10 pts Question9 Which reaction product is formed at 100°C? Br DMF Br Br IV O...
1. Predict the product(s) (or no reaction) and reagent(s). (19 pts) KN3 DMF KOMe DMF KOE -Br HMPA LDA THF NaO'Bu toluene
Provide the major product for the following reaction? Br NaCl, DMF OX / C
VII. (12 pts) Consider the following Sn2 reaction. Br -CN DMF a. assign configuration to the chirality center of the substrate. b. Write the structure of the product. c. assign configuration to the chirality center of the product.
VII. (12 pts) Consider the following Sn2 reaction. Br *CN DMF a. assign configuration to the chirality center of the substrate. b. Write the structure of the product. c. assign configuration to the chirality center of the product.
7. Which reaction intermediate is formed when 4-methylcyclohexene reacts with Bez dissolved in CCL? [ Br Ho HC Hac Br 8. Which reaction is not stereospecific? trans-2-Butene_ Bra/CCIA cis-2-Pentene Pentene Bry/H20 trans-2-Hexene — HBr 1-Methylcyclohexene Da/Pd IV TV 9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF - CN
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
What is the major product of the following reaction? Brz N H Br I. Br IV. W Br B Z-T II. V. 7-10 :ユー Br Br III. Br O ov 1 ON
4. Consider the substitution reaction below. (4 pts.) NaSH DMF Br SH this reaction proceeds through an Snl mechanism and not an SN2 mechanism a) Explain why this reaction proceeds through an b) Explain why this reaction produces a racemic mixture of products
Draw a detailed mechanism for the following transformation 1. Br. Br HBr HO 2. What are the major product (s) formed in the following substitution reaction? Draw as Fisher projections CH;CH2ОH CH-CHз Нас— вr CH2CH2CH3 Draw the mechanism for the following reaction. 3. HO Br Draw the major organic product(s) produced in the following reaction as Fischer projection. 4. CHз ОСHЗ Н NaN3 Н. -CH3 Н- Br DMSO CH3 Draw the mechanism for the following reaction to demonstrate how the...
What is the product of the following reaction? entisexex Br Br OL O II O III O IV O a mixture of II and III