Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
e&f only
Problem 3 Consider two quantity-setting firms that produce a homogeneous good. The inverse demand...
Consider an industry composed of four firms which produce a homogeneous good with inverse demand ...
Consider an industry composed of four firms which produce a homogeneous good with inverse demand P(Y) 100-Y where Y - Notice that this set-up implies the firms compete in quantities. The firms have similar c(y) 20y production costs defined as a) Compute firm profits from the Nash equilibrium. b) Show that a merger between firms one and two is not profitable. c) Suppose that a merger between firms one and two will generate cost synergies s where s is a...
= Consider an industry consisting of two firms which produce a homogeneous commodity. The industry demand...
= Consider an industry consisting of two firms which produce a homogeneous commodity. The industry demand function is Q = 100 – P, where Q is the quantity demanded and P is its price. The total cost functions are given as C1 = 50q1 for firm 1, and C2 = 60qz for firm 2, where Q 91 +92. a. (6 points) Suppose both firms are Cournot duopolists. Find and graph each firm's reaction function. What would be the equilibrium price,...
Due Date: June 21, 2019 1. Consider the market for ayran. There are two firms producing...
Due Date: June 21, 2019 1. Consider the market for ayran. There are two firms producing ayran: Merve (firm 1) and Sutas (firm 2). Inverse demand function for ayran is given as: P = 110 qi-92- Both firms have a cost function of C(x) = x2, where x is the amount produced. (a) What is the Nash equilibrium if they choose the level of production at the same time? What are the profits of each firm? (b) Suppose now Merve...
Suppose there are two firms in a market producing differentiated products. Both firms have MC=0. The...
Suppose there are two firms in a market producing differentiated products. Both firms have MC=0. The demand for firm 1 and 2’s products are given by: q1(p1,p2) = 5 - 2p1 + p2 q2(p1,p2) = 5 - 2p2 + p1 a. First, suppose that the two firms compete in prices (i.e. Bertrand). Compute and graph each firm’s best response functions. What is the sign of the slope of the firms’ best-response functions? Are prices strategic substitutes or complements? b. Solve...
2. There are two firms in a market that produce an identical good, both with marginal...
2. There are two firms in a market that produce an identical good, both with marginal cost MC=10. Fixed costs are zero for both firms. Suppose inverse demand for a product is P= 130 – e a) If the firms set the monopoly price and split the monopoly quantity. What quantities do they choose and what profit do they receive? b) Suppose they set quantities simultaneously. That is, suppose the firms play a Cournot game. What quantities do they choose...
Mathematical Question 3 (30pts) 3. Consider two firms are performing Cournot price competition in two differentiated...
Mathematical Question 3 (30pts) 3. Consider two firms are performing Cournot price competition in two differentiated goods markets. Firm 1 produces goods 1, and firm 2 produces goods 2, and two market demand functions are given by 91 (P1,P2) = 12-2p1 + P2 and 921,P2) = 12-2p2 + P 1. Furthermore, assume that the two firms have the same cost function such that fixed cost is $20 and variable cost is zero. a. (10pts) Calculate the equilibrium prices, quantities and...
1. (25 points) Consider two firms, 1 and 2, producing an identical good simul taneously. This...
1. (25 points) Consider two firms, 1 and 2, producing an identical good simul taneously. This good has market demand given by the demand function y (12 p)/3, where p is price, and y yi y2 is market quantity. yi represents the amount produced by firm i. Suppose production cost is 2yi1 for each firms (a) Solve algebraically for these firms' reaction functions, expressing each firm's optimal output level given the level of its competitor's out- put.(5 pts) (b) Graph...
2. Two firms produce homogeneous products. Market demand is given by Q = 40-P, and each firm face...
2. Two firms produce homogeneous products. Market demand is given by Q = 40-P, and each firm faces a marginal cost of production of 4 per unit The timing of the game is as follows. In Period 1, firm 1 chooses the quantity q it will sell. In Period 2, firm 2 (who observed firm 1s choice in period 1) chooses whether or not to enter the market. If firm 2 chooses to enter it must pay an entry fee...
1.Consider an industry with only two firms that produce identical products. Each of the firms only...
1.Consider an industry with only two firms that produce identical products. Each of the firms only incurs a fixed cost of $1000 to produce and marginal cost is 20. The market demand function is as follows: Q=q1+q2=400-P a. Assuming that the firms form a cartel, calculate the profit-maximizing quantity of output, price and profits b. If the firms choose to behave as in the Cournot model, what would be the profit- maximizing quantities of output, price and profits? c. if...
Two profit-maximizing firms compete in a market. Firm 1 chooses quantity qı > 0 and Firm...
Two profit-maximizing firms compete in a market. Firm 1 chooses quantity qı > 0 and Firm 2 chooses quantity 42 > 0. The market price is: p(91,92) = 8 - 2q1 - 42. The cost to Firm 1 of producing qi is C1 = 41. The cost to Firm 2 of producing 92 is C2 = 42 + 42. a.) * Calculate the best-response function for each firm. b.) Suppose the two firms choose their quantities simultaneously. What is the...
Consider an industry composed of four firms which produce a homogeneous good with inverse demand P(Y) 100-Y where Y - Notice that this set-up implies the firms compete in quantities. The firms have similar c(y) 20y production costs defined as a) Compute firm profits from the Nash equilibrium. b) Show that a merger between firms one and two is not profitable. c) Suppose that a merger between firms one and two will generate cost synergies s where s is a...
= Consider an industry consisting of two firms which produce a homogeneous commodity. The industry demand function is Q = 100 – P, where Q is the quantity demanded and P is its price. The total cost functions are given as C1 = 50q1 for firm 1, and C2 = 60qz for firm 2, where Q 91 +92. a. (6 points) Suppose both firms are Cournot duopolists. Find and graph each firm's reaction function. What would be the equilibrium price,...
Due Date: June 21, 2019 1. Consider the market for ayran. There are two firms producing ayran: Merve (firm 1) and Sutas (firm 2). Inverse demand function for ayran is given as: P = 110 qi-92- Both firms have a cost function of C(x) = x2, where x is the amount produced. (a) What is the Nash equilibrium if they choose the level of production at the same time? What are the profits of each firm? (b) Suppose now Merve...
2. There are two firms in a market that produce an identical good, both with marginal cost MC=10. Fixed costs are zero for both firms. Suppose inverse demand for a product is P= 130 – e a) If the firms set the monopoly price and split the monopoly quantity. What quantities do they choose and what profit do they receive? b) Suppose they set quantities simultaneously. That is, suppose the firms play a Cournot game. What quantities do they choose...
Mathematical Question 3 (30pts) 3. Consider two firms are performing Cournot price competition in two differentiated goods markets. Firm 1 produces goods 1, and firm 2 produces goods 2, and two market demand functions are given by 91 (P1,P2) = 12-2p1 + P2 and 921,P2) = 12-2p2 + P 1. Furthermore, assume that the two firms have the same cost function such that fixed cost is $20 and variable cost is zero. a. (10pts) Calculate the equilibrium prices, quantities and...
1. (25 points) Consider two firms, 1 and 2, producing an identical good simul taneously. This good has market demand given by the demand function y (12 p)/3, where p is price, and y yi y2 is market quantity. yi represents the amount produced by firm i. Suppose production cost is 2yi1 for each firms (a) Solve algebraically for these firms' reaction functions, expressing each firm's optimal output level given the level of its competitor's out- put.(5 pts) (b) Graph...
2. Two firms produce homogeneous products. Market demand is given by Q = 40-P, and each firm faces a marginal cost of production of 4 per unit The timing of the game is as follows. In Period 1, firm 1 chooses the quantity q it will sell. In Period 2, firm 2 (who observed firm 1s choice in period 1) chooses whether or not to enter the market. If firm 2 chooses to enter it must pay an entry fee...
Two profit-maximizing firms compete in a market. Firm 1 chooses quantity qı > 0 and Firm 2 chooses quantity 42 > 0. The market price is: p(91,92) = 8 - 2q1 - 42. The cost to Firm 1 of producing qi is C1 = 41. The cost to Firm 2 of producing 92 is C2 = 42 + 42. a.) * Calculate the best-response function for each firm. b.) Suppose the two firms choose their quantities simultaneously. What is the...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 54 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago