Homework Answers
Add Answer to:
Draw the Halogenation of avenges c arrow push give the structure of (6z) - 6methyl-6-octen-1-yne draw...
Alpha-Carbon Reactions Homework (Chapter 18) NAME 1. Draw the curved arrow mechanism to show the interconversion...
Alpha-Carbon Reactions Homework (Chapter 18) NAME 1. Draw the curved arrow mechanism to show the interconversion of the keto and enol form in either trace acid or base. OH trace OH HO trace H,00 HO OH trace OH HO u mane HO 2. Draw all possible eno tautomers for each molecule (ignoring E/Z stereoisomers).
Draw the curved arrow mechanims for the reactions of but-1-yne with catalytic trifilic acid in water...
Draw the curved arrow mechanims for the reactions of but-1-yne
with catalytic trifilic acid in water to form butan-2-one,
I just can't seem to figure out the last step! Thank you in
advance!
Draw the curved arrow mechanism for the reaction of but-1-yne with catalytic triflic acid in water to form butan-2-one. Follow the instructions under the boxes for each step. Draw all electrons and charges if necessary on all structures, do not show any inorganic side products Add any...
1. a) Draw the structure of an enol of this compound. If no enol is possible,...
1. a) Draw the structure of an enol of this compound. If no enol is possible, write "none possible". b) How many acidic hydrogens (pka <22) does this compound have? c) Can this compound react with I/KOH in the haloform reaction? If so, give the products. If not, state why not. 2. Show how you would make this compound by a malonic ester synthesis or an acetoacetic acid synthesis. hexanoic acid 3. Write in the products of these reactions: NaOCH2CH3...
3. For a) [CH3CH2C(-O)CH2l b) [CH3NHCHCHCH21 1) Draw their possible resonance forms as the Line-Angular structure. 2) Predict the product of the acid-base reaction between more stable resonance forms...
3. For a) [CH3CH2C(-O)CH2l b) [CH3NHCHCHCH21 1) Draw their possible resonance forms as the Line-Angular structure. 2) Predict the product of the acid-base reaction between more stable resonance forms. Use the curved arrow to show the movement of electrons 3) Predict the product of the acid-base reaction between less stable resonance forms. 4) After comparing the reaction mechanisms and its products of 2) and 3). describe your opinion on the difference of stability of product.
3. For a) [CH3CH2C(-O)CH2l b)...
CHEM 3020 Practice exam 3 Give the major organic product for the following reactions: R0, H.2 HO HO Bry 1) Lithium Diso...
CHEM 3020 Practice exam 3 Give the major organic product for the following reactions: R0, H.2 HO HO Bry 1) Lithium Disopropylamide (LDA) 2) CIES o spomen 1) Lithium Disopropyl anide (LDA) OCH, CITOTT 1) OHI 2) CHI OH Give all possible products from the following mixed aldol reaction and show how they can be formed. Show the mechanism for the keto enol tautomerization of 2-propanone in both acid and in base.
(c) Give the structure of 3, a mechanism for its formation, and an explanation of the...
(c) Give the structure of 3, a mechanism for its formation, and an explanation of the stereochemical outcome of the reaction. You must also state how many peaks you would expect in the 'H NMR spectrum of 3. You do not need to give the multiplicity of the peaks CH2Cl2 [4 MARKS] (d) Draw out a general reaction scheme that presents the different types of evidence that can be gathered to support the occurrence of neighbouring group participation. Critically evaluate...
just need (e) to (h) 5. Molecules with an-OH group directly bonded to a C-C sp...
just need (e) to (h)
5. Molecules with an-OH group directly bonded to a C-C sp hybridized carbon are called "enol"'s. The types of chemical reactions which enols undergo are substantially different from those of normal alcohols. By considering the Brensted-Lowry and Lewis acid/base reactivity of an enol, you can predict a few of these differences. (a) Ethenol, the simplest "enol", can react as a BL. base in three different places, by gaining a proton at either of the two...
a. First, circle the leaving group and label the alpha carbon as a. b. Then, label...
a. First, circle the leaving group and label the alpha carbon as a. b. Then, label the adjacent sp3 beta carbons as B. c. Finally, draw in the H's that can get eliminated along with the leaving group in each of these compounds. The first compound has been completed for you. HH می ) و CH3 2. Now, let's perform the elimination to make the Zaitsev (most substituted) product. Draw in the H from before and the curved arrows to...
1. Draw the structures of: a) (Z) 2-iodo-3-methyl-2-heptene b) cis non-3-en-5 yne Give the IUPAC name...
1. Draw the structures of: a) (Z) 2-iodo-3-methyl-2-heptene b) cis non-3-en-5 yne Give the IUPAC name of the following compounds, including steochemistry. a) F CH2CH2Br CH3CE 2. a) Draw the most stable chair conformation of cis 1,3-difluorocyclohexane. b) Draw a Newman projection of 2-iodo-3-methylpentane looking down the 3. Compound X has the formula CoHB2Br4. Compound X reacts with excess H2/Pd to give CATHa6Bra. How many does compound X have? Show how you got your answer. rings 4. For each pair...
3) Show how hex-1-yne might be converted to: a. 1-bromohex-1-ene b. 1,1,2,2-tetrabromohexane C. 2-bromohex-1-ene d. 2-bromohexane...
3) Show how hex-1-yne might be converted to: a. 1-bromohex-1-ene b. 1,1,2,2-tetrabromohexane C. 2-bromohex-1-ene d. 2-bromohexane e. 2,2-dibromohexane 4) For each compound, give the product(s) expected from (1) HgSo./H2SO4-catalyzed hydration and (2) hydroboration-oxidation. a. hex-1-yne b. hex-2-yne c. hex-3-yne d. cyclodecyne 5) Predict the product(s) you would expect from treatment of each compound with (1) dilute, neutral KMnO, and (2) warm, basic KMnO, then dilute acid. a. hex-1-yne b. hex-2-yne c. hex-3-yne d. 2-methylhex-3-yne e. But-1-ene → butan-2-ol 6) Show...
Alpha-Carbon Reactions Homework (Chapter 18) NAME 1. Draw the curved arrow mechanism to show the interconversion of the keto and enol form in either trace acid or base. OH trace OH HO trace H,00 HO OH trace OH HO u mane HO 2. Draw all possible eno tautomers for each molecule (ignoring E/Z stereoisomers).
Draw the curved arrow mechanims for the reactions of but-1-yne
with catalytic trifilic acid in water to form butan-2-one,
I just can't seem to figure out the last step! Thank you in
advance!
Draw the curved arrow mechanism for the reaction of but-1-yne with catalytic triflic acid in water to form butan-2-one. Follow the instructions under the boxes for each step. Draw all electrons and charges if necessary on all structures, do not show any inorganic side products Add any...
1. a) Draw the structure of an enol of this compound. If no enol is possible, write "none possible". b) How many acidic hydrogens (pka <22) does this compound have? c) Can this compound react with I/KOH in the haloform reaction? If so, give the products. If not, state why not. 2. Show how you would make this compound by a malonic ester synthesis or an acetoacetic acid synthesis. hexanoic acid 3. Write in the products of these reactions: NaOCH2CH3...
3. For a) [CH3CH2C(-O)CH2l b) [CH3NHCHCHCH21 1) Draw their possible resonance forms as the Line-Angular structure. 2) Predict the product of the acid-base reaction between more stable resonance forms. Use the curved arrow to show the movement of electrons 3) Predict the product of the acid-base reaction between less stable resonance forms. 4) After comparing the reaction mechanisms and its products of 2) and 3). describe your opinion on the difference of stability of product.
3. For a) [CH3CH2C(-O)CH2l b)...
CHEM 3020 Practice exam 3 Give the major organic product for the following reactions: R0, H.2 HO HO Bry 1) Lithium Disopropylamide (LDA) 2) CIES o spomen 1) Lithium Disopropyl anide (LDA) OCH, CITOTT 1) OHI 2) CHI OH Give all possible products from the following mixed aldol reaction and show how they can be formed. Show the mechanism for the keto enol tautomerization of 2-propanone in both acid and in base.
(c) Give the structure of 3, a mechanism for its formation, and an explanation of the stereochemical outcome of the reaction. You must also state how many peaks you would expect in the 'H NMR spectrum of 3. You do not need to give the multiplicity of the peaks CH2Cl2 [4 MARKS] (d) Draw out a general reaction scheme that presents the different types of evidence that can be gathered to support the occurrence of neighbouring group participation. Critically evaluate...
just need (e) to (h)
5. Molecules with an-OH group directly bonded to a C-C sp hybridized carbon are called "enol"'s. The types of chemical reactions which enols undergo are substantially different from those of normal alcohols. By considering the Brensted-Lowry and Lewis acid/base reactivity of an enol, you can predict a few of these differences. (a) Ethenol, the simplest "enol", can react as a BL. base in three different places, by gaining a proton at either of the two...
a. First, circle the leaving group and label the alpha carbon as a. b. Then, label the adjacent sp3 beta carbons as B. c. Finally, draw in the H's that can get eliminated along with the leaving group in each of these compounds. The first compound has been completed for you. HH می ) و CH3 2. Now, let's perform the elimination to make the Zaitsev (most substituted) product. Draw in the H from before and the curved arrows to...
1. Draw the structures of: a) (Z) 2-iodo-3-methyl-2-heptene b) cis non-3-en-5 yne Give the IUPAC name of the following compounds, including steochemistry. a) F CH2CH2Br CH3CE 2. a) Draw the most stable chair conformation of cis 1,3-difluorocyclohexane. b) Draw a Newman projection of 2-iodo-3-methylpentane looking down the 3. Compound X has the formula CoHB2Br4. Compound X reacts with excess H2/Pd to give CATHa6Bra. How many does compound X have? Show how you got your answer. rings 4. For each pair...
3) Show how hex-1-yne might be converted to: a. 1-bromohex-1-ene b. 1,1,2,2-tetrabromohexane C. 2-bromohex-1-ene d. 2-bromohexane e. 2,2-dibromohexane 4) For each compound, give the product(s) expected from (1) HgSo./H2SO4-catalyzed hydration and (2) hydroboration-oxidation. a. hex-1-yne b. hex-2-yne c. hex-3-yne d. cyclodecyne 5) Predict the product(s) you would expect from treatment of each compound with (1) dilute, neutral KMnO, and (2) warm, basic KMnO, then dilute acid. a. hex-1-yne b. hex-2-yne c. hex-3-yne d. 2-methylhex-3-yne e. But-1-ene → butan-2-ol 6) Show...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 30 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago