The answer is C. Why? Why isn't it E?
Homework Answers
Add Answer to:
The answer is C. Why? Why isn't it E?
The element selenium is in the same...
A) As B) Sb C) P D)Bi E)N 10. In which of the series of elements...
A) As B) Sb C) P D)Bi E)N 10. In which of the series of elements listed below would the elements have most nearly the same atomic radius? A) Na, K. Rb, Cs B)F, CI, Br.I C) Na, Mg. Al, Si D) Sc, Ti, V, Cr E)B, Si, As, Te Which of the following properties, in general, increases from left to right across a period in the periodic table? A) ionic charge 11、 B) atomic radius C) density D) ionization...
the answer is C but why Which element can have both positive and negative oxidation states?...
the answer is C but why
Which element can have both positive and negative oxidation states? a) Be b) Cu c) P d) F e) Ne
Answer: E. Why isn't Hydrogen bonds considered the strongest bond if its also a Dipole-Dipole ?...
Answer: E. Why isn't Hydrogen bonds considered the strongest
bond if its also a Dipole-Dipole ?
84) Of the various chemical bonds in biology, select the strongest one. A) Van Der Waals bond interactions to form water B) Hydrogen bonds to form stable DNA molecules C) A hydrogen atom covalently bonded to one electronegative atom is also attracted to another electronegative atom D) Lipophilic bonds that repulse water E) Covalent bonds
help 2. For each of the following atoms, give the formula of the ion that the...
help
2. For each of the following atoms, give the formula of the ion that the atom is most likely to form and identify that ion as a cation or an anion. a) bromine b) sulfur c) gallium d) rubidium 3. Write the abbreviated electron configuration for the following: a) gain of 2 electrons by selenium b) loss of 3 electrons by gallium 4. a) What is the formula of the compound formed between: (i) Al and Se ii) Ca...
In an experiment, various elements from the same family were reacted with the same element from...
In an experiment, various elements from the same family were reacted with the same element from the halogen family (H). Analysis reveals that all the resulting compounds made from these reactions have the chemical formula UnH. Un is the general symbol being used for these various elements. Based on this analysis, which choice identifies the family to which these various elements belong? O Group 16 O Group 2 O Group 18 O Group 1
Why the answer is D? Why choice C and E cannot be an answer? It looks...
Why the answer is D?
Why choice C and E cannot be an answer? It looks so similar to
me
Can you explain in detail? Also, answer D dosent show any anti
or syn addition,,,, Why?
please explain all A,B,C,D,E, choices with good
explanation
Which of the following alkenes reacts fastest with HCI? CH3 Н; Сн A.H.C=CHCH,CH,CH; B.H3C-C-CH=CH, C. a urc=cellence, caren, e. H CH,CH; CHỊ H | CHỊ CHỊCH CH CHH HH D. Alekene can form tertiary carbocation after...
7. Which element has the following electron configurations? lon: [Ar]3d10 lon (-1 charge): [Kr]5s4d105p6 8. Write t...
7. Which element has the following electron configurations? lon: [Ar]3d10 lon (-1 charge): [Kr]5s4d105p6 8. Write the following in order of increasing size As O Br Br Na Rb Te²- F- 02- 9. Arrange these elements in order of decreasing first ionization energy: CI, S, Sn, Pb 10. Choose the element with a more negative (exothermic) electron affinity in each pair: K or Cs Si or P Ga or Br Mg or s 11. a) Which has a higher ionization...
A species that differs in charge from another atom of the same element: A) is called...
A species that differs in charge from another atom of the same element: A) is called an isotope B) has more or less neutrons C) has lost or gained electrons D) is called an ion E) has the same number of protons I need to know why the incorrect answers are incorrect. Thanks!
2). Iron absorption is aided by a. selenium, b), copper, c), vitamin A, d), vitamin C,...
2). Iron absorption is aided by a. selenium, b), copper, c), vitamin A, d), vitamin C, e) cand d 3). Blood coagulation problems may result from lack of a). vitamin C, b). folate, c). iodine, d) vitamin K, e), vitamin E 4). Which of the following is the recommended weight gain in pregnancy for normal weight women is a). 11-20 pounds, b). 15-25 pounds.cl 25-35 pounds, d. 35-45 pounds, el about 50 pounds 5). How many essential minerals are there?...
To what symmetry point group a molecule of SeCl4 belongs? a) Dah 6) Ta c) C2v...
To what symmetry point group a molecule of SeCl4 belongs? a) Dah 6) Ta c) C2v d) Cav e) Da Problem 14. (10 pts) Does molecule of selenium hexafluoride possesses a symmetry element such as improper rotational axes? a) yes b) no
A) As B) Sb C) P D)Bi E)N 10. In which of the series of elements listed below would the elements have most nearly the same atomic radius? A) Na, K. Rb, Cs B)F, CI, Br.I C) Na, Mg. Al, Si D) Sc, Ti, V, Cr E)B, Si, As, Te Which of the following properties, in general, increases from left to right across a period in the periodic table? A) ionic charge 11、 B) atomic radius C) density D) ionization...
the answer is C but why
Which element can have both positive and negative oxidation states? a) Be b) Cu c) P d) F e) Ne
Answer: E. Why isn't Hydrogen bonds considered the strongest
bond if its also a Dipole-Dipole ?
84) Of the various chemical bonds in biology, select the strongest one. A) Van Der Waals bond interactions to form water B) Hydrogen bonds to form stable DNA molecules C) A hydrogen atom covalently bonded to one electronegative atom is also attracted to another electronegative atom D) Lipophilic bonds that repulse water E) Covalent bonds
help
2. For each of the following atoms, give the formula of the ion that the atom is most likely to form and identify that ion as a cation or an anion. a) bromine b) sulfur c) gallium d) rubidium 3. Write the abbreviated electron configuration for the following: a) gain of 2 electrons by selenium b) loss of 3 electrons by gallium 4. a) What is the formula of the compound formed between: (i) Al and Se ii) Ca...
In an experiment, various elements from the same family were reacted with the same element from the halogen family (H). Analysis reveals that all the resulting compounds made from these reactions have the chemical formula UnH. Un is the general symbol being used for these various elements. Based on this analysis, which choice identifies the family to which these various elements belong? O Group 16 O Group 2 O Group 18 O Group 1
Why the answer is D?
Why choice C and E cannot be an answer? It looks so similar to
me
Can you explain in detail? Also, answer D dosent show any anti
or syn addition,,,, Why?
please explain all A,B,C,D,E, choices with good
explanation
Which of the following alkenes reacts fastest with HCI? CH3 Н; Сн A.H.C=CHCH,CH,CH; B.H3C-C-CH=CH, C. a urc=cellence, caren, e. H CH,CH; CHỊ H | CHỊ CHỊCH CH CHH HH D. Alekene can form tertiary carbocation after...
7. Which element has the following electron configurations? lon: [Ar]3d10 lon (-1 charge): [Kr]5s4d105p6 8. Write the following in order of increasing size As O Br Br Na Rb Te²- F- 02- 9. Arrange these elements in order of decreasing first ionization energy: CI, S, Sn, Pb 10. Choose the element with a more negative (exothermic) electron affinity in each pair: K or Cs Si or P Ga or Br Mg or s 11. a) Which has a higher ionization...
2). Iron absorption is aided by a. selenium, b), copper, c), vitamin A, d), vitamin C, e) cand d 3). Blood coagulation problems may result from lack of a). vitamin C, b). folate, c). iodine, d) vitamin K, e), vitamin E 4). Which of the following is the recommended weight gain in pregnancy for normal weight women is a). 11-20 pounds, b). 15-25 pounds.cl 25-35 pounds, d. 35-45 pounds, el about 50 pounds 5). How many essential minerals are there?...
To what symmetry point group a molecule of SeCl4 belongs? a) Dah 6) Ta c) C2v d) Cav e) Da Problem 14. (10 pts) Does molecule of selenium hexafluoride possesses a symmetry element such as improper rotational axes? a) yes b) no
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago