The oxidation number of an element is the "charge" the element would have if all of...
The oxidation number of an element is the "charge" the element would have if all of its bonds were completely ionic; that is, if the electron pairs of each bond were transferred to the more electronegative atom.
For monatomic ions the oxidation number is simply the charge of the ion. For covalently bonded elements the oxidation number is a bookkeeping device and does not mean that the element carries an actual charge.
Determine the oxidation state for each of the elements below.
The oxidation state of silver in silver bromide AgBr is __
The oxidation state of nitrogen in nitrogen dioxide NO2 is __.
The oxidation state of xenon in xenon gas Xe is __.
Homework Answers
AgBr , Br will have --1 oxidation in general
Ag ( OS) + Br ( OS) = 0 ( OS mean Oxidation state , total compound charge = 0 )
Ag( OS) + ( -1) = 0
Ag (OS) = +1
NO2 has O in -2 state , hence N is +4
Xe oxidation state in Xe gas = 0 ( since Xe gas exists as Xe atoms , and single neutral atom oxidation state = 0 )
Add Answer to:
The oxidation number of an element is the
"charge" the element would have if all of...
Sudent Name: EXP #6: PRE-LAB EXERCISE 1. Find the charge (also called oxidation number) of the...
Sudent Name: EXP #6: PRE-LAB EXERCISE 1. Find the charge (also called oxidation number) of the metal atom in each of the following nstructor Name: polyatomie ions or compounds (hint! Oxygen is always-2). a) dichromate ion, CrO b) chromate ion, Cro c) arsenate ion, AsO 2. Balance the following redox reactions. The second one is broken up into separate oxidation and reduction "half reactions in order to assist you (hinr See page I) Orxidation Reduction 3. In the question above,...
Oxidation States 12 of 14 > Neutral compounds In a neutral compound, the sum of the...
Oxidation States 12 of 14 > Neutral compounds In a neutral compound, the sum of the oxidation states is zero. Note that the sign of the oxidation states and the number of atoms associated with each oxidation state must be considered. In H20, for example, each hydrogen atom has an oxidation state of +1 and each oxygen atom has an oxidation state of -2 for a total nstant Oxidation states are important for keeping track of electrons in oxidation-reduction reactions....
The formal charge is the "charge" an element would have in a molecule or ion if all of the bondin...
1. The formal charge is the "charge" an element would have in a molecule or ion if all of the bonding electrons were shared equally between atoms. We can draw three inequivalent Lewis structures for the tellurite ion , TeO32-. The concepts of formal charge and electronegativity can help us choose the structure that is the best representation. 1. Assign formal charges to the elements in each of the structures below. Note: Count oxygen atoms starting from the left for each structure.2. The best...
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons &n
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons (3) transfer of electrons (2) sharing of protons (4) transfer of protons In this reaction, CO→ 2 CO + O2 the oxidation number of carbon changes from: (1) 0 to +4 (3) +3 to 0 (2) +2 to +4 (4) +4 to +2 Which balanced equation represents a redox reaction? AgNO3 (aq) +NaCl (aq) →AgCl (s) +NaNO3 (aq) H2CO3 (aq)...
Please answer the questions too. Thanks. 4. What is used for naming covalent compounds that is...
Please answer the questions too. Thanks.
4. What is used for naming covalent compounds that is not used for lonic compound naes Procedures: 1. Complete Table A "Electron Dot Structures" using the given examples 2. Complete Table B "Physical Properties of lonic Compounds using text book as the reference. 3. Complete Table C "Formulas of lonic Compounds." Determine the oxidation mumber or valence of each ion, then determine the chemical formula so that the compounds have a balance, zero net...
please number and write the correct answer Ar have a total pressure of 1.6 bar. What...
please number and write the correct answer
Ar have a total pressure of 1.6 bar. What is the partial 17. A mixture of 100 g of Ne and 10.0 Ne? a) 0.40 bar b) 1.1 bar c) 0.54 bar GP 0.80 bar e) 1.3 bar 18. A sample of N, effuses in 255 s. How long will the same size sample of Cl2 take to effuser c12 a) 388 5 b) 1555 c) 247 s d) 406 5 e) 6455...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic compound C) molecular compound D) ternary acid 2) The compound TiO2 is classified as which of the following? A) binary acid B) ionic compound C) molecular compound D) ternary acid 3) What is the name for S2-? A) sulfur ion B) sulfide ion C) sulfite ion D) sulfate ion 4) What is the chemical formula for the nitrite ion? A) NO3- B) NO32- C)...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
d. Suppose you mistakenly acidify the filtrate with HCl instead of with HNO3. What would you...
d. Suppose you mistakenly acidify the filtrate with HCl instead of with HNO3. What would you obser after completing the halide test, and what would that observation lead you to conclude? Organic Laboratory Technique Primer Sodium Fusions and lon Testing Background: The elements that commonly occur in organic compounds along with carbon, hydrogen, and oxygen, are: nitrogen sulfur, and the halogens. The detection of these latter three elements depends on converting them into water soluble lons (CNS , and X...
Sudent Name: EXP #6: PRE-LAB EXERCISE 1. Find the charge (also called oxidation number) of the metal atom in each of the following nstructor Name: polyatomie ions or compounds (hint! Oxygen is always-2). a) dichromate ion, CrO b) chromate ion, Cro c) arsenate ion, AsO 2. Balance the following redox reactions. The second one is broken up into separate oxidation and reduction "half reactions in order to assist you (hinr See page I) Orxidation Reduction 3. In the question above,...
Oxidation States 12 of 14 > Neutral compounds In a neutral compound, the sum of the oxidation states is zero. Note that the sign of the oxidation states and the number of atoms associated with each oxidation state must be considered. In H20, for example, each hydrogen atom has an oxidation state of +1 and each oxygen atom has an oxidation state of -2 for a total nstant Oxidation states are important for keeping track of electrons in oxidation-reduction reactions....
Please answer the questions too. Thanks.
4. What is used for naming covalent compounds that is not used for lonic compound naes Procedures: 1. Complete Table A "Electron Dot Structures" using the given examples 2. Complete Table B "Physical Properties of lonic Compounds using text book as the reference. 3. Complete Table C "Formulas of lonic Compounds." Determine the oxidation mumber or valence of each ion, then determine the chemical formula so that the compounds have a balance, zero net...
please number and write the correct answer
Ar have a total pressure of 1.6 bar. What is the partial 17. A mixture of 100 g of Ne and 10.0 Ne? a) 0.40 bar b) 1.1 bar c) 0.54 bar GP 0.80 bar e) 1.3 bar 18. A sample of N, effuses in 255 s. How long will the same size sample of Cl2 take to effuser c12 a) 388 5 b) 1555 c) 247 s d) 406 5 e) 6455...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic compound C) molecular compound D) ternary acid 2) The compound TiO2 is classified as which of the following? A) binary acid B) ionic compound C) molecular compound D) ternary acid 3) What is the name for S2-? A) sulfur ion B) sulfide ion C) sulfite ion D) sulfate ion 4) What is the chemical formula for the nitrite ion? A) NO3- B) NO32- C)...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
d. Suppose you mistakenly acidify the filtrate with HCl instead of with HNO3. What would you obser after completing the halide test, and what would that observation lead you to conclude? Organic Laboratory Technique Primer Sodium Fusions and lon Testing Background: The elements that commonly occur in organic compounds along with carbon, hydrogen, and oxygen, are: nitrogen sulfur, and the halogens. The detection of these latter three elements depends on converting them into water soluble lons (CNS , and X...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 42 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago