Homework Answers
The highlighted structure is Peyer's patches (or aggregated lymphoid nodules).
peyer's patches are located in the small intestine generally in the ileum area.
Peyer's patches also called aggregated lymphoid nodules are the groupings of lymphoid follicles, lie in the mucus membrane that lines our small intestine. Peyer's patches are related to our immune system.
H andy-73-02 the bes e s by the Type here to search о не е
H andy-73-02 the bes e s by the Type here to search о не е
34 2h H-NMR Spectrum of Ester A НЕ НЕ на PPM tr H-NMR Spectrum of Product...
34 2h H-NMR Spectrum of Ester A НЕ НЕ на PPM tr H-NMR Spectrum of Product B НЕ зН зн на НL 0 PPM ) Write a comple te curved arrow mechanism for the bromination reaction below. Include the formation of all intermediates (10 points). нооно а 5) Name the following molecules (8 points total). но, (q 6) When an ester A is treated with one equivalent of sodium methoxide, product B is formed. The 'H-NMR spectra of A and...
Identify the highlighted structure.
Identify the highlighted structure.
Identify the highlighted structure.
Identify the highlighted structure.
Identify the highlighted structure.
Identify the highlighted structure.
7. Identify the highlighted structure.
7. Identify the highlighted structure.
8. Identify the highlighted structure.
8. Identify the highlighted structure.
notebook 4. Identify the tarsal bone in the picture above (highlighted in blue - Click here...
notebook 4. Identify the tarsal bone in the picture above (highlighted in blue - Click here to enter answer- REPORT A PROBLEM
217129 Essie Essi La z en 30 let Identify the highlighted structure.
217129 Essie Essi La z en 30 let Identify the highlighted structure.
6. Assign hydrogens on the structure to each of the NMR peaks by writing the ppm...
6. Assign hydrogens on the structure to each of the NMR peaks by writing the ppm value at which each hydrogen appears Не Hi: H7: Н,о. Hа Н: Hi:. На: Ha на Hs: Hs н 7. Draw the other possible structure that could have formed, and explain what drives this reaction forward. How would the NMR spectrum change for this isomeric compound (Be specific)?
H andy-73-02 the bes e s by the Type here to search о не е
34 2h H-NMR Spectrum of Ester A НЕ НЕ на PPM tr H-NMR Spectrum of Product B НЕ зН зн на НL 0 PPM ) Write a comple te curved arrow mechanism for the bromination reaction below. Include the formation of all intermediates (10 points). нооно а 5) Name the following molecules (8 points total). но, (q 6) When an ester A is treated with one equivalent of sodium methoxide, product B is formed. The 'H-NMR spectra of A and...
Identify the highlighted structure.
Identify the highlighted structure.
Identify the highlighted structure.
7. Identify the highlighted structure.
8. Identify the highlighted structure.
notebook 4. Identify the tarsal bone in the picture above (highlighted in blue - Click here to enter answer- REPORT A PROBLEM
217129 Essie Essi La z en 30 let Identify the highlighted structure.
6. Assign hydrogens on the structure to each of the NMR peaks by writing the ppm value at which each hydrogen appears Не Hi: H7: Н,о. Hа Н: Hi:. На: Ha на Hs: Hs н 7. Draw the other possible structure that could have formed, and explain what drives this reaction forward. How would the NMR spectrum change for this isomeric compound (Be specific)?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 38 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago