Note: there can be more than one common name for an ether as there is no specific rule for the order of alkyl group in common name. Hence, our ether can also have the common name methyl ethyl ether.
Write the common and systematic (IUPAC) names of the ether that has the following structure. H3C-O-CH2CH3...
write the common and systematic (IUPAC) names of the ether that has the following structure CH3---O---CH2CH3 Common name: Systematic name:
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O-CH₂ common name: S E systematic name:
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O -CH3 common name: ethyl methyl ether systematic name: methoxyethane
? What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common name:
What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common name:
? What are the systematic (IUPAC) names for the compounds shown? он. H3C systematic (IUPAC) name: B. H3C—CH2-CH-CH2 CH3 OH systematic (IUPAC) name:
Write the systematic (IUPAC) names for the amines shown below. The names should have the format alkanamine H3C-CH2-N- CH2CH3 CH2 CH2 CH3 H3C-NCH2 CH3 H3C-CH2CH2CH2 amines. These compounds are Select answer
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is Submit Answer Retry Entire Group 3 more group attempts remaining Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is Submit Answer Retry Entire Group 3...
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is