Homework Answers
Add Answer to:
4. If the agreed upon zero-point for standard reduction potential was the F,/F half-reaction instead of...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Cl...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Cl 2 (g) + 2 e − → 2 Cl − (aq) = E 0 red + 1.359 V MnO − 4 (aq) + 2 H 2 O (l) + 3 e − → MnO 2 (s) + 4 OH − (aq) = E 0 red + 0.59 V cathode half reaction anode half reaction overall reaction cell potential at standard state
Selective Reduction The standard reduction potential for the half-reaction: Sn4+ + 2e - Sn2+ is +0.15...
Selective Reduction The standard reduction potential for the half-reaction: Sn4+ + 2e - Sn2+ is +0.15 V. Consider data from the table of standard reduction potentials for common half-reactions, in your text. For a galvanic cell under standard conditions, which of the following anodic half reactions would produce, at the cathode a spontaneous reduction of Sn4+ to Sn2+ but not Sn2+ to Sn. no yes yes yes yes yes Fe — Fe2+ + 2e- Sn2+ Sn4+ + 2e- Sn Sn2+...
A certain half-reaction has a standard reduction potential rod = +0.81 V. An engineer proposes using...
A certain half-reaction has a standard reduction potential rod = +0.81 V. An engineer proposes using this half-reaction at the cathode of a galvanic cell that must provide at least 0.90 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the cathode of the cell. 0-0 Do oº Is there a minimum standard reduction potential that the half reaction used at the anode of this...
A certain half-reaction has a standard reduction potential Ered = +0.03 V. An engineer proposes using...
A certain half-reaction has a standard reduction potential Ered = +0.03 V. An engineer proposes using this half-reaction at the cathode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the cathode of the cell. 00 Is there a minimum standard reduction potential that the half-reaction used at the anode of this cell can have?...
A certain half-reaction has a standard reduction potential Ered = +0.23 V. An engineer proposes using...
A certain half-reaction has a standard reduction potential Ered = +0.23 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 1.40 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can have? g...
A certain half-reaction has a standard reduction potential e ed = -0.17 V. An engineer proposes...
A certain half-reaction has a standard reduction potential e ed = -0.17 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. olo Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can...
A chem igns a galvanic cell that uses these two half reactions: standard reduction potential half-reaction...
A chem igns a galvanic cell that uses these two half reactions: standard reduction potential half-reaction (aq)+4 H,0(1)+3e" → Cr(OH)2(3)+50H (aq) cro Ered=-0.13 V Fe?+ (aq)+e → Fe2+ (aq) E = +0.771 V Answer the following questions about this cell. 0-0 0 Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. X 5 Write a balanced equation for the overall reaction that powers the cell....
Selective Oxidation The standard reduction potential for the half-reaction Sn4+ + 2e - Sn2+ is +0.15...
Selective Oxidation The standard reduction potential for the half-reaction Sn4+ + 2e - Sn2+ is +0.15 V. Consider data from the table of standard reduction potentials for common half-reactions, in your text. For a galvanic cell under standard conditions, which of the following cathodic half reactions would produce, at the anode, a spontaneous oxidation of Sn to Sn2+ but not Sn2+ to Sn4+. 2H+ + 2e - H2 Fe3+ + 3e + Fe Sn2+ + 2e Fe2+ + 2e →...
A certain half-reaction has a standard reduction potential e ed =-0.80 V. An engineer proposes using...
A certain half-reaction has a standard reduction potential e ed =-0.80 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.60 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can have? O...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
Selective Reduction The standard reduction potential for the half-reaction: Sn4+ + 2e - Sn2+ is +0.15 V. Consider data from the table of standard reduction potentials for common half-reactions, in your text. For a galvanic cell under standard conditions, which of the following anodic half reactions would produce, at the cathode a spontaneous reduction of Sn4+ to Sn2+ but not Sn2+ to Sn. no yes yes yes yes yes Fe — Fe2+ + 2e- Sn2+ Sn4+ + 2e- Sn Sn2+...
A certain half-reaction has a standard reduction potential rod = +0.81 V. An engineer proposes using this half-reaction at the cathode of a galvanic cell that must provide at least 0.90 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the cathode of the cell. 0-0 Do oº Is there a minimum standard reduction potential that the half reaction used at the anode of this...
A certain half-reaction has a standard reduction potential Ered = +0.03 V. An engineer proposes using this half-reaction at the cathode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the cathode of the cell. 00 Is there a minimum standard reduction potential that the half-reaction used at the anode of this cell can have?...
A certain half-reaction has a standard reduction potential Ered = +0.23 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 1.40 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can have? g...
A certain half-reaction has a standard reduction potential e ed = -0.17 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. olo Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can...
A chem igns a galvanic cell that uses these two half reactions: standard reduction potential half-reaction (aq)+4 H,0(1)+3e" → Cr(OH)2(3)+50H (aq) cro Ered=-0.13 V Fe?+ (aq)+e → Fe2+ (aq) E = +0.771 V Answer the following questions about this cell. 0-0 0 Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. X 5 Write a balanced equation for the overall reaction that powers the cell....
Selective Oxidation The standard reduction potential for the half-reaction Sn4+ + 2e - Sn2+ is +0.15 V. Consider data from the table of standard reduction potentials for common half-reactions, in your text. For a galvanic cell under standard conditions, which of the following cathodic half reactions would produce, at the anode, a spontaneous oxidation of Sn to Sn2+ but not Sn2+ to Sn4+. 2H+ + 2e - H2 Fe3+ + 3e + Fe Sn2+ + 2e Fe2+ + 2e →...
A certain half-reaction has a standard reduction potential e ed =-0.80 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.60 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can have? O...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
Most questions answered within 3 hours.
-
Batteries play an important role in our everyday lives. From
making many devices mobile, to allowing...
asked 2 minutes ago -
It is possible to iterate through an array quickly and easily
using a loop?
asked 10 minutes ago -
Determine the pHpH of an HFHF solution of each of the following
concentrations. The KAKA value...
asked 6 minutes ago -
Two point charges of 7.0mL are initially 11.5m apart. What is
the change in potential energy...
asked 7 minutes ago -
Please write as a short answer
You have heartburn and a two hour working session on...
asked 11 minutes ago -
Please solve with excel and mention the excel function.
Thanks
Kevin deposits $10,000 in a savings...
asked 13 minutes ago -
Which Special Journal would the following transaction be
journalized in?
Sold merchandise on account to Customer...
asked 25 minutes ago -
Assuming 100% dissociation, calculate the freezing point (?fTf)
and boiling point (?bTb) of 1.45 ? K3PO4(aq)1.45...
asked 27 minutes ago -
An inflated helium balloon with a volume of 0.35L at
sea level (1.0 atm) was allowed...
asked 29 minutes ago -
Python 3.0 Please
Write a function that takes, as arguments, a binary string, a
list of...
asked 57 minutes ago -
(a) Calculate the momentum of a 2150 kg elephant charging a
hunter at a speed of...
asked 45 minutes ago -
all the following is an example of a fixed cost except: any cost
that changes in...
asked 47 minutes ago