Homework Answers
thank
you vmuch...
We were unable to transcribe this image
Add Answer to:
(3) The following amounts of water at the given temperatures are mixed. What will be temperature...
(1) H2SO4 + Al Al(SO4)3 + H2 (a) Balance the reaction (b) 17.0 g of Al...
(1) H2SO4 + Al Al(SO4)3 + H2 (a) Balance the reaction (b) 17.0 g of Al will produce how many liters of H2 (pressure = 1500 torr, temp. - 175 C)? (c) To collect 28.5 L of H (P - 3510 torr , temp = 29.0C) over water, how many ml of 6.00 M H2SO4 are required ? Vapor pressure of water at 29.0 C - 32.0 torr. (2) 57.0 g of N2.3.0 mol of O2 and 18.0 g of...
3. What determines whether the equilibrium temperature of a mixture of two amounts of water will...
3. What determines whether the equilibrium temperature of a mixture of two amounts of water will be closer to the initially cooler or warmer water? A) the temperature of the water B) the amounts of water at each temperature. C) neither the temperature or amounts of water at each temperature. D) both the temperature and amounts of water at each temperature. 4. The amount of internal energy in the water is proportional to what quantities? A) the mass of the...
#6 When 108 g of water at a temperature of 21.1 °C is mixed with 65.7...
#6 When 108 g of water at a temperature of 21.1 °C is mixed with 65.7 g of water at an unknown temperature, the final temperature of the resulting mixture is 47.6 °C. What was the initial temperature of the second sample of water? (The specific heat capacity of liquid water is 4.184 J/g ⋅ K.) Initial temperature = °C
Introduction If a cup of cold water is mixed with a cup of hot water, the...
Introduction If a cup of cold water is mixed with a cup of hot water, the final temperature of the mixture will be between the two initial temperatures. Using information on the temperature and volume of the hot and the cold water, the final temperature of the mixture could be predicted. This virtual experiment involves mixing of equal volume of cold and hot water and prediction of the final temperature of the mixture. Procedure Step 1 To get equal volume...
Problem 8: Two amounts of salt water at different temperatures are brought into thermal contact with...
Problem 8: Two amounts of salt water at different temperatures are brought into thermal contact with each other and mixed thoroughly. The first amount of water has mass m, = 0.302 kg and its initial temperature is T, = 7.61 °C. The second has a mass of m2 = 0.873 kg and an initial temperature of T2 = 34.5 °C. Assume that the system is isolated. Let the specific heat of the water at this salinity to be Cw=0.84 kcal...
In a coffee cup calorimeter, 6.70 g of NH4NO3 is mixed with 75.0 g of water...
In a coffee cup calorimeter, 6.70 g of NH4NO3 is mixed with 75.0 g of water at an initial temperature of 25.0 °C. At the end of the dissolution, the final temperature of the mixture is 13.1 °C. With the assumption that the solution has the same specific heat capacity as water and is accompanied by no heat loss to the calorimeter, calculate the enthalpy change for the dissolution of NH4NO3 in kJ/mol. en ott 46.6 94.5 47.2 3.0 80.1
An known mass of liquid water at 25.0 °C is mixed with 65.0 g of water...
An known mass of liquid water at 25.0 °C is mixed with 65.0 g of water at 95.0 °C. The final temperature of the combined water is 49.6 °C. What was the mass of the cooler sample of water? What equation is used for this question.
If 25.0 g H2O at 85.0°C is mixed in a coffee-cup calorimeter with 15.0 g H2O...
If 25.0 g H2O at 85.0°C is mixed in a coffee-cup calorimeter with 15.0 g H2O at 20.0°C, what is the final temperature of the mixture? The specific heat of water is 4.18 J/g·°C.
1. 50 mL of water at 51.9°C were mixed with 50 mL of water at 23.2°C...
1. 50 mL of water at 51.9°C were mixed with 50 mL of water at 23.2°C in a calorimeter also at 23.2°C. The final temperature was 33.1°C. Assuming that neither the density of water nor its specific heat capacity change with temperature, calculate the total heat capacity of the calorimeter. (density of water = 1.00 g mlº', specific heat capacity=4.18 J g?K=) 2. When 5.00 g of NaOH(s) are added to 100 g of water (using the same calorimeter as...
What is the final temperature when 63.4 g of water at 80.3°C is mixed with 39.5...
What is the final temperature when 63.4 g of water at 80.3°C is mixed with 39.5 g of water at 26.1°C? (The specific heat of water is 4.184 J/g °C.) T- Joc
(1) H2SO4 + Al Al(SO4)3 + H2 (a) Balance the reaction (b) 17.0 g of Al will produce how many liters of H2 (pressure = 1500 torr, temp. - 175 C)? (c) To collect 28.5 L of H (P - 3510 torr , temp = 29.0C) over water, how many ml of 6.00 M H2SO4 are required ? Vapor pressure of water at 29.0 C - 32.0 torr. (2) 57.0 g of N2.3.0 mol of O2 and 18.0 g of...
Problem 8: Two amounts of salt water at different temperatures are brought into thermal contact with each other and mixed thoroughly. The first amount of water has mass m, = 0.302 kg and its initial temperature is T, = 7.61 °C. The second has a mass of m2 = 0.873 kg and an initial temperature of T2 = 34.5 °C. Assume that the system is isolated. Let the specific heat of the water at this salinity to be Cw=0.84 kcal...
In a coffee cup calorimeter, 6.70 g of NH4NO3 is mixed with 75.0 g of water at an initial temperature of 25.0 °C. At the end of the dissolution, the final temperature of the mixture is 13.1 °C. With the assumption that the solution has the same specific heat capacity as water and is accompanied by no heat loss to the calorimeter, calculate the enthalpy change for the dissolution of NH4NO3 in kJ/mol. en ott 46.6 94.5 47.2 3.0 80.1
1. 50 mL of water at 51.9°C were mixed with 50 mL of water at 23.2°C in a calorimeter also at 23.2°C. The final temperature was 33.1°C. Assuming that neither the density of water nor its specific heat capacity change with temperature, calculate the total heat capacity of the calorimeter. (density of water = 1.00 g mlº', specific heat capacity=4.18 J g?K=) 2. When 5.00 g of NaOH(s) are added to 100 g of water (using the same calorimeter as...
What is the final temperature when 63.4 g of water at 80.3°C is mixed with 39.5 g of water at 26.1°C? (The specific heat of water is 4.184 J/g °C.) T- Joc
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 15 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago