Homework Answers
Add Answer to:
Consider this reaction: (CH_3)3CBr + H_2O rightarrow (CH_3)_3COH +HBr what effect does doubling the concentration of...
Assuming no other changes, what is the effect of doubling only the concentration of the alkyl...
Assuming no other changes, what is the effect of doubling only the concentration of the alkyl halide in the above S_N 1 reaction? quadruples the rate rate is halved no change triples the rate doubles the rate
9. How does doubling the concentration of hydroxide (OH-) and halve the concentration of bromomethane (CH3Br)...
9. How does doubling the concentration of hydroxide (OH-) and halve the concentration of bromomethane (CH3Br) in the following reaction affect the rate of the reaction? CH3BE + HO CH3OH + Br A) no change B) doubles the rate C) triples the rate D) quadruples the rate E) rate is halved
For the following reaction: CH_3 OH(aq) + H^+ (aq) + Cl^- (aq) rightarrow CH_3Cl(aq) + H_2O(l)...
For the following reaction: CH_3 OH(aq) + H^+ (aq) + Cl^- (aq) rightarrow CH_3Cl(aq) + H_2O(l) the value of [H^+] was measured over a period of time. Given the data, find the average rate of disappearance of H^+(aq) for the time interval between each measurement. What is the average rate of appearance of CH_3 CI(aq) for the same time intervals?
For the reaction shown below, what effect would doubling the 1-bromopropane concentration have on the rate...
For the reaction shown below, what effect would doubling the 1-bromopropane concentration have on the rate of reaction? он Br + KOH + KBr rate = k[C3HBr](KOH) Select one: a. Quadruple the rate O b. Double the rate c. No effect Od. Halve the rate
According to the following reaction: KHP + NaOH a NaKP + H_2O What is the concentration...
According to the following reaction: KHP + NaOH a NaKP + H_2O What is the concentration of the NaOH if it look 42.52 mL to titrate 0.835 g of KHP? (MM KHP = 204.2 g/mol) According to the following equation, how many ml of 0.15 M NaOH would be needed to titrate 10.00 ml of 0.500 M HCl? HCl + NaOH a NaCI + H_2O What is the pH of a 0.33 M solution of HCl? What is the [H+]...
C_3H_8 + 5O_2 rightarrow 3 CO_2 + 4 H_2O For the above reaction, 88 g of...
C_3H_8 + 5O_2 rightarrow 3 CO_2 + 4 H_2O For the above reaction, 88 g of C_3H_8 is reacted with 160 g of O_2. What would be the theoretical yield of CO_2? A) 264 g B) 132 g C) 66 g D) 33 g
need help to solve this orgo chem page? November 18, 2005 Thyoa souri wintial attack by...
need help to solve this orgo chem page?
November 18, 2005 Thyoa souri wintial attack by a chlorine atom Gsmutin ofan-propyl cation Name Multiple Choice (3 points each) Chemistry 2113 I. Markovnikov addition of HCI to aT initial attack by a chlorine ion, c isomerization of 1-chloropropane er formation of an isopropyl cation. Propene inalwes 2 In the following reaction, doubling the indide conantration will have what effeect on the rate of the reaction? (CH3)3CBr I a) no change b)...
Which of the following graphs best represents of penicillin, if the reaction is second order with...
Which of the following graphs best represents of penicillin, if the reaction is second order with respect to penicillin? For the reaction X_2 + Y + Z rightarrow XY + XZ, it is found that doubling the concentration of X_2 doubled the reaction rate, tripling the concentration of Y triples the rate, and doubling the concentration of Z has no effect. What is the rate law for this reaction? What is the unit for the rate constant for this reaction?...
41 The following data was experimentally obtained for the reaction: 2 of 2 (CH3)3CBr + H2O...
41 The following data was experimentally obtained for the reaction: 2 of 2 (CH3)3CBr + H2O → (CH3)3COH + HBr t(h) (CH3)2CBr (mol/L) 0 10.39 x 102 3.15 8.96 x 102 6.20 7.76 x 102 10 6.39 x 102 18.30 3.53 x 102 30.80 2.07 x 102 a) Make the appropriate graphs and from them determine the order of reaction in relation to (CH3),CBr. In other words, the rate law expression will be like: Rate = k [(CH3)3CBr]" By concluding...
7. Consider the following reaction A+B - products. The rate law was found to be Rate...
7. Consider the following reaction A+B - products. The rate law was found to be Rate = k [A] [B]. Calculate k if [A] = 0.0500 M [B] = 0.125 M and the reaction took 405 seconds to go to completion. 8. For a reaction A+B → C, doubling the concentration of either A or B, quadruples the reaction rate. Write the rate law for the reaction.
Assuming no other changes, what is the effect of doubling only the concentration of the alkyl halide in the above S_N 1 reaction? quadruples the rate rate is halved no change triples the rate doubles the rate
9. How does doubling the concentration of hydroxide (OH-) and halve the concentration of bromomethane (CH3Br) in the following reaction affect the rate of the reaction? CH3BE + HO CH3OH + Br A) no change B) doubles the rate C) triples the rate D) quadruples the rate E) rate is halved
For the following reaction: CH_3 OH(aq) + H^+ (aq) + Cl^- (aq) rightarrow CH_3Cl(aq) + H_2O(l) the value of [H^+] was measured over a period of time. Given the data, find the average rate of disappearance of H^+(aq) for the time interval between each measurement. What is the average rate of appearance of CH_3 CI(aq) for the same time intervals?
For the reaction shown below, what effect would doubling the 1-bromopropane concentration have on the rate of reaction? он Br + KOH + KBr rate = k[C3HBr](KOH) Select one: a. Quadruple the rate O b. Double the rate c. No effect Od. Halve the rate
According to the following reaction: KHP + NaOH a NaKP + H_2O What is the concentration of the NaOH if it look 42.52 mL to titrate 0.835 g of KHP? (MM KHP = 204.2 g/mol) According to the following equation, how many ml of 0.15 M NaOH would be needed to titrate 10.00 ml of 0.500 M HCl? HCl + NaOH a NaCI + H_2O What is the pH of a 0.33 M solution of HCl? What is the [H+]...
C_3H_8 + 5O_2 rightarrow 3 CO_2 + 4 H_2O For the above reaction, 88 g of C_3H_8 is reacted with 160 g of O_2. What would be the theoretical yield of CO_2? A) 264 g B) 132 g C) 66 g D) 33 g
need help to solve this orgo chem page?
November 18, 2005 Thyoa souri wintial attack by a chlorine atom Gsmutin ofan-propyl cation Name Multiple Choice (3 points each) Chemistry 2113 I. Markovnikov addition of HCI to aT initial attack by a chlorine ion, c isomerization of 1-chloropropane er formation of an isopropyl cation. Propene inalwes 2 In the following reaction, doubling the indide conantration will have what effeect on the rate of the reaction? (CH3)3CBr I a) no change b)...
Which of the following graphs best represents of penicillin, if the reaction is second order with respect to penicillin? For the reaction X_2 + Y + Z rightarrow XY + XZ, it is found that doubling the concentration of X_2 doubled the reaction rate, tripling the concentration of Y triples the rate, and doubling the concentration of Z has no effect. What is the rate law for this reaction? What is the unit for the rate constant for this reaction?...
41 The following data was experimentally obtained for the reaction: 2 of 2 (CH3)3CBr + H2O → (CH3)3COH + HBr t(h) (CH3)2CBr (mol/L) 0 10.39 x 102 3.15 8.96 x 102 6.20 7.76 x 102 10 6.39 x 102 18.30 3.53 x 102 30.80 2.07 x 102 a) Make the appropriate graphs and from them determine the order of reaction in relation to (CH3),CBr. In other words, the rate law expression will be like: Rate = k [(CH3)3CBr]" By concluding...
7. Consider the following reaction A+B - products. The rate law was found to be Rate = k [A] [B]. Calculate k if [A] = 0.0500 M [B] = 0.125 M and the reaction took 405 seconds to go to completion. 8. For a reaction A+B → C, doubling the concentration of either A or B, quadruples the reaction rate. Write the rate law for the reaction.
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 23 seconds from now -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago