Homework Answers
Add Answer to:
8. According to Le Chatelier, adding heat to an endothermic equilibrium reaction will cause: (A) No...
Equilibrium and Le Chatelier Principle In an endothermic reaction what is correct about the energy in...
Equilibrium and Le Chatelier Principle
In an endothermic reaction what is correct about the energy in the reaction? O Energy becomes available Energy is absorbed O The energy stays the same O The reaction needs to be kept cold O Only one component realeases energy What is the main difference between a reversible and irreversible reaction? O Both a irreversable and a reversible make products are formed but not reactants irreversable reaction the products cannot convert back to the reactants,...
Question 3 1.5 pts each response In 1887, Henry Louis Le Chatelier formulated the principles that...
Question 3 1.5 pts each response In 1887, Henry Louis Le Chatelier formulated the principles that documented the effects of disturbing a reaction at equilibrium. In the 1880's, farmers were in dire need of fertilizer containing ammonia, NH, and miners required Ammonia for use in their explosives. This is the reaction Le Chatelier worked with: 2 N; (6) + 3H2(e) 2 NH, (c) Hºrn = -92.22 kJ Ves Indicate whether the following parameters should be increased or decreased in order...
For each of the following reactions: (a) Write the Equilibrium expression (b) Calculate the Equilibrium Constant,...
For each of the following reactions: (a) Write the Equilibrium expression (b) Calculate the Equilibrium Constant, Kc (c) Determine the DIRECTION of the reaction (d) Determine if the reaction is in Equilibrium (e) Determine the effect of INCREASING the temperature (f) Determine the effect of increasing the concentration of ONE of the reactants. (g) Determine the effect of increasing the volume of the container. (h) Determine the effect of increasing the Pressure in the container. Reaction 1: N204(g) 2NO2(g) Reaction...
24. A hypothetical endothermic reaction, A2(aq) + B(aq) ↔ BA2(g), has an equilibrium constant of 2.3x10-4....
24. A hypothetical endothermic reaction, A2(aq) + B(aq) ↔ BA2(g), has an equilibrium constant of 2.3x10-4. A2 is yellow, B is clear, and BA2 is blue. If the reaction is at equilibrium and the volume is increased, which color will increase? a. Yellow b. Blue c. Neither d. Both
Now let us do some Le Chatelier C(s)+H2O (g)←→CO (g) +H2 (g)AH-+131 kJ (in case you...
Now let us do some Le Chatelier C(s)+H2O (g)←→CO (g) +H2 (g)AH-+131 kJ (in case you don't remember, this is an endothermic reaction). 4. A rigid container holds a mixture of graphite pellets (C(s)), water vapor, carbon monoxide gas, and hydrogen gas at equilibrium. State whether the number of moles of CO (g) in the container will increase, decrease, or remain the same after each of the following disturbances is applied to the original mixture. For each case, assume that...
19) Consider the following reaction, equilibrium concentrations, and equilibrium constant at a particular temperature. Determine the...
19) Consider the following reaction, equilibrium concentrations, and equilibrium constant at a particular temperature. Determine the equilibrium concentration of H2O(g). C2H4(8) + H2O(g) - C2H5OH(g) Kc = 9.0 x 103 (C2H4leq=0.015 M [C2H5OHleq=1.69 M A) 1.0 M B) 9.9 x 10-7 M C) 0.013 M D) 1.68 M E) 80.M 20) Consider the following reaction at equilibrium. What effect will increasing the volume of the reactic mixture have on the system? 20) 2 H2S(8) + 3 O2(g) + 2 H2O(g)...
If the equilibrium constant, Kc for the hypothetical reaction A(g) ⇄ B(g) is 50 at a...
If the equilibrium constant, Kc for the hypothetical reaction A(g) ⇄ B(g) is 50 at a given temperature, and if [A] = 0.020 M and [B] = 0.50 M in a mixture at that temperature 1. is the reaction at equilibrium? a) yes b) no 2. which way will the reaction shift? a) no shift b) towards the products c) towards the reactants
What is the effect of adding carbon monoxide (at constant volume and temperature) to an equilibrium...
What is the effect of adding carbon monoxide (at constant volume and temperature) to an equilibrium mixture of this reaction? CO(g) + Cl2(9) COCl2(g) The reaction slows down. The reaction shifts toward the products. The reaction does not shift in either direction. O The reaction shifts toward the reactants. The equilibrium constant for this reaction is Keq 1.0 x 103. The reaction mixture at equilibrium contains [A] = 1.0 x 10-4 M. What is the concentration of B in the...
please show work? Question 38 (8 points) A 50.0 L reaction vessel contains 2.00 mole nitrogen,...
please show work?
Question 38 (8 points) A 50.0 L reaction vessel contains 2.00 mole nitrogen, 3.00 mole hydrogen and 0.500 mole NH3. The mixture is approaching the following equilibrium: N2(g) + 3H2(g) + 2NH3(9) a) Calculate the reaction quotient Q. b) If the value of Kc is 0.500, predict which direction the reaction will go in order to reach equilibrium(to the right, to the left, or no change). Explain your answer.
1.At 450°C, tert-butyl alcohol decomposes into water and isobutene. (CH3)3COH(g) (CH3)2CCH2(g) + H2O(g) A reaction vessel...
1.At 450°C, tert-butyl alcohol decomposes into water and isobutene. (CH3)3COH(g) (CH3)2CCH2(g) + H2O(g) A reaction vessel contains these compounds at equilibrium. What will happen if the volume of the container is reduced by 50% at constant temperature? A. The forward reaction will proceed in order to reestablish equilibrium. B. The reverse reaction will proceed in order to reestablish equilibrium. C. No change occurs. D. The equilibrium constant will increase. E. The equilibrium constant will decrease. 2. The following reaction is...
Equilibrium and Le Chatelier Principle
In an endothermic reaction what is correct about the energy in the reaction? O Energy becomes available Energy is absorbed O The energy stays the same O The reaction needs to be kept cold O Only one component realeases energy What is the main difference between a reversible and irreversible reaction? O Both a irreversable and a reversible make products are formed but not reactants irreversable reaction the products cannot convert back to the reactants,...
Question 3 1.5 pts each response In 1887, Henry Louis Le Chatelier formulated the principles that documented the effects of disturbing a reaction at equilibrium. In the 1880's, farmers were in dire need of fertilizer containing ammonia, NH, and miners required Ammonia for use in their explosives. This is the reaction Le Chatelier worked with: 2 N; (6) + 3H2(e) 2 NH, (c) Hºrn = -92.22 kJ Ves Indicate whether the following parameters should be increased or decreased in order...
For each of the following reactions: (a) Write the Equilibrium expression (b) Calculate the Equilibrium Constant, Kc (c) Determine the DIRECTION of the reaction (d) Determine if the reaction is in Equilibrium (e) Determine the effect of INCREASING the temperature (f) Determine the effect of increasing the concentration of ONE of the reactants. (g) Determine the effect of increasing the volume of the container. (h) Determine the effect of increasing the Pressure in the container. Reaction 1: N204(g) 2NO2(g) Reaction...
Now let us do some Le Chatelier C(s)+H2O (g)←→CO (g) +H2 (g)AH-+131 kJ (in case you don't remember, this is an endothermic reaction). 4. A rigid container holds a mixture of graphite pellets (C(s)), water vapor, carbon monoxide gas, and hydrogen gas at equilibrium. State whether the number of moles of CO (g) in the container will increase, decrease, or remain the same after each of the following disturbances is applied to the original mixture. For each case, assume that...
19) Consider the following reaction, equilibrium concentrations, and equilibrium constant at a particular temperature. Determine the equilibrium concentration of H2O(g). C2H4(8) + H2O(g) - C2H5OH(g) Kc = 9.0 x 103 (C2H4leq=0.015 M [C2H5OHleq=1.69 M A) 1.0 M B) 9.9 x 10-7 M C) 0.013 M D) 1.68 M E) 80.M 20) Consider the following reaction at equilibrium. What effect will increasing the volume of the reactic mixture have on the system? 20) 2 H2S(8) + 3 O2(g) + 2 H2O(g)...
What is the effect of adding carbon monoxide (at constant volume and temperature) to an equilibrium mixture of this reaction? CO(g) + Cl2(9) COCl2(g) The reaction slows down. The reaction shifts toward the products. The reaction does not shift in either direction. O The reaction shifts toward the reactants. The equilibrium constant for this reaction is Keq 1.0 x 103. The reaction mixture at equilibrium contains [A] = 1.0 x 10-4 M. What is the concentration of B in the...
please show work?
Question 38 (8 points) A 50.0 L reaction vessel contains 2.00 mole nitrogen, 3.00 mole hydrogen and 0.500 mole NH3. The mixture is approaching the following equilibrium: N2(g) + 3H2(g) + 2NH3(9) a) Calculate the reaction quotient Q. b) If the value of Kc is 0.500, predict which direction the reaction will go in order to reach equilibrium(to the right, to the left, or no change). Explain your answer.
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 6 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 23 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 24 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 37 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 6 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago