When oxygen is in its elemental form, O2, it has an oxidation number of 0. True...
When oxygen is in its elemental form, O2, it has an oxidation number of 0.
True False
Homework Answers
Yes statment is true
Suppose oxidation number of O = x
O2 = 2*x
Net charge present on the O2 = 0
So, 2x = 0
x = 0 ( it means oxygen neither gained or loosed electrons )
If you have any questions please comment
If you satisfied with the solution please rate it thanks
Add Answer to:
When oxygen is in its elemental form, O2, it has an oxidation
number of 0.
True...
4. When a substance is in its elemental form (existing alone without bonds to other elements),...
4. When a substance is in its elemental form (existing alone without bonds to other elements), the oxidation number is 0 1 02 03 5. The sum of the oxidation numbers within a formula is equal to the overall charge of the formula. True 0 False 6. A spectator ion is during a chemical reaction. O oxidized o reduced both oxidized and reduced 0 neither oxidized nor reduced
When elemental carbon is burned in the open atmosphere, with plenty of oxygen gas present, the...
When elemental carbon is burned in the open atmosphere, with plenty of oxygen gas present, the product is carbon dioxide. C(s)+O2(g) -> CO2(g) However, when the amount of oxygen present during the burning of the carbon is restricted, carbon monoxide is more likely to result. 2C(s)+O2(g) -> 2CO(g) What mass of each product is expected when a 8.60 g sample of pure carbon is burned under each of these conditions? ____g CO2 ____ g CO
Elemental S reacts with O2 to form SO3 according to the reaction 2S+3O2→2SO3 as depicted here.(Figure...
Elemental S reacts with O2 to form SO3 according to the reaction 2S+3O2→2SO3 as depicted here.(Figure 1) (Part A) How many O2 molecules are needed to react with 4.41 g of S? (Part B) What is the theoretical yield of SO3 produced by 4.41 g of S? (Part C) For each of the given situations, indicate whether S or O2 is the limiting reactant. 1. 3 mol sulfur, 5 mol oxygen 2. 3 mol sulfur, 4 mol oxygen 3. 3...
Elemental S reacts with O2 gas to form SO3 gas according to thereaction depicted here....
Elemental S reacts with O2 gas to form SO3 gas according to the reaction depicted here.Before a chemical equation can be used to conduct stoichiometric analysis, it must balanced. Type the balanced chemical equation for this reaction between solid sulfur and oxygen gas.Express your answer as a chemical equation including phases.
What is the change in C oxidation number when carbon monoxide reacts with oxygen to make...
What is the change in C oxidation number when carbon monoxide reacts with oxygen to make carbon dioxide? It may help to write out the chemical equation. с 0 0 0 0
) Oxygen has a -2 oxidation number 5) Group 7A elements have a -1 oxidation number...
) Oxygen has a -2 oxidation number 5) Group 7A elements have a -1 oxidation number 7) Group 6A elements have 2 oxidation number. 8) Group 5A elements have -3 oxidation number. en there is a conflict between two of these rules or ambiguity nber, apply rule that comes first and ignore the conflicting rul What is the oxidation number for: a. CI04- b. SF6 C. NaOBr d. Bi2S3 e. O2F2 Determine what has been oxidized and what has been...
POL Elemental nitrogen and oxygen gases react to form gaseous NO. N2(0)+ 02 (0)22 NO(g) Suppose...
POL Elemental nitrogen and oxygen gases react to form gaseous NO. N2(0)+ 02 (0)22 NO(g) Suppose that the partial pressures of N2 and O2 are initially 0.250 atm and the reaction is allowed to reach equilibrium at a high temperature. At equilibrium, the partial pressure of NO is 0.0122 atm. Determine the equilibrium constant Kp of this reaction at this temperature by using ICE table. 0.0025 0.0040 0.0251 0.205 Question 1 Use these data for the reaction A + 2B...
Ozone, O_3(g), is a form of elemental oxygen that is important in the absorption of ultraviolet...
Ozone, O_3(g), is a form of elemental oxygen that is important in the absorption of ultraviolet radiation in the stratosphere. It decomposes to O_2(g) at room temperature and pressure according to the following reaction: (a) What is the enthalpy change for this reaction per mole of O_3(g)? (b) Which has the higher enthalpy under these conditions, 2 O_3(g) or 3 O_2(g)?
oxidation state Aluminum in AlCl3, Carbon in C2O4^2-,oxygen in O2
oxidation state Aluminum in AlCl3, Carbon in C2O4^2-,oxygen in O2
1. One mole of oxygen gas (O2) molecules has fewer atoms than one mole of ozone...
1. One mole of oxygen gas (O2) molecules has fewer atoms than one mole of ozone gas (O3) molecules ( True or false) 2. One molecule of oxygen gas (O2) has fewer atoms than one mole of ozone gas (O3) (True or false)
4. When a substance is in its elemental form (existing alone without bonds to other elements), the oxidation number is 0 1 02 03 5. The sum of the oxidation numbers within a formula is equal to the overall charge of the formula. True 0 False 6. A spectator ion is during a chemical reaction. O oxidized o reduced both oxidized and reduced 0 neither oxidized nor reduced
What is the change in C oxidation number when carbon monoxide reacts with oxygen to make carbon dioxide? It may help to write out the chemical equation. с 0 0 0 0
) Oxygen has a -2 oxidation number 5) Group 7A elements have a -1 oxidation number 7) Group 6A elements have 2 oxidation number. 8) Group 5A elements have -3 oxidation number. en there is a conflict between two of these rules or ambiguity nber, apply rule that comes first and ignore the conflicting rul What is the oxidation number for: a. CI04- b. SF6 C. NaOBr d. Bi2S3 e. O2F2 Determine what has been oxidized and what has been...
POL Elemental nitrogen and oxygen gases react to form gaseous NO. N2(0)+ 02 (0)22 NO(g) Suppose that the partial pressures of N2 and O2 are initially 0.250 atm and the reaction is allowed to reach equilibrium at a high temperature. At equilibrium, the partial pressure of NO is 0.0122 atm. Determine the equilibrium constant Kp of this reaction at this temperature by using ICE table. 0.0025 0.0040 0.0251 0.205 Question 1 Use these data for the reaction A + 2B...
Ozone, O_3(g), is a form of elemental oxygen that is important in the absorption of ultraviolet radiation in the stratosphere. It decomposes to O_2(g) at room temperature and pressure according to the following reaction: (a) What is the enthalpy change for this reaction per mole of O_3(g)? (b) Which has the higher enthalpy under these conditions, 2 O_3(g) or 3 O_2(g)?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 8 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 40 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago