Homework Answers
1-ethylcyclopentene
and ethylcyclopentene have same structure.
Since in the question ethyl group is attached to the ring at 4th carbon therefore iupac name of the given structure in the question is 4- ethylcyclopentene.
Add Answer to:
The IUPAC name for the following compound is CH2CH3 O ethylcyclopentene 0 3-ethylcyclopentene 0 4-ethylcyclopentene O1-ethylcyclopentene
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН...
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН 3 CH3 Br 4. сі
Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might...
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might help to take the expanded molecular formula and draw the structural formula) The IUPAC name of the molecule shown above is Give the family name for the organic compound shown here: C-C-C-C-NH2 The family name of the molecule shown above is a(n)
The name the compound generated when 1-ethylcyclopentene is subjected to Oz followed by dimethyl sulfide is...
The name the compound generated when 1-ethylcyclopentene is subjected to Oz followed by dimethyl sulfide is _ Use IUPAC nomenclature.
Give the IUPAC name for the following compound. Give the IUPAC name for the following compound....
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
3 attempts left Check my work PANO Be sure to answer all parts. Give the IUPAC name for the following compound: nts SQUARE PHOTO (select)) (select) (weleet) (select) TIME-LAPSE ASICNACION: ALCANOS O 3 attempts left Check my work Be sure to answer all parts. Give the IUPAC name for the following compound. points eBook (select) (select)...
QUESTION 2 What is the IUPAC name for this compound? CHE -CH2CH2CH2CH, QUESTION 3 What is...
QUESTION 2 What is the IUPAC name for this compound? CHE -CH2CH2CH2CH, QUESTION 3 What is the IUPAC name for this compound? -CH2CH3 CH2CH2CH, QUESTION 4 What is the IUPAC name for this compound? Br CH3CH2CH2CH2CCH NO2
What is the IUPAC name for the following compound? O HO What is the IUPAC name...
What is the IUPAC name for the following compound? O HO What is the IUPAC name for the following compound? F OH What is the IUPAC name for the following compound? O HO НOо HO Provide the reagents necessary to carry out the following conversion. 9. ecle OH
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the...
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: | methyl ethanoatone CH3CH2CH2CCH2CH3 systematic (IUPAC) name: ethyl propanoatone What is the IUPAC name for the compound shown? IUPAC name:
3) Provide the IUPAC name of the following compound. H 4) Provide the proper IUPAC name...
3) Provide the IUPAC name of the following compound. H 4) Provide the proper IUPAC name for CICH2CH2CONHCH3. is 5) Provide the proper IUPAC name for NCCH2CH2CH2CH2CO2CH3.
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3...
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН 3 CH3 Br 4. сі
Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might help to take the expanded molecular formula and draw the structural formula) The IUPAC name of the molecule shown above is Give the family name for the organic compound shown here: C-C-C-C-NH2 The family name of the molecule shown above is a(n)
The name the compound generated when 1-ethylcyclopentene is subjected to Oz followed by dimethyl sulfide is _ Use IUPAC nomenclature.
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
3 attempts left Check my work PANO Be sure to answer all parts. Give the IUPAC name for the following compound: nts SQUARE PHOTO (select)) (select) (weleet) (select) TIME-LAPSE ASICNACION: ALCANOS O 3 attempts left Check my work Be sure to answer all parts. Give the IUPAC name for the following compound. points eBook (select) (select)...
QUESTION 2 What is the IUPAC name for this compound? CHE -CH2CH2CH2CH, QUESTION 3 What is the IUPAC name for this compound? -CH2CH3 CH2CH2CH, QUESTION 4 What is the IUPAC name for this compound? Br CH3CH2CH2CH2CCH NO2
What is the IUPAC name for the following compound? O HO What is the IUPAC name for the following compound? F OH What is the IUPAC name for the following compound? O HO НOо HO Provide the reagents necessary to carry out the following conversion. 9. ecle OH
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: | methyl ethanoatone CH3CH2CH2CCH2CH3 systematic (IUPAC) name: ethyl propanoatone What is the IUPAC name for the compound shown? IUPAC name:
3) Provide the IUPAC name of the following compound. H 4) Provide the proper IUPAC name for CICH2CH2CONHCH3. is 5) Provide the proper IUPAC name for NCCH2CH2CH2CH2CO2CH3.
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
Most questions answered within 3 hours.
-
Is there the need for the government to have hackers. Please
share your thoughts.
asked 57 seconds ago -
Explain why you should not lose any LDH activity when you
centrifuge a crude sample at...
asked 9 minutes ago -
An AA battery (object), standing on end, is placed to the left
of a diverging lens...
asked 10 minutes ago -
After you measure the self-inductance of a coil, you unwind it
and then rewind one third...
asked 10 minutes ago -
1. Which of the following best describes a transistor?
A) a small electrical circuit made from...
asked 12 minutes ago -
Use generating function to find the number of distributions of
20 people into four different rooms...
asked 27 minutes ago -
The following data set consists the number of minutes a sample
of 25 people run every...
asked 31 minutes ago -
Suppose vacuum cleaners are part of the market basket used to
compute the CPI. Suppose also...
asked 43 minutes ago -
What intermediate results after the addition of H3O+ to
E-3-methyl-2-pentane?
pentene*
asked 48 minutes ago -
Potassium hydrogen phthalate is a solid, monoprotic acid
frequently used in the laboratory to standardize strong...
asked 1 hour ago -
1-Describe the 3 major classes of ownerships of retailers
2-What are the differences between consumer and...
asked 50 minutes ago -
A Student takes a sample from a table top in the student lounge
using a sterile...
asked 57 minutes ago