST ISN'T CLICKING** a) Mg(C2H3O2)2(aq) + Cs3PO4(aq) ==> b) FeCl3(aq) + AgNO3(aq) ==> c) Cr(NO3)3(aq) + Ba(OH)2(aq) ==> d) Fe(OH)2(s) + HBr(aq) ==> e) Ca(OH)2(aq) + H2SO3(aq) ==> ) HC2H3O2(aq) + LiOH(aq) ==> g) (NH4)2CO3(aq)...
Predict any products and the balanced total and net ionic equations for the following reactions: Pb(NO3)2...
Predict any products and the balanced total and net ionic equations for the following reactions: Pb(NO3)2 + MgCl2 ---> T:______________________________________ N:_____________________________________ ZnCl2 + Na2CO3 ---> T:______________________________________ N:_____________________________________
Predict the product(s) of the following equations. Balance the equations, and classify each of the reactions...
Predict the product(s) of the following equations. Balance the
equations, and classify each of the reactions type. Please type the
answer or write with clear handwriting.
1 Pb(NO3)2 + Na2CO3 → 2. C4H10 02 3. Zn + CuSO4 Heat CaCO3 5. Na H20 6. Ca 02 7. MgSO4 LiOH 8. A1 - NiS04 → 9. SO2 + H20- Heat 10. HgO
4. Predict the products of the following reactions, including physical states. Then balance each reaction. A....
4. Predict the products of the following reactions, including physical states. Then balance each reaction. A. ____ Pb(NO3)2(aq) + ____ KCl(aq) → B. ____ H2SO4(aq) + ____ LiOH(aq) → C. ____ Na2S(aq) + ____ FeI2(aq) → D. ____ Fe(C2H3O2)3(aq) + ____ NH4OH(aq) →
Determine whether each of the following equations for precipitation reactions is correct. If not, write the...
Determine whether each of the following equations for precipitation reactions is correct. If not, write the correct equation. If no reaction occurs, choose NO REACTION. Ba(NO3)2(aq)+(NH4)2SO4(aq)→BaSO4(s)+2NH4NO3(aq)Ba(NO3)2(aq)+(NH4)2SO4(aq)→BaSO4(s)+2NH4NO3(aq) correct incorrect no reaction BaS(aq)+2KCl(aq)→BaCl2(s)+K2S(aq)BaS(aq)+2KCl(aq)→BaCl2(s)+K2S(aq) correct incorrect no reaction 2KI(aq)+Pb(NO3)2(aq)→PbI2(s)+2KNO3(aq)2KI(aq)+Pb(NO3)2(aq)→PbI2(s)+2KNO3(aq) correct incorrect no reaction Pb(NO3)2(aq)+2LiCl(aq)→2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq)+2LiCl(aq)→2LiNO3(s)+PbCl2(aq) correct incorrect no reaction
9. Predict the products of the reactions below and balance the equations. If no reaction would...
9. Predict the products of the reactions below and balance the equations. If no reaction would occur, write NR. (4 points each) (a) 241 +312 -2A113 (b) Ba(OH)2 + HBI BaBr 2 + H2O (c) C&H 206 + O2 → 10. What volume of a 2.00 M solution of AuCl2 would be necessary to give 1.65 g of AuCiz? (5 points) 11. A solution of KOH was titrated with 0.1423 g of HBr. If 3.08 mL of KOH solution were...
Predict the products of the following reactions and balance the chemical equations. 1. Synthesis Reactions a) 2Na(s) + Cl2(g) → 2NaCl (s) b) 3Mg(s) + N2(g) → Mg3N2 (8) 2. Decomposition Reactions a) 2HgO(s) → 2Hg (s)+ O2(g) b)Li2O(s)2Li (g)+ 0-2 (g) 3. Single Displacement Reactions a) Al(s) + Pb(NO3)2 (aq) → Al(NO3)2 + Pb b) Ca(s) + HNO3(aq) → 4. Double Displacement Reactions Remember to include state symbols to show if a precipitate forms. a) CaCl2(aq) +_ Li2SO4(aq) →...
need assistance with this.
3) 4) Balancing Equations Race _Catte + 302 300₂ + 4 H₂O 2A1+_ Fe3N2 + 2AIN + 3 Fe 2 Na+ _Cl2 + 2 Naci - H202 → __H20 + _02 _CeH12O6 + __027_H2O + __CO2 _H20 + __CO2 + _C4H8 + _02 _NaClO3 → __NaCl + __02 _ (NH4)3PO4 + _ Pb(NO3); }_Pb3(PO4)4 + _ NH4NO. BF3 + _ Li2SO3 → __B2(SO3)3 + __LiF C7H17+ - 02+_ CO2 + __ H2O _ CaCO3 + __...
CHEMISTRY 2A EXAM NAME UNIT 4 - EQUATIONS Spring 2005 BALANCE THE FOLLOWING EQUATIONS and predict the products if none are written SO2 + -_> so, H3PO4 + Ba(OH)2 Sr + Fe2O, -----> Bi(NO3)3 + HS - - LiH + A LiAlH + H₂ Naci + O2 6. NaCIO FOR THE REACTIONS ABOVE INDICATE THE REACTION TYPE.
Predict the product(s) of the following equations. Balance the
equations, and classify each of the reactions type. Please type the
answer or write with clear handwriting.
1 Pb(NO3)2 + Na2CO3 → 2. C4H10 02 3. Zn + CuSO4 Heat CaCO3 5. Na H20 6. Ca 02 7. MgSO4 LiOH 8. A1 - NiS04 → 9. SO2 + H20- Heat 10. HgO
9. Predict the products of the reactions below and balance the equations. If no reaction would occur, write NR. (4 points each) (a) 241 +312 -2A113 (b) Ba(OH)2 + HBI BaBr 2 + H2O (c) C&H 206 + O2 → 10. What volume of a 2.00 M solution of AuCl2 would be necessary to give 1.65 g of AuCiz? (5 points) 11. A solution of KOH was titrated with 0.1423 g of HBr. If 3.08 mL of KOH solution were...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago