Name two areas of the human body with the highest concentration of lymph nodes and speculate...
Name two areas of the human body with the highest concentration of lymph nodes and speculate
why they are located at such high concentrations at these locations.
Homework Answers
Remember that the lymph nodes are highly important during maturation and development of some white blood cells. Additionally, they are involved in draining the lymph (white fluid composed by white blood cells). In order to drain the lymph in a proper way, it is important the distribution of lymph nodes in specific part of the body. The most concentrated zones on the human body is the axillary and inguinal regions. As you can observe, the axillary region is in the upper zone of the body and the inguinal in the lower part of the body.
So, it is important to have high concentration of lymph nodes in the axillary region since it will drain lymph that comes from the breast, neck, upper arms and underarm areas. While the inguinal region will focus in the abdominal wall, back, vulva, anus, perineum and scrotum.
Add Answer to:
Name two areas of the human body with the highest concentration
of lymph nodes and speculate...
Zinc is present in the human body at a concentration of 33 ppm. If an average...
Zinc is present in the human body at a concentration of 33 ppm. If an average human body has a mass of 70.0 kg, what mass (in grams) of zinc is present? Give your answer to two significant figures. Answer in g Zn
9) Identification : (5 points) What is this tissue/structure: Name a location in the human body...
9) Identification : (5 points) What is this tissue/structure: Name a location in the human body where this tissue/structure is located? Name ONE of its major functions?
Buffers have a capacity and a range that depend on what two factors? A. A) Highest...
Buffers have a capacity and a range that depend on what two factors? A. A) Highest concentration possible and intermolecular force B. B) Vapor pressure and equal concentrations of acid and conjugate salt base C. C) Highest concentration possible and equal concentration of acid and conjugate salt D. D) A high value of K and moderate concentrations E. E) all of the above
Name one type of cell in the human body from which you could NOT extract chromosomal...
Name one type of cell in the human body from which you could NOT extract chromosomal DNA and explain why.
Q11) It is crucial that the human body control the concentration of H ions for any...
Q11) It is crucial that the human body control the concentration of H ions for any significant change can lead to sickness or death. Breathing controls the amount of CO2 in the lungs which can ultimately impact the bodies H' concentration. 3 (ag) a) If the breathing rate is slowed down, the concentration of CO2 in the lungs increases. Use LeChatelier's principle and discuss how holding your breath can impact the H concentration. (This is called "respiratory acidosis") What would...
Human being breaths in order to provide the means for gas exchange for the entire body. A respira...
Human being breaths in order to provide the means for gas exchange for the entire body. A respiratory control system is needed to ensure that the body's needs for this gas exchange are adequately met. The criterion of control is adequate ventilation, which ensures satisfactory levels of both ca controlled by neural impulses that originate within the lower brain and are transmitted to the chest cavity and diaphragm to govem the rate and tidal volume. One source of the signals...
1. Why can't fatty acids serve as fuel for the brain? 2. The human body has...
1. Why can't fatty acids serve as fuel for the brain? 2. The human body has a storage capacity for excess carbohydrates and fats but not for excess proteins. What consequences does this have for a daily diet? 3. Explain how a high concentration of glucose causes a decrease in the rate of glycolysis. 4. Ketone bodies are said to be better fuel for our bodies. Discuss the pros and cons. 5. Discuss how glycerol metabolism utilized glycerol that otherwise...
Name two important areas of health psychology that require more research, current research findings, and why...
Name two important areas of health psychology that require more research, current research findings, and why do they require further study?
Chapter 1 Oranization of the Human Body3 Digestive system, which converts raw food materials into products...
Chapter 1 Oranization of the Human Body3 Digestive system, which converts raw food materials into products . Urinary system, which removes wastes and excess water usable by cells . Reproductive system, by which new individuals of the species are produced All the cellular reactions that sustain life together make up into catabolism and anabolism. In catabolism, complex substances are broken down into simpler molecules. When the nutrients from food are broken down by catabolism, energy is released. This energy is...
tive system, which converts raw food materials into products usable by cells Chapter 1 Organization of the Human Bo...
tive system, which converts raw food materials into products usable by cells Chapter 1 Organization of the Human Body3 enary system, which removes wastes and excess water uctive system, by which new individuals of the species are produced the cellular reactions that sustain life together make up metabolism, which can be d nd anabolism. In catabolism, complex substances are broken down into simpler into catabolism les. When the nutrients from food are broken down by catabolism, energy is re molec...
9) Identification : (5 points) What is this tissue/structure: Name a location in the human body where this tissue/structure is located? Name ONE of its major functions?
Q11) It is crucial that the human body control the concentration of H ions for any significant change can lead to sickness or death. Breathing controls the amount of CO2 in the lungs which can ultimately impact the bodies H' concentration. 3 (ag) a) If the breathing rate is slowed down, the concentration of CO2 in the lungs increases. Use LeChatelier's principle and discuss how holding your breath can impact the H concentration. (This is called "respiratory acidosis") What would...
Human being breaths in order to provide the means for gas exchange for the entire body. A respiratory control system is needed to ensure that the body's needs for this gas exchange are adequately met. The criterion of control is adequate ventilation, which ensures satisfactory levels of both ca controlled by neural impulses that originate within the lower brain and are transmitted to the chest cavity and diaphragm to govem the rate and tidal volume. One source of the signals...
Chapter 1 Oranization of the Human Body3 Digestive system, which converts raw food materials into products . Urinary system, which removes wastes and excess water usable by cells . Reproductive system, by which new individuals of the species are produced All the cellular reactions that sustain life together make up into catabolism and anabolism. In catabolism, complex substances are broken down into simpler molecules. When the nutrients from food are broken down by catabolism, energy is released. This energy is...
tive system, which converts raw food materials into products usable by cells Chapter 1 Organization of the Human Body3 enary system, which removes wastes and excess water uctive system, by which new individuals of the species are produced the cellular reactions that sustain life together make up metabolism, which can be d nd anabolism. In catabolism, complex substances are broken down into simpler into catabolism les. When the nutrients from food are broken down by catabolism, energy is re molec...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 49 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago