Homework Answers
1-ethylcyclopentene
and ethylcyclopentene have same structure.
Since in the question ethyl group is attached to the ring at 4th carbon therefore iupac name of the given structure in the question is 4- ethylcyclopentene.
Add Answer to:
The IUPAC name for the following compound is CH2CH3 O ethylcyclopentene 0 3-ethylcyclopentene 0 4-ethylcyclopentene O1-ethylcyclopentene
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН...
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН 3 CH3 Br 4. сі
Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might...
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might help to take the expanded molecular formula and draw the structural formula) The IUPAC name of the molecule shown above is Give the family name for the organic compound shown here: C-C-C-C-NH2 The family name of the molecule shown above is a(n)
The name the compound generated when 1-ethylcyclopentene is subjected to Oz followed by dimethyl sulfide is...
The name the compound generated when 1-ethylcyclopentene is subjected to Oz followed by dimethyl sulfide is _ Use IUPAC nomenclature.
Give the IUPAC name for the following compound. Give the IUPAC name for the following compound....
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
3 attempts left Check my work PANO Be sure to answer all parts. Give the IUPAC name for the following compound: nts SQUARE PHOTO (select)) (select) (weleet) (select) TIME-LAPSE ASICNACION: ALCANOS O 3 attempts left Check my work Be sure to answer all parts. Give the IUPAC name for the following compound. points eBook (select) (select)...
QUESTION 2 What is the IUPAC name for this compound? CHE -CH2CH2CH2CH, QUESTION 3 What is...
QUESTION 2 What is the IUPAC name for this compound? CHE -CH2CH2CH2CH, QUESTION 3 What is the IUPAC name for this compound? -CH2CH3 CH2CH2CH, QUESTION 4 What is the IUPAC name for this compound? Br CH3CH2CH2CH2CCH NO2
What is the IUPAC name for the following compound? O HO What is the IUPAC name...
What is the IUPAC name for the following compound? O HO What is the IUPAC name for the following compound? F OH What is the IUPAC name for the following compound? O HO НOо HO Provide the reagents necessary to carry out the following conversion. 9. ecle OH
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the...
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: | methyl ethanoatone CH3CH2CH2CCH2CH3 systematic (IUPAC) name: ethyl propanoatone What is the IUPAC name for the compound shown? IUPAC name:
3) Provide the IUPAC name of the following compound. H 4) Provide the proper IUPAC name...
3) Provide the IUPAC name of the following compound. H 4) Provide the proper IUPAC name for CICH2CH2CONHCH3. is 5) Provide the proper IUPAC name for NCCH2CH2CH2CH2CO2CH3.
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3...
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН 3 CH3 Br 4. сі
Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might help to take the expanded molecular formula and draw the structural formula) The IUPAC name of the molecule shown above is Give the family name for the organic compound shown here: C-C-C-C-NH2 The family name of the molecule shown above is a(n)
The name the compound generated when 1-ethylcyclopentene is subjected to Oz followed by dimethyl sulfide is _ Use IUPAC nomenclature.
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
Give the IUPAC name for the following compound.
3 attempts left Check my work PANO Be sure to answer all parts. Give the IUPAC name for the following compound: nts SQUARE PHOTO (select)) (select) (weleet) (select) TIME-LAPSE ASICNACION: ALCANOS O 3 attempts left Check my work Be sure to answer all parts. Give the IUPAC name for the following compound. points eBook (select) (select)...
QUESTION 2 What is the IUPAC name for this compound? CHE -CH2CH2CH2CH, QUESTION 3 What is the IUPAC name for this compound? -CH2CH3 CH2CH2CH, QUESTION 4 What is the IUPAC name for this compound? Br CH3CH2CH2CH2CCH NO2
What is the IUPAC name for the following compound? O HO What is the IUPAC name for the following compound? F OH What is the IUPAC name for the following compound? O HO НOо HO Provide the reagents necessary to carry out the following conversion. 9. ecle OH
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: | methyl ethanoatone CH3CH2CH2CCH2CH3 systematic (IUPAC) name: ethyl propanoatone What is the IUPAC name for the compound shown? IUPAC name:
3) Provide the IUPAC name of the following compound. H 4) Provide the proper IUPAC name for CICH2CH2CONHCH3. is 5) Provide the proper IUPAC name for NCCH2CH2CH2CH2CO2CH3.
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
Most questions answered within 3 hours.
-
Raising a heavy load requires work. Raising it in half the time
requires:
asked 3 minutes ago -
Calculate the number of valence electrons for
[Mo(C6H6)(CO)3]
asked 1 minute ago -
MGT-201: Marketing Management
Before deciding on the structure of the channel marketers must
take several factors...
asked 3 minutes ago -
1. ACLs allow a router to control traffic within a network. The
concept is very similar...
asked 5 minutes ago -
35. When the electron in a hydrogen atom falls from its first
excited energy level to...
asked 6 minutes ago -
A man is dragging a box of mass "m" by using a rope which rests
on...
asked 22 minutes ago -
Liquid octane
(CH3(CH2)6CH3) will
react with gaseous oxygen (O2) to produce gaseous carbon
dioxide (CO2) and...
asked 24 minutes ago -
For the reaction N2(g) +
O2(g) --> 2NO(g), if the initial
concentration of NO was 0.00M...
asked 27 minutes ago -
On a recent quiz, the class mean was 75 with a standard
deviation of 2.2. Calculate...
asked 43 minutes ago -
Discuss the Coefficient of Restitution in an elastic collision
compared to the Coefficient of Restitution in...
asked 47 minutes ago -
Pretend that you are
the audit manager on an annual financial statement audit engagement
for a...
asked 56 minutes ago -
A certain lens focuses light from an object 1.65 m away as an
image 41.8 cm...
asked 56 minutes ago