Homework Answers
Add Answer to:
Find The product of the following The product of the following
Grignard reaction 6 and 7...
can you solve 7 and 8 please? 7. Propose structure(s) for the major organic product(s) of...
can you solve 7 and 8 please?
7. Propose structure(s) for the major organic product(s) of the following reactions or sequences of reactions. Show all relevant stereochemistry. a. O CH3CCH3 + CH3CH2MgBr 1. ether 2. H30* b. -[O] CrO3 H20 OH C. CH3 + CH3CH2NH2 1º amine 8. Write the complete stepwise mechanism for the Grignard reaction shown below. Show all intermediate structures and all electron flow with arrows. OH C-CH2CH3 1. in ether CH3 CH3CH2MgBr 2. H, H2O O=0...
Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3...
Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3 CH3CH2NHCH3 CH3CH2CH2NHCH3 CH3CH2 H NCHS CH3CH2CH2N(CH3)2 O CH3CH2CH2OH Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3 CH3CH2NHCH3 CH3CH2CH2NHCH3 CH3CH2 H NCHS CH3CH2CH2N(CH3)2 O CH3CH2CH2OH
Select the major product of the following reaction scheme: Select the major product of the following...
Select the major product of the following reaction
scheme:
Select the major product of the following reaction scheme: Reaction NaOH H H3C Acetone, EtOH 25 °C А D CH3 CH3 H3C H3C B E ОН О CH3 H3C H3C CH3 C F H H3C (No Reaction) CI ol. A o II. B o III.C o IV.D OV. E
Grignard reagents undergo a general and very useful reaction with ketones. What is the structure of the product of...
Grignard reagents undergo a general and very useful reaction with ketones. What is the structure of the product of the following reaction if it has a strong, broad IR absorption at 3450 cm? 1. CH MgBr CeH140 H3C CH3 2. Hy0 . You do not have to consider stereochemistry. You do not have to explicitly draw H atoms. In cases where there is more than one answer, just draw one ChemDoodle
35. Write the IUPAC name for the following compound. CH3 H₃C & E -CHE H obo...
35. Write the IUPAC name for the following compound. CH3 H₃C & E -CHE H obo ludibo CH2 heya ni tolon CH2 bomo guolis CHE 36. Draw the line angle formula for the product of the following reaction. H + H2O 37. Identify the following as hemiacetal or acetal. (2 marks) a. b. -CH3 CH3 H3C- -ОН H3C с CH3 38. Draw the condensed structural formula for 3-methyl-1-butanol. 39. Draw the major product for the following reaction. OH Ht, Heat...
Draw the product of the following reaction between a ketone and an alcohol. Include hydrogen atoms...
Draw the product of the following reaction between a ketone and an alcohol. Include hydrogen atoms in your structural formula. он + H3C-¢-CH3 + HO-CH2-CH3 6-CH2-CH3 How would you classify the product of the reaction? It is an alcohol. + H20 It is a ketone. It is a hemiacetal. It is an acetal.
Chem. 2425 Test 1 Summer II 2020 Name: 11. Consider the Grignard reaction below to answer...
Chem. 2425 Test 1 Summer II 2020 Name: 11. Consider the Grignard reaction below to answer the following question(s). OH HO MgBr C---CH3 CH3 د) CH3 + H3C CH3 1. ether 2.H30+ CH3 B с :C The nucleophile in this reaction is: ; the alcohol product can be classified as a: a. 1° alcohol b. 2° alcohol C. )3° alcohol d. 4° alcohol
6) Predict the major product in each of the following reactions and indicate if it came...
6) Predict the major product in each of the following reactions and indicate if it came from an Sn1, S2, E1, or E2 reaction. H3C Br NaOme CH3 H2O H Br MeOH 'BUOK H Br DMSO H3C Br NaOme CH3 H20 MeOH H OTS ЕКОН
Select the major product of the following reaction scheme: Select the major product of the following...
Select the major product of the following reaction scheme:
Select the major product of the following reaction scheme: Reaction NaOH H Н4С Acetone, EtOH 25 °C А CH3 CH3 HEC H2C B E OH O CH3 нс H3C CHE F с H H3C (No Reaction) CI ol. A oll. B olll. IV.D OV. E OVLF
Please explain thoroughly in detail. 5. Write the product(s) or reactants of each reaction. a. 1....
Please explain thoroughly in detail.
5. Write the product(s) or reactants of each reaction. a. 1. BBr3 CH3 2. H20 b. HI O-CH3 heat C. 1. CH3 MgBr d. 2. H*/H20 o 1.H3C-CEC Nat 2. H*/H2O
can you solve 7 and 8 please?
7. Propose structure(s) for the major organic product(s) of the following reactions or sequences of reactions. Show all relevant stereochemistry. a. O CH3CCH3 + CH3CH2MgBr 1. ether 2. H30* b. -[O] CrO3 H20 OH C. CH3 + CH3CH2NH2 1º amine 8. Write the complete stepwise mechanism for the Grignard reaction shown below. Show all intermediate structures and all electron flow with arrows. OH C-CH2CH3 1. in ether CH3 CH3CH2MgBr 2. H, H2O O=0...
Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3 CH3CH2NHCH3 CH3CH2CH2NHCH3 CH3CH2 H NCHS CH3CH2CH2N(CH3)2 O CH3CH2CH2OH Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3 CH3CH2NHCH3 CH3CH2CH2NHCH3 CH3CH2 H NCHS CH3CH2CH2N(CH3)2 O CH3CH2CH2OH
Select the major product of the following reaction
scheme:
Select the major product of the following reaction scheme: Reaction NaOH H H3C Acetone, EtOH 25 °C А D CH3 CH3 H3C H3C B E ОН О CH3 H3C H3C CH3 C F H H3C (No Reaction) CI ol. A o II. B o III.C o IV.D OV. E
Grignard reagents undergo a general and very useful reaction with ketones. What is the structure of the product of the following reaction if it has a strong, broad IR absorption at 3450 cm? 1. CH MgBr CeH140 H3C CH3 2. Hy0 . You do not have to consider stereochemistry. You do not have to explicitly draw H atoms. In cases where there is more than one answer, just draw one ChemDoodle
35. Write the IUPAC name for the following compound. CH3 H₃C & E -CHE H obo ludibo CH2 heya ni tolon CH2 bomo guolis CHE 36. Draw the line angle formula for the product of the following reaction. H + H2O 37. Identify the following as hemiacetal or acetal. (2 marks) a. b. -CH3 CH3 H3C- -ОН H3C с CH3 38. Draw the condensed structural formula for 3-methyl-1-butanol. 39. Draw the major product for the following reaction. OH Ht, Heat...
Draw the product of the following reaction between a ketone and an alcohol. Include hydrogen atoms in your structural formula. он + H3C-¢-CH3 + HO-CH2-CH3 6-CH2-CH3 How would you classify the product of the reaction? It is an alcohol. + H20 It is a ketone. It is a hemiacetal. It is an acetal.
Chem. 2425 Test 1 Summer II 2020 Name: 11. Consider the Grignard reaction below to answer the following question(s). OH HO MgBr C---CH3 CH3 د) CH3 + H3C CH3 1. ether 2.H30+ CH3 B с :C The nucleophile in this reaction is: ; the alcohol product can be classified as a: a. 1° alcohol b. 2° alcohol C. )3° alcohol d. 4° alcohol
6) Predict the major product in each of the following reactions and indicate if it came from an Sn1, S2, E1, or E2 reaction. H3C Br NaOme CH3 H2O H Br MeOH 'BUOK H Br DMSO H3C Br NaOme CH3 H20 MeOH H OTS ЕКОН
Select the major product of the following reaction scheme:
Select the major product of the following reaction scheme: Reaction NaOH H Н4С Acetone, EtOH 25 °C А CH3 CH3 HEC H2C B E OH O CH3 нс H3C CHE F с H H3C (No Reaction) CI ol. A oll. B olll. IV.D OV. E OVLF
Please explain thoroughly in detail.
5. Write the product(s) or reactants of each reaction. a. 1. BBr3 CH3 2. H20 b. HI O-CH3 heat C. 1. CH3 MgBr d. 2. H*/H20 o 1.H3C-CEC Nat 2. H*/H2O
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 36 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 59 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 3 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago