Homework Answers
Add Answer to:
1. NaOCH2CH3 CH2C 2. CH3CH2CH2CI OCH2CH3 12 3.НО a. Ethyl ethanoate b. Ethyl butanoate d. Butanoic...
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d) methyl 4-phenylpent...
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d) methyl 4-phenylpentanoatef) butyl 3-hydroxyheptanoate 15. Name the following esters CH CH3 H3 C) CH3 b) CH2 CH O-C--CH3 CH3 f CH2 d)
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d)...
Question 7 (1 point) Saved What is the correct name for CH3 CH2COOCH2CH3? a) propyl ethanoate...
Question 7 (1 point) Saved What is the correct name for CH3 CH2COOCH2CH3? a) propyl ethanoate b) methyl butanoate c) ethyl propanoate d) ethyl butanoate Question 6 (1 point) How many carbon atoms are in 3-methyl-4,4-diethyl-5-propyldecane? a) 18 Ob) 20 c) 16 d) 14 What is the correct name for CH2CH2COOCH2CH3? a) propyl ethanoate b) methyl butanoate c) ethyl propanoate d) ethyl butanoate
a propyl ethanoate (full structural) b 3-ethyl-2-methylhexanoic acid (line) C 2-bromocyclopentene (condensed structural) d 2-methyl-3-phenylpentane your...
a propyl ethanoate (full structural) b 3-ethyl-2-methylhexanoic acid (line) C 2-bromocyclopentene (condensed structural) d 2-methyl-3-phenylpentane your choice) Butane-1,2,3-triol (your choice) [insert a photo of your work here] a b е red, greenF. grey C, white d H HH e
classify each of the following as a primary CH-CHE The compound CH -CH-CH-CH-COOH is called a...
classify each of the following as a primary
CH-CHE The compound CH -CH-CH-CH-COOH is called a 3-hexanoic acid b. 2-ethyl pentancate C. 2-ethyl pentanoic acid d. 3-heptanoic acid e 4 -heptanoic acid (ioni 2 Fien) 5. Which equation correctly represents the dissociation of a carbovie acid? CH - -OH a CH-COOH + HO-CHY-COOH, OH b. CHY-COOH-CH.COO + H,0 c CH-COOH + H2O - CH-COO + H,09 d. CHỊ-COOH + HBO - CH2-COOH + MO e CH-COOH +24,0 - CH-C00+ 2H,0*...
Which of the following has the lowest boiling point? | CHG-CH2-CHO - || . CH3-CH2-CH, CH-CH2-CH2-OH...
Which of the following has the lowest boiling point? | CHG-CH2-CHO - || . CH3-CH2-CH, CH-CH2-CH2-OH 20 CH3-CH2-CH-CH CH,CH,COOH Ovo 17. What is the product of oxidation of butanal? 1-butanol D butanoic acid C. 2-butanol d. 2-butanal e. dibutylether 18). O CE, H-C-O - CHCH, is called: methyl isopropyl ester methyl isopropyl ether methylethyl ethanoate isopropyl formate 19. Reaction of CH3-CH-CH2-COOH with CH-CH,OH produces: a. butyl ethanoate ethyl butanoate ethyl propanoate d. propyl butanoate acetyl butanoate
23). In soup action oil and 'Dirt dissolve in which part of the outs a. Hydrophobic, polar side b. Hydrophilic, nou...
23). In soup action oil and 'Dirt dissolve in which part of the outs a. Hydrophobic, polar side b. Hydrophilic, nou polarside C. Hydrophobic, non polar side d. Hydrophilic, polar side e. Hydrophobic and Hydrophilic sides 24) Acid - hydrolysis of Ester called ? a. Esterification b. Sopanification c. d. Reverse esterification e. salt formation Alkalition 25). Name the ester prepared from ethanoic acid and isobutyl alcohol? a. ethyl isobutyrate b. isobutyl ethanoate c. Butyl ethanoate d. t-butyl ethanoate e....
e. E) -CH20H 15. The reaction of butanoic acid and dimethylamine gives a. N-methylbutanamide b. N-ethylbutanamide...
e. E) -CH20H 15. The reaction of butanoic acid and dimethylamine gives a. N-methylbutanamide b. N-ethylbutanamide c. N.N-dimethylbutanamide e. N-methylbutanamine a. amines; esters d. NN-methylbutanamine 16. Amides are derivatives of and b. amines; carboxylic acids c. alkanes; amines d. carboxylic acids; alcohols e. alcohols; carboxylic acids 17. What is the IUPAC name of the following compound? a. propyl butanoate b. butanoic acid c. 1-butanal d. 1-butanoate e propyl methanoate
Which of the following dienes can uñdel 11 E) all of the above D) IV C)...
Which of the following dienes can uñdel 11 E) all of the above D) IV C) ш в) I A) I 12. What is the major organic product obtained from the following reaction? co,CHy .co/CH dо,сн, COCH PCH 2 co,CH .co,CH co,CH co,CH co,CH 4 A) 1 B) 2 C) 3 D) 4 13) What is the name of the following ester? A) propyl ethanoate D) ethyl butanoate B) ethyl propanoate E) None of the above C) ethoxy butanoate 14)...
Which best explains why an acetal can be used as a protecting group for carbonyls during...
Which best explains why an acetal can be used as a protecting group for carbonyls during a Grignard readion (A) The acetal is stable in acid. (B) The acetal prevents reaction of the carbonyl with a strong nucleophile. (C) The reaction is reversible and the acid helps to generate more product (D) To increase the electrophilic nature of the ketone since the Grignard is a weak nucleophile 0909 Select the reagents needed for the synthesis of pentyl butanoate by Fischer...
Draw the structures of the following carbonyl compounds: 4-hydroxypentanoic acid ethyl ethanoate methyl 2-aminobenzoate 4-bromocyclohexanone 1-bromo-2-chloro-cyclopentane...
Draw the structures of the following carbonyl compounds: 4-hydroxypentanoic acid ethyl ethanoate methyl 2-aminobenzoate 4-bromocyclohexanone 1-bromo-2-chloro-cyclopentane carboxylic acid
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d) methyl 4-phenylpentanoatef) butyl 3-hydroxyheptanoate 15. Name the following esters CH CH3 H3 C) CH3 b) CH2 CH O-C--CH3 CH3 f CH2 d)
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d)...
Question 7 (1 point) Saved What is the correct name for CH3 CH2COOCH2CH3? a) propyl ethanoate b) methyl butanoate c) ethyl propanoate d) ethyl butanoate Question 6 (1 point) How many carbon atoms are in 3-methyl-4,4-diethyl-5-propyldecane? a) 18 Ob) 20 c) 16 d) 14 What is the correct name for CH2CH2COOCH2CH3? a) propyl ethanoate b) methyl butanoate c) ethyl propanoate d) ethyl butanoate
a propyl ethanoate (full structural) b 3-ethyl-2-methylhexanoic acid (line) C 2-bromocyclopentene (condensed structural) d 2-methyl-3-phenylpentane your choice) Butane-1,2,3-triol (your choice) [insert a photo of your work here] a b е red, greenF. grey C, white d H HH e
classify each of the following as a primary
CH-CHE The compound CH -CH-CH-CH-COOH is called a 3-hexanoic acid b. 2-ethyl pentancate C. 2-ethyl pentanoic acid d. 3-heptanoic acid e 4 -heptanoic acid (ioni 2 Fien) 5. Which equation correctly represents the dissociation of a carbovie acid? CH - -OH a CH-COOH + HO-CHY-COOH, OH b. CHY-COOH-CH.COO + H,0 c CH-COOH + H2O - CH-COO + H,09 d. CHỊ-COOH + HBO - CH2-COOH + MO e CH-COOH +24,0 - CH-C00+ 2H,0*...
Which of the following has the lowest boiling point? | CHG-CH2-CHO - || . CH3-CH2-CH, CH-CH2-CH2-OH 20 CH3-CH2-CH-CH CH,CH,COOH Ovo 17. What is the product of oxidation of butanal? 1-butanol D butanoic acid C. 2-butanol d. 2-butanal e. dibutylether 18). O CE, H-C-O - CHCH, is called: methyl isopropyl ester methyl isopropyl ether methylethyl ethanoate isopropyl formate 19. Reaction of CH3-CH-CH2-COOH with CH-CH,OH produces: a. butyl ethanoate ethyl butanoate ethyl propanoate d. propyl butanoate acetyl butanoate
23). In soup action oil and 'Dirt dissolve in which part of the outs a. Hydrophobic, polar side b. Hydrophilic, nou polarside C. Hydrophobic, non polar side d. Hydrophilic, polar side e. Hydrophobic and Hydrophilic sides 24) Acid - hydrolysis of Ester called ? a. Esterification b. Sopanification c. d. Reverse esterification e. salt formation Alkalition 25). Name the ester prepared from ethanoic acid and isobutyl alcohol? a. ethyl isobutyrate b. isobutyl ethanoate c. Butyl ethanoate d. t-butyl ethanoate e....
e. E) -CH20H 15. The reaction of butanoic acid and dimethylamine gives a. N-methylbutanamide b. N-ethylbutanamide c. N.N-dimethylbutanamide e. N-methylbutanamine a. amines; esters d. NN-methylbutanamine 16. Amides are derivatives of and b. amines; carboxylic acids c. alkanes; amines d. carboxylic acids; alcohols e. alcohols; carboxylic acids 17. What is the IUPAC name of the following compound? a. propyl butanoate b. butanoic acid c. 1-butanal d. 1-butanoate e propyl methanoate
Which of the following dienes can uñdel 11 E) all of the above D) IV C) ш в) I A) I 12. What is the major organic product obtained from the following reaction? co,CHy .co/CH dо,сн, COCH PCH 2 co,CH .co,CH co,CH co,CH co,CH 4 A) 1 B) 2 C) 3 D) 4 13) What is the name of the following ester? A) propyl ethanoate D) ethyl butanoate B) ethyl propanoate E) None of the above C) ethoxy butanoate 14)...
Which best explains why an acetal can be used as a protecting group for carbonyls during a Grignard readion (A) The acetal is stable in acid. (B) The acetal prevents reaction of the carbonyl with a strong nucleophile. (C) The reaction is reversible and the acid helps to generate more product (D) To increase the electrophilic nature of the ketone since the Grignard is a weak nucleophile 0909 Select the reagents needed for the synthesis of pentyl butanoate by Fischer...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago