Homework Answers
Add Answer to:
Obtain the reaction orders with respect to the S_2O_8^2- and I^- ions. Remember that your results...
Consider the reaction of ammonium ions (NH and nitrite ions (NO2), shown in Equation 1. NH...
Consider the reaction of ammonium ions (NH and nitrite ions (NO2), shown in Equation 1. NH (aq) +NO2 (aq)N2 (g +2H O 0) Solutions of NH4 and NO2 were mixed in various quantities and the following rate data were obtained at a constant temperature: Experiment Initial [NH4 Initial [NO2] Initial rate for formation of N2 moVL s 3.04 x 10 6.08 x 10 1.22 x 10 0.1507.50 x 10 0.1501.50 102 0.300 1.50x 10 1. Find the order of the...
The reaction between bromate ions and bromide ions in acidic aqueous solution is given by the...
The reaction between bromate ions and bromide ions in acidic aqueous solution is given by the equation BrO3- (aq) + 5 Br – (aq) + 6 H+ (aq) à 3 Br2 (l) + 3 H2O (l) The table below gives the results of four experiments. Using these data, determine the orders for all three reactants, the overall reaction order, and the value of the rate constant. What is the value of k? What are the units of k? Experiment...
g. Using your experimental results, explain why Zn(s) will reduce Cu?, Ag and H+ ions, but...
g. Using your experimental results, explain why Zn(s) will reduce Cu?, Ag and H+ ions, but Zn²+ ions are not reduced by Cu(s) or Ag(s) or H, (g). Reaction E (V) Explanation h. When a piece of silver metal is inserted into a solution of Cus or Agt will there be a reaction? Explain why or why not? Reaction E (V) Explanation
In acidic solution, the iodate ion can be used to react with a number of ions....
In acidic solution, the iodate ion can be used to react with a number of ions. One such reaction is IO3^- +Sn^2+ >I^- +Sn^4+ Since this reaction takes place in acidic solution, H2O and H^+ will be involved in the reaction. Places for these species are indicated by the blanks in the following restatement of the equation: IO3^- +Sn^2+ +__>I^- +Sn^4+ +__ Part A: What are the coefficient of the reactants and produces in the balanced equation above? Remember to...
I will be negalite control a positive control * Homework before The Hill Reaction Lab, your...
I will be negalite control a positive control * Homework before The Hill Reaction Lab, your group should do the following: 1) Write a question that you would like to answer about how different conditions alleet the Hill reaction. Remember, a possible answer to this question should be your hypothesis, not predictions about the specific outcome of an experiment Here is an example: Question: Is there a specific temperature range within which photosynthesis can continue to operate? Hypothesis: There is...
Homework 8-3_1 Reaction Rate Orders, Temp Effects Reaction Rates and Rate Orders The following initial rate...
Homework 8-3_1 Reaction Rate Orders, Temp Effects Reaction Rates and Rate Orders The following initial rate data was collected for the reaction: HI(g) + CHşl(g) à CH.(g) +1-(9) Experiment (HI) (CHI) Initial Rate 0.015 M0.900 M 4.01 x 10M's 0.030 M0.900 M 8.04 x 10'Ms 0.030 M0.450 M 3.99 x 10 m/s 1. What is the rate law for this reaction? a. Rate =k [HI] [CHI] b. Rate = k [HI] [C,H,I] c. Rate = k [HI] (C,H,I] d. Rate...
[17 Marks Q 2(b) The rate equation for the reaction 2NO + O2 -» 2NO2 was...
[17 Marks Q 2(b) The rate equation for the reaction 2NO + O2 -» 2NO2 was determined experimentally to be Rate kINO] [02]. Two mechanisms have been proposed for this reaction: Mechanism A Mechanism B 2NO N202 NO O2 NO3 NO3 + NO → 2NO2 N202 O22NO2 (i) Determine the rate equation for the formation of NO2 by both mechanisms. (i) Under what conditions will both of these mechanisms fit the experimental data? (i) Suggest one reason why either mechanism...
Reaction 2 (Ma Reaction 1 (Mgo) 1. Volume of 1.00 M HCT 2. Final temperature, t 3. Initial temper...
please help fill in data table and answer questions.
please show all work. thank you!
Reaction 2 (Ma Reaction 1 (Mgo) 1. Volume of 1.00 M HCT 2. Final temperature, t 3. Initial temperature, t, EO.O ml 50.0 mt 28 a0 oc 4. Change in temperature, t 5. Mass of solid 203 MgO 6. Heat, q k.J kJ kJ k.I 8. Moles mol Mg mol MgO 9. ΔΗ/mol kJ/mol kJ/mol 10. Determine ΔΗ/mol Mg for reaction (4). (10.) II. Percent...
the reaction is: CaCl2(aq) + Na2CO3(aq) ? CaCO3(s) + 2NaCl(aq) Mass Grams Mass of CaCl Mass...
the reaction is: CaCl2(aq) +
Na2CO3(aq) ? CaCO3(s) +
2NaCl(aq)
Mass Grams Mass of CaCl Mass of Na2CO Mass of Filter Paper Mass of Product, CaCO3 (Experimental Yield) Experimental Observations 2 gm 2.5 gm 2.3 gm 2.4 gm 1. What is the proper name of CaCO? When is it used in real life? 2. What happened to the excess reactant after the reaction was complete? 3. What was the limiting reagent in your experiment? Show your calculations that prove this....
Write the balanced I want to question for the reaction between silver (I) ions and tin....
Write the balanced I want to question for the reaction between
silver (I) ions and tin.
← → O 仚 | Owww3.diem21lats.constuderanmode-assign&assigrrnert-11 . Ag +Sn NGI 2 Mouse over the grey boxes for infonmation on coefficients formulas, charges and states cf tler the oomponents of a chemical Write the balanced ionic equation for the reaction between silver () ions and tin. Work Problem art F O Type here to search
Consider the reaction of ammonium ions (NH and nitrite ions (NO2), shown in Equation 1. NH (aq) +NO2 (aq)N2 (g +2H O 0) Solutions of NH4 and NO2 were mixed in various quantities and the following rate data were obtained at a constant temperature: Experiment Initial [NH4 Initial [NO2] Initial rate for formation of N2 moVL s 3.04 x 10 6.08 x 10 1.22 x 10 0.1507.50 x 10 0.1501.50 102 0.300 1.50x 10 1. Find the order of the...
g. Using your experimental results, explain why Zn(s) will reduce Cu?, Ag and H+ ions, but Zn²+ ions are not reduced by Cu(s) or Ag(s) or H, (g). Reaction E (V) Explanation h. When a piece of silver metal is inserted into a solution of Cus or Agt will there be a reaction? Explain why or why not? Reaction E (V) Explanation
I will be negalite control a positive control * Homework before The Hill Reaction Lab, your group should do the following: 1) Write a question that you would like to answer about how different conditions alleet the Hill reaction. Remember, a possible answer to this question should be your hypothesis, not predictions about the specific outcome of an experiment Here is an example: Question: Is there a specific temperature range within which photosynthesis can continue to operate? Hypothesis: There is...
Homework 8-3_1 Reaction Rate Orders, Temp Effects Reaction Rates and Rate Orders The following initial rate data was collected for the reaction: HI(g) + CHşl(g) à CH.(g) +1-(9) Experiment (HI) (CHI) Initial Rate 0.015 M0.900 M 4.01 x 10M's 0.030 M0.900 M 8.04 x 10'Ms 0.030 M0.450 M 3.99 x 10 m/s 1. What is the rate law for this reaction? a. Rate =k [HI] [CHI] b. Rate = k [HI] [C,H,I] c. Rate = k [HI] (C,H,I] d. Rate...
[17 Marks Q 2(b) The rate equation for the reaction 2NO + O2 -» 2NO2 was determined experimentally to be Rate kINO] [02]. Two mechanisms have been proposed for this reaction: Mechanism A Mechanism B 2NO N202 NO O2 NO3 NO3 + NO → 2NO2 N202 O22NO2 (i) Determine the rate equation for the formation of NO2 by both mechanisms. (i) Under what conditions will both of these mechanisms fit the experimental data? (i) Suggest one reason why either mechanism...
please help fill in data table and answer questions.
please show all work. thank you!
Reaction 2 (Ma Reaction 1 (Mgo) 1. Volume of 1.00 M HCT 2. Final temperature, t 3. Initial temperature, t, EO.O ml 50.0 mt 28 a0 oc 4. Change in temperature, t 5. Mass of solid 203 MgO 6. Heat, q k.J kJ kJ k.I 8. Moles mol Mg mol MgO 9. ΔΗ/mol kJ/mol kJ/mol 10. Determine ΔΗ/mol Mg for reaction (4). (10.) II. Percent...
the reaction is: CaCl2(aq) +
Na2CO3(aq) ? CaCO3(s) +
2NaCl(aq)
Mass Grams Mass of CaCl Mass of Na2CO Mass of Filter Paper Mass of Product, CaCO3 (Experimental Yield) Experimental Observations 2 gm 2.5 gm 2.3 gm 2.4 gm 1. What is the proper name of CaCO? When is it used in real life? 2. What happened to the excess reactant after the reaction was complete? 3. What was the limiting reagent in your experiment? Show your calculations that prove this....
Write the balanced I want to question for the reaction between
silver (I) ions and tin.
← → O 仚 | Owww3.diem21lats.constuderanmode-assign&assigrrnert-11 . Ag +Sn NGI 2 Mouse over the grey boxes for infonmation on coefficients formulas, charges and states cf tler the oomponents of a chemical Write the balanced ionic equation for the reaction between silver () ions and tin. Work Problem art F O Type here to search
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago