is atp optically active? it's IUPAC name is (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
is atp optically active? it's IUPAC name is (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
Homework Answers
Yes it is optically active because it has asymmetric atom centers and has no internal plane of symmetry or inversion center
ATP is a chiral molecule
Add Answer to:
is atp optically active? it's IUPAC name is
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]
phosphono hydrogen phosphate
What is the IUPAC name of the following compound? a. l-ethoxy-1-methoxy-3-propylcyclohexane b. 1-propyl-3-ethoxy-3-methoxycyclohexane C. 2-ethoxy-2-methoxy-6-cyclohexylnonane d....
What is the IUPAC name of the following compound? a. l-ethoxy-1-methoxy-3-propylcyclohexane b. 1-propyl-3-ethoxy-3-methoxycyclohexane C. 2-ethoxy-2-methoxy-6-cyclohexylnonane d. 1-(3-ethoxy-3-methoxycyclohexyl)-propane What is the IUPAC name for the following compound? ОН a. (2R,55)-5-ethoxy-2-octanol b. (25,5S)-5-ethoxy-2-octanol C. (25,5R)-5-ethoxy-2-octanol d. (4R,75)-4-ethoxy-7-octanol
What is the IUPAC name for the followin: A) 2-Bromo-4-pentylhexane B) (2S,4S)-2-Bromo-4,5-diethylheptane C) 3,4-Die...
What is the IUPAC name for the followin: A) 2-Bromo-4-pentylhexane B) (2S,4S)-2-Bromo-4,5-diethylheptane C) 3,4-Diethyl-6-bromoheptane D) 2-Bromo-4-methylhexane E) (2R,4R)-2-Bromo-4,5-diethylheptane 47. When drawing a curved arrow mechanism, A) the bond that is being formed
Question 3 Identify the correct IUPAC name for the molecule shown below. H2CO HO CHE 2-methoxy-6-methylcyclohexanol...
Question 3 Identify the correct IUPAC name for the molecule shown below. H2CO HO CHE 2-methoxy-6-methylcyclohexanol 2-methyl-6-methoxycyclohexanol 1-methoxy-3-methylcyclohexan-2-ol 2-hydroxy-1-methoxy-3-methylcyclohexane Question 4 Determine whether the following name is correct. If it is incorrect, choose the IUPAC name. 7-ethoxy-2-propyloctan-3-ol The name is correct. o 9-ethoxy-4-methyldecan-5-ol 2-ethoxy-7-methyldecan-6-ol 2-ethoxy-7-propyloctan-6-ol
What is the IUPAC name for the following compound? 9. Br А. 2-Bromo-4-pentylhexane (2S,4S)-2-Bromo-4,5-diethyl heptane С....
What is the IUPAC name for the following compound? 9. Br А. 2-Bromo-4-pentylhexane (2S,4S)-2-Bromo-4,5-diethyl heptane С. В. 3,4-Diethyl-6-bromoheptane 2-Bromo-4-methyl hexa ne (2R,4R)-2-Bromo-4,5-diethyl heptane BCDE
2. Draw structures of the compound based on the given IUPAC name 1) (2E,5E-N-ethyl-N-methylhepta-2,5-dienamide 2) (1R,2R,3R,5R)-1-ethyl-5-isopropyl-3-methyl-2-(3-methylpentyl)cyclohexane...
2. Draw structures of the compound based on the given IUPAC name 1) (2E,5E-N-ethyl-N-methylhepta-2,5-dienamide 2) (1R,2R,3R,5R)-1-ethyl-5-isopropyl-3-methyl-2-(3-methylpentyl)cyclohexane Identify aromatic ring system 3.
2. Draw structures of the compound based on the given IUPAC name 1) (2E,5E-N-ethyl-N-methylhepta-2,5-dienamide 2) (1R,2R,3R,5R)-1-ethyl-5-isopropyl-3-methyl-2-(3-methylpentyl)cyclohexane Identify aromatic ring system 3.
OH 8. What is the correct IUPAC name of the following compound? A) (4R)-4-hydroxymethyl)-4-isobutyl-2-vinylheptane B) (2R)-2-isobutyl-4-methyl-2-propyl-4-penten-1-ol...
OH 8. What is the correct IUPAC name of the following compound? A) (4R)-4-hydroxymethyl)-4-isobutyl-2-vinylheptane B) (2R)-2-isobutyl-4-methyl-2-propyl-4-penten-1-ol (48)-4-hydroxymethyl)-6-methyl-4-propyl-2-vinylheptane D) (28)-2-isobutyl-4-methyl-2-propyl-4-penten-1-ol E) (4R) 4(hydroxymethyl)-6-methyl-4-propyl-2-vinylheptane F) (48)-4-(hydroxymethyl)-4-isobutyl-2-vinylheptane
why is the answer not 6-dibromo-7-tert-butyl-2-chloro-5-isobutyl-9-dimethyldecane? 5. What is the correct IUPAC name of the following...
why is the answer not
6-dibromo-7-tert-butyl-2-chloro-5-isobutyl-9-dimethyldecane?
5. What is the correct IUPAC name of the following compounds? Br Br Molecule A CI Molecule B IUPAC Name of Molecule B: 5,5-dibromo-4-tert-butyl-9-chloro-6-isobutyl-2,2-dimethyldecane
1. Name the following compound. A. (3S,4R)-8-chloro-4-methyloctan-3-ol B. (5S,6R)-1-chloro-5-methyloctan-6-ol C. (3R,4S)-8-chloro-4-methyloctan-3-ol D. (5R6S)-1-chloro-5-methyloctan-6-0l Cl OH 2....
1. Name the following compound. A. (3S,4R)-8-chloro-4-methyloctan-3-ol B. (5S,6R)-1-chloro-5-methyloctan-6-ol C. (3R,4S)-8-chloro-4-methyloctan-3-ol D. (5R6S)-1-chloro-5-methyloctan-6-0l Cl OH 2. What is the reagent needed for the following chemical transformation? OH Cl A. SOCl2, Pyr B. PBr3 C. HCI D. XeCl5
9. What is the correct IUPAC name of the following compound? Br A) 3-bromo-4-sec-butyl-6-chlorobenzaldehyde D) 5-bromo-4-sec-butyl-2-chlorobenzaldehyde...
9. What is the correct IUPAC name of the following compound? Br A) 3-bromo-4-sec-butyl-6-chlorobenzaldehyde D) 5-bromo-4-sec-butyl-2-chlorobenzaldehyde -CHO B) 3-bromo-6-chloro-4-isobutylbenzaldehyde C) 5-bromo-4-butyl-2-chlorobenzaldehyde E) 5-bromo-2-chloro-4-isobutylbenzaldehyde CI
7. The IUPAC name for the followe d in the OH controls a) 3-chloro-2-methylcyclohexanol 5-chloro-2-methylcyclohexanol 2-methyl-3-chlorocyclohexanol...
7. The IUPAC name for the followe d in the OH controls a) 3-chloro-2-methylcyclohexanol 5-chloro-2-methylcyclohexanol 2-methyl-3-chlorocyclohexanol d) 2-methyl-5 chlorocyclohexanol e) 1-chloro-4-methylcyclohexanol Which of the following cannot be an electrophile? a) H b) CH2-CH; c) 'NO ) BF; d) Fee ased on the following enery diagram, which compound is formed slowly Reaction ) B from A c) Cfrom B d) from C a) A from B b 10. Which of the following has the highest priority? -0-H -CH=CHCH -CH=NCH -SC-CH; 11....
What is the IUPAC name of the following compound? a. l-ethoxy-1-methoxy-3-propylcyclohexane b. 1-propyl-3-ethoxy-3-methoxycyclohexane C. 2-ethoxy-2-methoxy-6-cyclohexylnonane d. 1-(3-ethoxy-3-methoxycyclohexyl)-propane What is the IUPAC name for the following compound? ОН a. (2R,55)-5-ethoxy-2-octanol b. (25,5S)-5-ethoxy-2-octanol C. (25,5R)-5-ethoxy-2-octanol d. (4R,75)-4-ethoxy-7-octanol
What is the IUPAC name for the followin: A) 2-Bromo-4-pentylhexane B) (2S,4S)-2-Bromo-4,5-diethylheptane C) 3,4-Diethyl-6-bromoheptane D) 2-Bromo-4-methylhexane E) (2R,4R)-2-Bromo-4,5-diethylheptane 47. When drawing a curved arrow mechanism, A) the bond that is being formed
Question 3 Identify the correct IUPAC name for the molecule shown below. H2CO HO CHE 2-methoxy-6-methylcyclohexanol 2-methyl-6-methoxycyclohexanol 1-methoxy-3-methylcyclohexan-2-ol 2-hydroxy-1-methoxy-3-methylcyclohexane Question 4 Determine whether the following name is correct. If it is incorrect, choose the IUPAC name. 7-ethoxy-2-propyloctan-3-ol The name is correct. o 9-ethoxy-4-methyldecan-5-ol 2-ethoxy-7-methyldecan-6-ol 2-ethoxy-7-propyloctan-6-ol
What is the IUPAC name for the following compound? 9. Br А. 2-Bromo-4-pentylhexane (2S,4S)-2-Bromo-4,5-diethyl heptane С. В. 3,4-Diethyl-6-bromoheptane 2-Bromo-4-methyl hexa ne (2R,4R)-2-Bromo-4,5-diethyl heptane BCDE
2. Draw structures of the compound based on the given IUPAC name 1) (2E,5E-N-ethyl-N-methylhepta-2,5-dienamide 2) (1R,2R,3R,5R)-1-ethyl-5-isopropyl-3-methyl-2-(3-methylpentyl)cyclohexane Identify aromatic ring system 3.
2. Draw structures of the compound based on the given IUPAC name 1) (2E,5E-N-ethyl-N-methylhepta-2,5-dienamide 2) (1R,2R,3R,5R)-1-ethyl-5-isopropyl-3-methyl-2-(3-methylpentyl)cyclohexane Identify aromatic ring system 3.
OH 8. What is the correct IUPAC name of the following compound? A) (4R)-4-hydroxymethyl)-4-isobutyl-2-vinylheptane B) (2R)-2-isobutyl-4-methyl-2-propyl-4-penten-1-ol (48)-4-hydroxymethyl)-6-methyl-4-propyl-2-vinylheptane D) (28)-2-isobutyl-4-methyl-2-propyl-4-penten-1-ol E) (4R) 4(hydroxymethyl)-6-methyl-4-propyl-2-vinylheptane F) (48)-4-(hydroxymethyl)-4-isobutyl-2-vinylheptane
why is the answer not
6-dibromo-7-tert-butyl-2-chloro-5-isobutyl-9-dimethyldecane?
5. What is the correct IUPAC name of the following compounds? Br Br Molecule A CI Molecule B IUPAC Name of Molecule B: 5,5-dibromo-4-tert-butyl-9-chloro-6-isobutyl-2,2-dimethyldecane
1. Name the following compound. A. (3S,4R)-8-chloro-4-methyloctan-3-ol B. (5S,6R)-1-chloro-5-methyloctan-6-ol C. (3R,4S)-8-chloro-4-methyloctan-3-ol D. (5R6S)-1-chloro-5-methyloctan-6-0l Cl OH 2. What is the reagent needed for the following chemical transformation? OH Cl A. SOCl2, Pyr B. PBr3 C. HCI D. XeCl5
9. What is the correct IUPAC name of the following compound? Br A) 3-bromo-4-sec-butyl-6-chlorobenzaldehyde D) 5-bromo-4-sec-butyl-2-chlorobenzaldehyde -CHO B) 3-bromo-6-chloro-4-isobutylbenzaldehyde C) 5-bromo-4-butyl-2-chlorobenzaldehyde E) 5-bromo-2-chloro-4-isobutylbenzaldehyde CI
7. The IUPAC name for the followe d in the OH controls a) 3-chloro-2-methylcyclohexanol 5-chloro-2-methylcyclohexanol 2-methyl-3-chlorocyclohexanol d) 2-methyl-5 chlorocyclohexanol e) 1-chloro-4-methylcyclohexanol Which of the following cannot be an electrophile? a) H b) CH2-CH; c) 'NO ) BF; d) Fee ased on the following enery diagram, which compound is formed slowly Reaction ) B from A c) Cfrom B d) from C a) A from B b 10. Which of the following has the highest priority? -0-H -CH=CHCH -CH=NCH -SC-CH; 11....
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 38 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago