Answer a) and b)
Specifically b)
Homework Answers
Add Answer to:
Answer a) and b)
Specifically b)
1) Chromium (Cr) reacts with oxygen (O) to form two...
1. Three binary compounds composed of bromine and oxygen were decomposed and the mass of each...
1. Three binary compounds composed of bromine and oxygen were decomposed and the mass of each element in a sample of each compound determined. The results were: Cpd 1: 7.21 g O and 72.0 g Br Cpd 2: 4.68 g O and 11.7 g Br Cpd 3: 5.43 g O and 18.1 g Br a) Calculate the ratio of g Br/g O for each compound. b) Are the ratios from (a) consistent with the Law of Multiple...
Please answer ALL questions, not just 1. Specifically in need for 3-8. 1. Determine the formula...
Please answer ALL questions, not just 1. Specifically in need for 3-8. 1. Determine the formula weight for each compound: sulfur tetrafluoride, carbon dioxide, sodium chloride, phosphorus pentafluoride, calcium phosphate, water, propane (C3H8), iron(III) sulfate. Which compounds would also have a molecular weight or molar mass? What is the difference between a formula weight and a molecular weight? 2. Determine the percent composition for each compound in question 1. Is it possible for two compounds to have the same percent...
I need each question answered. #6-12 6. Calculate the number of nitrogen atoms are present in...
I need each question answered. #6-12
6. Calculate the number of nitrogen atoms are present in each of the following quantities. A) 8.45x10 kg nitric acid B) 1280 dg of calcium nitrate 7. Write the empirical formula of the following compounds. A) H2S2 D) Co:PO B) ZnP203 E) C:H16012 C) C12H1oCl2 F) Au204 8. First balance the equation below the answer the questions that follow. ZrCN(aq) + Al2(S2O3)3(aq) — Zr2S2O3(s) + A) How many moles of ZnSO, of can form...
2.1 MULTIPLE CHOICE 1) Which element has the chemical symbol, P? Al lead B) phosphorus platinum...
2.1 MULTIPLE CHOICE 1) Which element has the chemical symbol, P? Al lead B) phosphorus platinum D) potassium to water is formed if 3.2 of methane reacts with 12. Me react to form carbon code and water. What of open to produce 3.3 o carbon dioxide? A1724 14.88 DJ 160 3) Which of the following two whom we stopes? 2.2 OTHER QUESTIONS (Fill in the blank, TRUE or FALSE and calculations) On and Complete the sentences in questions and using...
1. The reaction 6f propane with oxygen follows the reaction below: Equation1 ) Balance Equation 1...
1. The reaction 6f propane with oxygen follows the reaction below: Equation1 ) Balance Equation 1 above i) is the above reaction endothermic or exothermic? Enstem i) Classify the reaction above as combination, single displacement, double displacement, decomposition or combustion. comba How much heat was produced in Equation 1 if it can heat 100 g of water from 32 °C? to 40 Is the energy in propane potential or kinetic energy? P。hhi vi) Given that 1 mole of propane produces...
1. Four elements make up 96% of the molecules involved chemical a) Oxygen, (0), b) Nitrogen...
1. Four elements make up 96% of the molecules involved chemical a) Oxygen, (0), b) Nitrogen (N), c) Carbon (C), d) Hydrogen (H) Ne in chemical evolution. Which of the following is not one of these? 2. During Chemical Evolution, elements reacted with each other to form sl norga compounds is thought to have been a critical solvent for elements and simple molec Oxygen ef Water molecules? a) Formaldehyde b) Carbon dloxide c) Ammonia d lipid bilayer was important because:...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
please complete the questions has not answering with clarification of the answer to any page Name...
please complete the questions has not answering with
clarification of the answer to any page
Name Lab Section _Date The Mole Concept and Atomic Weights The purpose of this activity is to better understand the concepts of relative atomic mass, counting by weighing and the mole. Percent composition and average atomic mass are included. Part I. Relative Atomic Masses and the Mole - Early Method When John Dalton proposed his atomic theory, he stated that the atoms of each element...
if you can't answer all ,please don't answer 1) of the reactions below, which one is...
if you can't answer all ,please don't answer
1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
I need each question answered. #6-12
6. Calculate the number of nitrogen atoms are present in each of the following quantities. A) 8.45x10 kg nitric acid B) 1280 dg of calcium nitrate 7. Write the empirical formula of the following compounds. A) H2S2 D) Co:PO B) ZnP203 E) C:H16012 C) C12H1oCl2 F) Au204 8. First balance the equation below the answer the questions that follow. ZrCN(aq) + Al2(S2O3)3(aq) — Zr2S2O3(s) + A) How many moles of ZnSO, of can form...
2.1 MULTIPLE CHOICE 1) Which element has the chemical symbol, P? Al lead B) phosphorus platinum D) potassium to water is formed if 3.2 of methane reacts with 12. Me react to form carbon code and water. What of open to produce 3.3 o carbon dioxide? A1724 14.88 DJ 160 3) Which of the following two whom we stopes? 2.2 OTHER QUESTIONS (Fill in the blank, TRUE or FALSE and calculations) On and Complete the sentences in questions and using...
1. The reaction 6f propane with oxygen follows the reaction below: Equation1 ) Balance Equation 1 above i) is the above reaction endothermic or exothermic? Enstem i) Classify the reaction above as combination, single displacement, double displacement, decomposition or combustion. comba How much heat was produced in Equation 1 if it can heat 100 g of water from 32 °C? to 40 Is the energy in propane potential or kinetic energy? P。hhi vi) Given that 1 mole of propane produces...
1. Four elements make up 96% of the molecules involved chemical a) Oxygen, (0), b) Nitrogen (N), c) Carbon (C), d) Hydrogen (H) Ne in chemical evolution. Which of the following is not one of these? 2. During Chemical Evolution, elements reacted with each other to form sl norga compounds is thought to have been a critical solvent for elements and simple molec Oxygen ef Water molecules? a) Formaldehyde b) Carbon dloxide c) Ammonia d lipid bilayer was important because:...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
please complete the questions has not answering with
clarification of the answer to any page
Name Lab Section _Date The Mole Concept and Atomic Weights The purpose of this activity is to better understand the concepts of relative atomic mass, counting by weighing and the mole. Percent composition and average atomic mass are included. Part I. Relative Atomic Masses and the Mole - Early Method When John Dalton proposed his atomic theory, he stated that the atoms of each element...
if you can't answer all ,please don't answer
1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 57 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago