5. Complete the following triacylglycerol reactions: a. Complete Hydrogenation: CH2-0-C-(CH3)-CH-CH (CH)s-CH CH-0-C-(CHỊhCH=CH-(CHỊ) -CH, + 3H, Ni,...
Part A The product of this reaction is CH2-0-C-(CH2)7-CH=CH-(CH2)2-CHz Ni, CH-0C-(CH3)3-CH=CH-(CHỊ)-CH, + 3H, 10 CH2-0-C-(CH2)-CH=CH-(CH2)-CH glyceryl trioleate. e glyceryl tristearate. glyceryl tripalmitate glyceryl tricaprate. Submit Request Answer Provide Feedback
"He the following triacylglycerol is Hć 0-C-(CH2)OCH LOH C-(CH2) CH3 + 3H,0 OH + 3 Horc- HC HySO4 O-C-(CH2)10CH a) Label which fatty acid formed has the highest melting point? (0.5 pts) b) What type of molecule would have formed if the triacylglycerol was hydrolyzed using NaOH? -(0.5 pts) Extra Credit (2 pts): Discuss in detail why phosphoacylglycerols are more water soluble than triacylglycerols.
19) The structure is that of a CH3-(CH2)14-0-0-(CH2)25-CH3 A) fatty acid B) steroid C) wax D) triacylglycerol E) glycerophospholipid 20) What type of lipid is the following compound? CH,OC(CH2) 16CH3 10 CHOC(CH2) 14CH3 CHOC(CH2)18CH A) steroid B) bile salt C) glycerophospholipid D) triacylglycerol E) wax
Give common names: a. C CHZ CH-CH3 OH ?. d. CH3 CH2-0-CH2-CH2-CH2-CH3 b. 0 CH2 CH CH2 CH2 CH3 CH2CH3 2 e. CH3 N CH2-CH2-CH3
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid
find the products of the following reactions 0 d) (Z)- CH3 (CH2), CH = CH (CH2), cooh + Cc Hs 0-0-0-H А А + H₂ot
complete the following reactions LE H3C-CH2-C-CH3 NaOH ОН HO + HO K2Cr2O7 H2C-CH-CH2-OH CH3 4x OH + HBr
Post Lab questions 1. Complete the following reactions and name the products. CH3 -CH=CH2 + CI + Brz c) CH3 -CH=CH-CH, + HBr - Pt d) CH3 -CH2-CH=CH2 + H 25 °C, I am A Bez 2. Toluene contains a benzene ring with three double bonds in it, but still does not show any signs of undergoing a reaction with bromine solution. Why? 3. Why doesn't cyclohexane decolorize the orange-red color of the bromine or the purple color of KMnO...
Post Lab questions 1. Complete the following reactions and name the products. a) CH3 -CH=CH2 CI + b) + Bry c) CH3 -CH=CH-CH3 + HBE Pt d) CH3 -CH2-CH=CH2 + H 25 °C, 1 atm e) + Brz 2. Toluene contains a benzene ring with three double bonds in it, but still does not show any signs of undergoing a reaction with bromine solution. Why? 3. Why doesn't cyclohexane decolorize the orange-red color of the bromine or the purple color...
5. Use the structure of the peptide to complete the problems/questions following. CH2 CH-OH CH2 CH3 CH2 NH NH2 a. (4 pts) Name (full name) the N-terminal amino acid? b. (4 pts) Name (full name) the C-terminal amino acid? c. (5 pts) Using the 1 letter amino acid abbreviation, give the name of the peptide.