Homework Answers
Add Answer to:
Question 3 Identify the correct IUPAC name for the molecule shown below. H2CO HO CHE 2-methoxy-6-methylcyclohexanol...
What is the IUPAC name of the following compound? a. l-ethoxy-1-methoxy-3-propylcyclohexane b. 1-propyl-3-ethoxy-3-methoxycyclohexane C. 2-ethoxy-2-methoxy-6-cyclohexylnonane d....
What is the IUPAC name of the following compound? a. l-ethoxy-1-methoxy-3-propylcyclohexane b. 1-propyl-3-ethoxy-3-methoxycyclohexane C. 2-ethoxy-2-methoxy-6-cyclohexylnonane d. 1-(3-ethoxy-3-methoxycyclohexyl)-propane What is the IUPAC name for the following compound? ОН a. (2R,55)-5-ethoxy-2-octanol b. (25,5S)-5-ethoxy-2-octanol C. (25,5R)-5-ethoxy-2-octanol d. (4R,75)-4-ethoxy-7-octanol
NOMENCLATURE: Choose the correct IUPAC name for each of the structures below. If the correct name...
NOMENCLATURE: Choose the correct IUPAC name for each of the structures below. If the correct name doesn't appear, choose "none of the above." (3 pts each) 1 HO, H HO H a. (2R 3R)-2,3-butanediol b. (2R 3R)-butane-2,3-diol c. (25,3R)-butane-2,3-diol d. (25,3R)-2,3-butanediol e. none of the above vo a. 1-ethoxy-3-ethylheptane b. 7-ethoxy-5-ethylheptane c. 5-ethyl-5-propoxyheptane d. 3-ethyl-1-ethoxyheptane e. none of the above a. (2E)-2-methyl-6-Isopropyl-heptene b. (2E)-3-isopropyl-2-heptene C. (22)-5-isopropyl-6-heptene d. (22)-3-isopropyl-2-heptene e, none of the above co a. 1,2-epoxy-1,1,3-trimethylcyclohexane b. 1,2-epoxy-1,3,3-trimethylcyclohexane c.1-epoxide-1,3,3-trimethylcyclohexane d....
What is the IUPAC name of the molecule shown below HO Br Select one: O a....
What is the IUPAC name of the molecule shown below HO Br Select one: O a. 7-bromo-2-cycloheptenol b. 1-bromo-3-cyclohepten-2-ol O c. 2-bromo-cycloheptenol O d. 2-bromo-6-cycloheptenol
1) Identify the correct name for the following structure н,с осна A) 3-methoxy-5-methyleyclohepta-1,5-diene B) 6-me...
1) Identify the correct name for the following structure н,с осна A) 3-methoxy-5-methyleyclohepta-1,5-diene B) 6-methoxy-1-methylcyclohepta-1,4-diene C) 7-methoxy-5-methylcyclohepta-1,4-diene D) 4-methoxy-2-methyleyclohepta-1,5-diene 2) Name the alkene shown. Be sure to include the appropriate E or Z label necessary. CH-CH-C H CI 3) Provide a correct IUPAC name for the structure below. Н,с 4) Provide the structure of 1,3,5-heptatriene. 5) Provide the proper IUPAC name for the alkene shown below. CH3 CH, CH CHy CH3 CH2 CH3
Give the IUPAC name of the branched alkane. Identify the locations of the substituents in this...
Give the IUPAC name of the branched alkane. Identify the locations
of the substituents in this molecule.
Give the IUPAC name of the branched alkane. Identify the locations of the substituents in this molecule. 4-methyl 5-methyl 3-methyl 7-methyl 8-methyl 2-methyl 6-methyl
(6 points) 2. Identify whether the following IUPAC names are correct. If the name is correct,...
(6 points) 2. Identify whether the following IUPAC names are correct. If the name is correct, write YES in the box. If the name is incorrect, write NO in the box. You do NOT have to provide a correct name for those that are wrong. Redundant - 1-'s are not shown and are not considered to be wrong if not shown. 3,4,6-trimethyloctane 2,3-diethylheptan-4-01 1-amino-3-bromo-4-methylcyclopentane
What is the correct IUPAC name for the molecule shown below? Moving to the next question...
What is the correct IUPAC name for the molecule shown below?
Moving to the next question prevents changes to this answer. Question 8 What is the correct IUPAC name for the molecule shown below? O (R.E-3-chlorohex-4-en-1-yne O (S,E-3-chlorohex-4-en-1-yne O (RZ-3-chlorohex-4-en-1-yne O (R.E-3-chlorohex-2-en-4-yne O(S,E-3-chlorohex-2-en-4-yne Moving to the next question prevents changes to this answer MacBo F3 4
) Correct name for this molecule Choose the correct name for the molecule @ 2- pentane...
) Correct name for this molecule Choose the correct name for the molecule @ 2- pentane ® 3-pentane ©2-pentene @3-pentene | Choose the correct name for this molecule OH сна- сH - сна- сно @ 2-hydroxa putanal 1,3-dihydroxy butanal © 3-hydroxybutanal Choose the correct name for the molecule Br u 2-methyl-4-bromo he xane Ⓡ4 bromo-2-methyl hexanone 4-bromo-2-methylhexane (CH3)₂N @ trimethylamine Ⓡa-aminopropane © 1,2,3-trimethylamine @a-propylamine 6 Choose the correct name of the molecule CH₃ C = C CH3 @ 2- butene...
The correct IUPAC name of the compound shown is pentyl 5-hydroxy-3- propylcyclohexane carboxylate. HO True False...
The correct IUPAC name of the compound shown is pentyl 5-hydroxy-3- propylcyclohexane carboxylate. HO True False
1. Draw the following molecules, based on their IUPAC name: a) 2-hydroxy-5, 5-dimethylheptanedioic acid; b) 3-hydroxy-7-methylnonanedioic...
1. Draw the following molecules, based on their IUPAC name: a) 2-hydroxy-5, 5-dimethylheptanedioic acid; b) 3-hydroxy-7-methylnonanedioic acid 2. Give the IUPAC name for the following compounds: A) HO OH 3. Circle the name that is correct for each molecule, based on IUPAC rules. V a) 4-methylheptanoate 4-methylbutanoate b) pentyl 4-metylhexanoate c) 3-methylbutyl 4-methylhexanoate d) isobutyl 4-methylhexanoate
What is the IUPAC name of the following compound? a. l-ethoxy-1-methoxy-3-propylcyclohexane b. 1-propyl-3-ethoxy-3-methoxycyclohexane C. 2-ethoxy-2-methoxy-6-cyclohexylnonane d. 1-(3-ethoxy-3-methoxycyclohexyl)-propane What is the IUPAC name for the following compound? ОН a. (2R,55)-5-ethoxy-2-octanol b. (25,5S)-5-ethoxy-2-octanol C. (25,5R)-5-ethoxy-2-octanol d. (4R,75)-4-ethoxy-7-octanol
NOMENCLATURE: Choose the correct IUPAC name for each of the structures below. If the correct name doesn't appear, choose "none of the above." (3 pts each) 1 HO, H HO H a. (2R 3R)-2,3-butanediol b. (2R 3R)-butane-2,3-diol c. (25,3R)-butane-2,3-diol d. (25,3R)-2,3-butanediol e. none of the above vo a. 1-ethoxy-3-ethylheptane b. 7-ethoxy-5-ethylheptane c. 5-ethyl-5-propoxyheptane d. 3-ethyl-1-ethoxyheptane e. none of the above a. (2E)-2-methyl-6-Isopropyl-heptene b. (2E)-3-isopropyl-2-heptene C. (22)-5-isopropyl-6-heptene d. (22)-3-isopropyl-2-heptene e, none of the above co a. 1,2-epoxy-1,1,3-trimethylcyclohexane b. 1,2-epoxy-1,3,3-trimethylcyclohexane c.1-epoxide-1,3,3-trimethylcyclohexane d....
What is the IUPAC name of the molecule shown below HO Br Select one: O a. 7-bromo-2-cycloheptenol b. 1-bromo-3-cyclohepten-2-ol O c. 2-bromo-cycloheptenol O d. 2-bromo-6-cycloheptenol
1) Identify the correct name for the following structure н,с осна A) 3-methoxy-5-methyleyclohepta-1,5-diene B) 6-methoxy-1-methylcyclohepta-1,4-diene C) 7-methoxy-5-methylcyclohepta-1,4-diene D) 4-methoxy-2-methyleyclohepta-1,5-diene 2) Name the alkene shown. Be sure to include the appropriate E or Z label necessary. CH-CH-C H CI 3) Provide a correct IUPAC name for the structure below. Н,с 4) Provide the structure of 1,3,5-heptatriene. 5) Provide the proper IUPAC name for the alkene shown below. CH3 CH, CH CHy CH3 CH2 CH3
Give the IUPAC name of the branched alkane. Identify the locations
of the substituents in this molecule.
Give the IUPAC name of the branched alkane. Identify the locations of the substituents in this molecule. 4-methyl 5-methyl 3-methyl 7-methyl 8-methyl 2-methyl 6-methyl
(6 points) 2. Identify whether the following IUPAC names are correct. If the name is correct, write YES in the box. If the name is incorrect, write NO in the box. You do NOT have to provide a correct name for those that are wrong. Redundant - 1-'s are not shown and are not considered to be wrong if not shown. 3,4,6-trimethyloctane 2,3-diethylheptan-4-01 1-amino-3-bromo-4-methylcyclopentane
What is the correct IUPAC name for the molecule shown below?
Moving to the next question prevents changes to this answer. Question 8 What is the correct IUPAC name for the molecule shown below? O (R.E-3-chlorohex-4-en-1-yne O (S,E-3-chlorohex-4-en-1-yne O (RZ-3-chlorohex-4-en-1-yne O (R.E-3-chlorohex-2-en-4-yne O(S,E-3-chlorohex-2-en-4-yne Moving to the next question prevents changes to this answer MacBo F3 4
) Correct name for this molecule Choose the correct name for the molecule @ 2- pentane ® 3-pentane ©2-pentene @3-pentene | Choose the correct name for this molecule OH сна- сH - сна- сно @ 2-hydroxa putanal 1,3-dihydroxy butanal © 3-hydroxybutanal Choose the correct name for the molecule Br u 2-methyl-4-bromo he xane Ⓡ4 bromo-2-methyl hexanone 4-bromo-2-methylhexane (CH3)₂N @ trimethylamine Ⓡa-aminopropane © 1,2,3-trimethylamine @a-propylamine 6 Choose the correct name of the molecule CH₃ C = C CH3 @ 2- butene...
The correct IUPAC name of the compound shown is pentyl 5-hydroxy-3- propylcyclohexane carboxylate. HO True False
1. Draw the following molecules, based on their IUPAC name: a) 2-hydroxy-5, 5-dimethylheptanedioic acid; b) 3-hydroxy-7-methylnonanedioic acid 2. Give the IUPAC name for the following compounds: A) HO OH 3. Circle the name that is correct for each molecule, based on IUPAC rules. V a) 4-methylheptanoate 4-methylbutanoate b) pentyl 4-metylhexanoate c) 3-methylbutyl 4-methylhexanoate d) isobutyl 4-methylhexanoate
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago