Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
QUESTION 2 What is the IUPAC name for this compound? CHE -CH2CH2CH2CH, QUESTION 3 What is the IUPAC name for this compound? -CH2CH3 CH2CH2CH, QUESTION 4 What is the IUPAC name for this compound? Br CH3CH2CH2CH2CCH NO2
QUESTION 1 What is the IUPAC name for this compound? CH,CH= CHCH2CH2CH2CH3 QUESTION 2 What is the IUPAC name for this compound? H3C CH2CH3 QUESTION 3 What is the IUPAC name for this compound? сна QUESTION 4 What is the IUPAC name for this compound? сну Hyc=cнс насненснен снаснасн; QUESTION 5 QUESTIONS ne nentor Sigma bonds are the result of _ overlap of orbitals
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
Give the IUPAC name for the following compound H H₃G CH3 도 H CH2CH3 CH(CH3)2 I
Part 6 Write the IUPAC name for the following compound: CH, CH3-N-CH, Spell out the IUPAC name of the compound. Submit Request Answer
me for the following compound? 8. What is the IUPAC name for the follo jethe IUPAC name for the following compound 10. What is the IUPAC name for the following compound? НО, 11. What is the IUPAC name for the following compound? 12. Arrange the following compounds in decreasing (highest to lowest) order of boiling point and explain your choice. CH3CH2CH2CH2NH2 CH3CH,N(CH3 CH2CH2CH NHCH;
8. Give the IUPAC name for the following compound. CH2CH2CH(CH3)CH2COOLI Enter your answer here
Part B Give IUPAC name for the following compound HỌC, CH, H C=C=CH-CH, Spell out the full name of the compound. 3-methylhept-2-ene-4-yne You have already submitted this answer. Enter a new answer No credit lost. Try again Submit Previous Answer Reguest Answer Part E Give IUPAC name for the following compound: -CH2-CC-CH, Spell out the full name of the compound. 4-cyclopenivibu2 vne Submit Previous Answers Request Answer X Incorrect; Try Again; 4 attempts remaining
IUPAC name CH2CH2CH2CH3 CH2= C—CH-CH=CHCH,CH, CH2CH3
What is the IUPAC name for the following compound? CH, CH_CHCH CH,—<-CH2-CH-CH, CH,CH Enter the name of the molecule. View Available Hint(s) þentane Submit