Homework Answers
1. Option I is the major product.
2. Option b is the major product.
3. Option III is the final product Z.
4. Oprion III is the correct answer.
5. C6H5COCH3 will not give a positive reaction with Tollens reagent because it is a Ketone.
Add Answer to:
Which is the major product of the reaction of ethyl Grignard reagent and propiohenone? What is...
9. Which is the major product of the reaction of methyl Grignard (CH3MgBr) and propiophenone (ethyl...
9. Which is the major product of the reaction of methyl Grignard (CH3MgBr) and propiophenone (ethyl phenyl ketone)? CH2CH3 CCH3 CH2CH3 -СCH-CH b) ay ОН OH CH3 CH -ССH-CH, -СCH d) он ОН tor leact first) (hint: add the lone pai
I need help answering this Question 19 Give the Grignard reagent and expected product for the...
I need help answering this
Question 19 Give the Grignard reagent and expected product for the following chemical reaction (after aqueous workup, if needed) (Upload your answer) Mg El Final Product Grignard Reagent
5. Grignard Mechanism. Draw the major product for the Grignard reaction below in the box. Then,...
5. Grignard Mechanism. Draw the major product for the Grignard reaction below in the box. Then, draw the proper FULL electron-pushing mechanism for the reaction, including ALL intermediates (with formal charges) and electron pushing arrows. Label the Electrophile and Nucleophile in each step! 1. BrMg 2. H2O+
1. What is the major product for the following reaction? 2. What is the major product...
1. What is the major product for the following
reaction?
2. What is the major product for the following
reaction?
3.
4. Which reagent or test could be used to distinguish between
3-methyl-2-octene and 3-methyloctane?
Ethanol
Br2/CCl4
Sodium hydroxide aqueous solution
Two of these choices.
All of these choices.
5. Which of the following reagents give the highest yield for
conversion of 2-bromopentane to 1-pentene?
KOH/H2O
KOH/CH3OH
(CH3)3COK/(CH3)3COH
CH3ONa/CH3OH
CH3CH2ONa/CH3CH2OH
6.
What is the major product for the following reaction?...
16. What is the final product of the following reaction sequence? Give structural details of all...
16. What is the final product of the following reaction sequence? Give structural details of all significant intermediates. i. NaH ii. Br CO 2Et CO 2Et Br iii. NaOEt iv. NaOH, heat v. H2O7, heat Part I. Multiple Choice, select best answer. 1. In the molecule below, which of the hydrogens are the most acidic? II IV sonryer i II í V (a) 1 (b) II (c) III (d) IV 6. What would be the major product of the following...
1) What is the major organic product obtained from the following sequence of reactions? 1. (CH)...
1) What is the major organic product obtained from the following sequence of reactions? 1. (CH) CHCH.MOBI O CO HSÓ 2.H.O 2) What is the product of the following reaction? La noh to stor 3) What is the product of the following reaction? EtMgBr 4) What carbonyl compound and Grignard reagent could be used to prepare 2-butanol? CH.CHOCH.CH:Mgle CH.CH:CHO CHME CH.COCHCHMulle Only I Only II Only III Only I and II 6) What is the missing reagent in the reaction...
LO Which following compound is product of reaction between an ester and a Grignard reagent? OH...
LO Which following compound is product of reaction between an ester and a Grignard reagent? OH (B) OH (C) OH (D) OH
Grignard reagent THE GRIGNARD REAGENT-PREPARATION AND REACTION In this experiment, you will prepa...
i need help with the prelab questions please
Grignard reagent THE GRIGNARD REAGENT-PREPARATION AND REACTION In this experiment, you will prepare a Grignard reagent, phenyl magnesium bromide, from bromobenzene and magnesium metal. The Grignard reagent will then react with methyl benzoate to form triphenylmethanol. Introduction Grignard reagents, such as organomagnesium halides, were discovered in 1910 by French chemist Victor Grignard. The Grignard reaction is one of the most general methods for carbon- carbon bond formation in all of organic chemistry....
13. What is the major organic product of the following reaction? ma POCI OH 16-POCIE CIZOPO...
13. What is the major organic product of the following reaction? ma POCI OH 16-POCIE CIZOPO 14. Which of the following statements about Grignard reagents (R-Mg-X) is true? (i) because of the highly polar nature of the Mg-X and Mg-C bonds in Grignard reagents, water and CH3OH are good solvents for Grignard reactions. (ii) reaction of a Grignard reagent with an aldehyde yields a secondary alcohol; (iii) Grignard reagents are strongly nucleophilic; (a) only () is true (d) only (i)...
Grignard Reaction 1. Draw your complete reaction, including the formation of the Grignard reagent and the...
Grignard Reaction 1. Draw your complete reaction, including the formation of the Grignard reagent and the reaction with your carbonyl compound. Below each reagent, write its molecular weight and density (if a liquid). Also write how much of each material you will use in ml (if liquid), grams, and moles. Also include the molecular weight and melting point of your final product. 2. How many moles of Grignard reagent are you synthesizing? What mass of water could fully react with...
9. Which is the major product of the reaction of methyl Grignard (CH3MgBr) and propiophenone (ethyl phenyl ketone)? CH2CH3 CCH3 CH2CH3 -СCH-CH b) ay ОН OH CH3 CH -ССH-CH, -СCH d) он ОН tor leact first) (hint: add the lone pai
I need help answering this
Question 19 Give the Grignard reagent and expected product for the following chemical reaction (after aqueous workup, if needed) (Upload your answer) Mg El Final Product Grignard Reagent
5. Grignard Mechanism. Draw the major product for the Grignard reaction below in the box. Then, draw the proper FULL electron-pushing mechanism for the reaction, including ALL intermediates (with formal charges) and electron pushing arrows. Label the Electrophile and Nucleophile in each step! 1. BrMg 2. H2O+
1. What is the major product for the following
reaction?
2. What is the major product for the following
reaction?
3.
4. Which reagent or test could be used to distinguish between
3-methyl-2-octene and 3-methyloctane?
Ethanol
Br2/CCl4
Sodium hydroxide aqueous solution
Two of these choices.
All of these choices.
5. Which of the following reagents give the highest yield for
conversion of 2-bromopentane to 1-pentene?
KOH/H2O
KOH/CH3OH
(CH3)3COK/(CH3)3COH
CH3ONa/CH3OH
CH3CH2ONa/CH3CH2OH
6.
What is the major product for the following reaction?...
16. What is the final product of the following reaction sequence? Give structural details of all significant intermediates. i. NaH ii. Br CO 2Et CO 2Et Br iii. NaOEt iv. NaOH, heat v. H2O7, heat Part I. Multiple Choice, select best answer. 1. In the molecule below, which of the hydrogens are the most acidic? II IV sonryer i II í V (a) 1 (b) II (c) III (d) IV 6. What would be the major product of the following...
1) What is the major organic product obtained from the following sequence of reactions? 1. (CH) CHCH.MOBI O CO HSÓ 2.H.O 2) What is the product of the following reaction? La noh to stor 3) What is the product of the following reaction? EtMgBr 4) What carbonyl compound and Grignard reagent could be used to prepare 2-butanol? CH.CHOCH.CH:Mgle CH.CH:CHO CHME CH.COCHCHMulle Only I Only II Only III Only I and II 6) What is the missing reagent in the reaction...
LO Which following compound is product of reaction between an ester and a Grignard reagent? OH (B) OH (C) OH (D) OH
i need help with the prelab questions please
Grignard reagent THE GRIGNARD REAGENT-PREPARATION AND REACTION In this experiment, you will prepare a Grignard reagent, phenyl magnesium bromide, from bromobenzene and magnesium metal. The Grignard reagent will then react with methyl benzoate to form triphenylmethanol. Introduction Grignard reagents, such as organomagnesium halides, were discovered in 1910 by French chemist Victor Grignard. The Grignard reaction is one of the most general methods for carbon- carbon bond formation in all of organic chemistry....
13. What is the major organic product of the following reaction? ma POCI OH 16-POCIE CIZOPO 14. Which of the following statements about Grignard reagents (R-Mg-X) is true? (i) because of the highly polar nature of the Mg-X and Mg-C bonds in Grignard reagents, water and CH3OH are good solvents for Grignard reactions. (ii) reaction of a Grignard reagent with an aldehyde yields a secondary alcohol; (iii) Grignard reagents are strongly nucleophilic; (a) only () is true (d) only (i)...
Grignard Reaction 1. Draw your complete reaction, including the formation of the Grignard reagent and the reaction with your carbonyl compound. Below each reagent, write its molecular weight and density (if a liquid). Also write how much of each material you will use in ml (if liquid), grams, and moles. Also include the molecular weight and melting point of your final product. 2. How many moles of Grignard reagent are you synthesizing? What mass of water could fully react with...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago