If a system of six particles can exist in 121 different microstates what is the entropy...
If a system of six particles can exist in 121 different microstates what is the entropy of the system in J/K?
Homework Answers
Add Answer to:
If a system of six particles can exist in 121 different
microstates what is the entropy...
A gaseous system undergoes a change in temperature and volume. What is the entropy change for...
A gaseous system undergoes a change in temperature and volume.
What is the entropy change for a particle in this system if the
final number of microstates is 0.465 times that of the initial
number of microstates? (units is J/K.particle)
Quantitative relationship between entropy and number of microstates the Boltzmann equation where k is the Boltzmann constant per molecule (particle), 1.38 × 10 23 J/(K-particle). From this equation the entropy change, ΔS, for a system can be related to the...
Entropy, S, is related to the number of accessible microstates, W, by the following equation S...
Entropy, S, is related to the number of accessible microstates, W, by the following equation S kB InW where kg is the Boltzmann constant and has a value of 1.381 x10-23/K. Use the appropriate standard molar entropy 238.8 J/mol. K to calculate how many microstates are accessible to a single molecule of 03 (g) at 298 K
The following relationships regarding entropy (S) and the number of microstates in a system (W) are...
The following relationships regarding entropy (S) and the number of microstates in a system (W) are true at 0 K: a. S = 0, W = 0 b. S = 1, W = 0 c. S = 0, W = 1 d. S = 213.7, W = 7.69 x 1034 e. S = -213.7, W = 7.69 x 1034
user page 16 Question (6 points) Entropy. S is related to the number of accessible microstates,...
user page 16 Question (6 points) Entropy. S is related to the number of accessible microstates, W. by the following equation: S = kg InW where ky is the Boltzmann constant and has a value of 1.381 x10 23 J/K. 3rd attempt Feedback See Periodic Table See Hint Use the appropriate standard molar entropy 188.8 Jmolek to calculate how many microstates are accessible to a single molecule of H20 (s) at 298 K. 0236 1011
Ludwig Boltzmann developed a molecular-scale statistical model that relates the entropy of a system to the number of possible microstates (W) for the system. What is the equation that describes this r...
Ludwig Boltzmann developed a molecular-scale statistical model that relates the entropy of a system to the number of possible microstates (W) for the system. What is the equation that describes this relationship?
4. Configurational Entropy. 25 points. The following is an isolated system: a six-digit number consisting of...
4. Configurational Entropy. 25 points. The following is an isolated system: a six-digit number consisting of 4 sevens and 2 threes in any sequence. a. What is the probability that the system is in the following microstate: 373777? Give your answer in percent (%). b. Which microstate is more likely: 373777 or 777733? c. What is the probability that the system is in any one of the many microstates where the 2 threes are together (e.g., 777733)? Give your answer...
3. Entropy of physical systems (a) Consider two interacting systems A and B. Calculate the number of microstates an...
3. Entropy of physical systems (a) Consider two interacting systems A and B. Calculate the number of microstates and the entropy S of the combined system if i. (1 point) ΩΑ-2 and Ω13 3; ii. (1 point) A0204 and 2B 103x104 (b) A 20 Ω resistor is held at constant temperature of 300 K. A 10 A current is passed through the resistor for a minute i. (1 point) What is the change in entropy of the resistor? ii. (1...
Consider a system with four particles. If each particle has two distinct configurations, how many microstates...
Consider a system with four particles. If each particle has two distinct configurations, how many microstates does the system have?
Using Boltzmann’s equation, calculate the entropy of a system consisting of one mole of gas in...
Using Boltzmann’s equation, calculate the entropy of a system consisting of one mole of gas in which each molecule of gas has 10 possible microstates. How does this value compare with the standard molar entropy of helium gas (see lecture slides for examples of standard values!). (Boltzmann’s constant k = 1.38 x 10-23 J/K)
11 Consider an assembly of N-4 particles in a system which has equally spaced non degenerate...
11 Consider an assembly of N-4 particles in a system which has equally spaced non degenerate energy levels, U-0.e,2e,3e, The total energy of the system is U 6. a) Assuming the particles are distinguishable, how many distributions of the particles over the energy levels are possible? List all of them in a table showing the number [7] of particles, n, in each energy level U b) To which particle statistics does this scenario correspond? c) How many microstates contribute to...
A gaseous system undergoes a change in temperature and volume.
What is the entropy change for a particle in this system if the
final number of microstates is 0.465 times that of the initial
number of microstates? (units is J/K.particle)
Quantitative relationship between entropy and number of microstates the Boltzmann equation where k is the Boltzmann constant per molecule (particle), 1.38 × 10 23 J/(K-particle). From this equation the entropy change, ΔS, for a system can be related to the...
Entropy, S, is related to the number of accessible microstates, W, by the following equation S kB InW where kg is the Boltzmann constant and has a value of 1.381 x10-23/K. Use the appropriate standard molar entropy 238.8 J/mol. K to calculate how many microstates are accessible to a single molecule of 03 (g) at 298 K
user page 16 Question (6 points) Entropy. S is related to the number of accessible microstates, W. by the following equation: S = kg InW where ky is the Boltzmann constant and has a value of 1.381 x10 23 J/K. 3rd attempt Feedback See Periodic Table See Hint Use the appropriate standard molar entropy 188.8 Jmolek to calculate how many microstates are accessible to a single molecule of H20 (s) at 298 K. 0236 1011
4. Configurational Entropy. 25 points. The following is an isolated system: a six-digit number consisting of 4 sevens and 2 threes in any sequence. a. What is the probability that the system is in the following microstate: 373777? Give your answer in percent (%). b. Which microstate is more likely: 373777 or 777733? c. What is the probability that the system is in any one of the many microstates where the 2 threes are together (e.g., 777733)? Give your answer...
3. Entropy of physical systems (a) Consider two interacting systems A and B. Calculate the number of microstates and the entropy S of the combined system if i. (1 point) ΩΑ-2 and Ω13 3; ii. (1 point) A0204 and 2B 103x104 (b) A 20 Ω resistor is held at constant temperature of 300 K. A 10 A current is passed through the resistor for a minute i. (1 point) What is the change in entropy of the resistor? ii. (1...
11 Consider an assembly of N-4 particles in a system which has equally spaced non degenerate energy levels, U-0.e,2e,3e, The total energy of the system is U 6. a) Assuming the particles are distinguishable, how many distributions of the particles over the energy levels are possible? List all of them in a table showing the number [7] of particles, n, in each energy level U b) To which particle statistics does this scenario correspond? c) How many microstates contribute to...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 19 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 41 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago