The following relationships regarding entropy (S) and the number of microstates in a system (W) are...
The following relationships regarding entropy (S) and the number of microstates in a system (W) are true at 0 K:
a. S = 0, W = 0
b. S = 1, W = 0
c. S = 0, W = 1
d. S = 213.7, W = 7.69 x 1034
e. S = -213.7, W = 7.69 x 1034
Homework Answers
At 0 K, the number of microstates in a system ( W) are 1. The relation between entropy (S) and the number of microstates in system(W) is given by S = 2.303 klog (W)
S = 2.303*k*log(1) = 0 because log(1) = 0.
Add Answer to:
The following relationships regarding entropy (S) and the number
of microstates in a system (W) are...
Entropy, S, is related to the number of accessible microstates, W, by the following equation S...
Entropy, S, is related to the number of accessible microstates, W, by the following equation S kB InW where kg is the Boltzmann constant and has a value of 1.381 x10-23/K. Use the appropriate standard molar entropy 238.8 J/mol. K to calculate how many microstates are accessible to a single molecule of 03 (g) at 298 K
user page 16 Question (6 points) Entropy. S is related to the number of accessible microstates,...
user page 16 Question (6 points) Entropy. S is related to the number of accessible microstates, W. by the following equation: S = kg InW where ky is the Boltzmann constant and has a value of 1.381 x10 23 J/K. 3rd attempt Feedback See Periodic Table See Hint Use the appropriate standard molar entropy 188.8 Jmolek to calculate how many microstates are accessible to a single molecule of H20 (s) at 298 K. 0236 1011
3. Entropy of physical systems (a) Consider two interacting systems A and B. Calculate the number of microstates an...
3. Entropy of physical systems (a) Consider two interacting systems A and B. Calculate the number of microstates and the entropy S of the combined system if i. (1 point) ΩΑ-2 and Ω13 3; ii. (1 point) A0204 and 2B 103x104 (b) A 20 Ω resistor is held at constant temperature of 300 K. A 10 A current is passed through the resistor for a minute i. (1 point) What is the change in entropy of the resistor? ii. (1...
Ludwig Boltzmann developed a molecular-scale statistical model that relates the entropy of a system to the number of possible microstates (W) for the system. What is the equation that describes this r...
Ludwig Boltzmann developed a molecular-scale statistical model that relates the entropy of a system to the number of possible microstates (W) for the system. What is the equation that describes this relationship?
02 Question (1 point) a See page 866 Entropy, S, is related to the number of...
02 Question (1 point) a See page 866 Entropy, S, is related to the number of accessible microstates, W, by the following equation: s-kg InW where kB is the Boltzmann constant and has a value of 1.381 ×10-23 J/K. 1st attempt d See Periodic Table Q See Hint Use the appropriate standard molar entropy 238.8 J/mol.K to calculate how many microstates are accessible to a single molecule of O3 (8) at 298 K.
1. By considering macrostates and microstates of an ensemble, explain why entropy tends to increa...
1. By considering macrostates and microstates of an ensemble, explain why entropy tends to increase. 2. As the number of states available to a system increases , the entropy: a) Remains Constant b) Increases c) Decreases d) None of the above
Which of the following statements concerning entropy is NOT correct? a. The dispersal of matter, such...
Which of the following statements concerning entropy is NOT correct? a. The dispersal of matter, such as the spontaneous expansion of a gas, cannot be explained by an increase in entropy. b. The entropy of a system is proportional to the natural log of the number of microstates. c. The entropy of a system increases as the number of available microstates increases. d. In a spontaneous process, ΔS(universe) indicates the extent to which energy is dispersed. e. Entropy is a...
4. Configurational Entropy. 25 points. The following is an isolated system: a six-digit number consisting of...
4. Configurational Entropy. 25 points. The following is an isolated system: a six-digit number consisting of 4 sevens and 2 threes in any sequence. a. What is the probability that the system is in the following microstate: 373777? Give your answer in percent (%). b. Which microstate is more likely: 373777 or 777733? c. What is the probability that the system is in any one of the many microstates where the 2 threes are together (e.g., 777733)? Give your answer...
calculate the number of microstates corresponding to each of the following combinations: Calculate the number of...
calculate the number of microstates corresponding to each of the
following combinations:
Calculate the number of microstates corresponding to each of the following combinations: 4. a. b. c. d. e. A system with three particles and four energy bands A system with 15 particles and four energy levels A system with four particles and 15 energy levels A cluster of 50 particles each of which may reside in any of 30 energy levels 1000 particles that may reside in 100...
Let's say we have 4 small interacting systems. I've already calculated the number of microstates for...
Let's say we have 4 small interacting systems. I've already calculated the number of microstates for each independent system which are as follows; Ohm_1 = 6 Times 10^5, Ohm_2 = 3 Times 10^6, Ohm_3 = 5 Times 10^5, and Ohm_4 = 8 Times 10^6. a) When the 4 systems are interacting what is the total number of states (microstates, Ohm_T) accessible? b) What are S_1, S_2, S_3, and S_4 (entropy of each system independently) in terms of Boltzmann's Constant, k?...
Entropy, S, is related to the number of accessible microstates, W, by the following equation S kB InW where kg is the Boltzmann constant and has a value of 1.381 x10-23/K. Use the appropriate standard molar entropy 238.8 J/mol. K to calculate how many microstates are accessible to a single molecule of 03 (g) at 298 K
user page 16 Question (6 points) Entropy. S is related to the number of accessible microstates, W. by the following equation: S = kg InW where ky is the Boltzmann constant and has a value of 1.381 x10 23 J/K. 3rd attempt Feedback See Periodic Table See Hint Use the appropriate standard molar entropy 188.8 Jmolek to calculate how many microstates are accessible to a single molecule of H20 (s) at 298 K. 0236 1011
3. Entropy of physical systems (a) Consider two interacting systems A and B. Calculate the number of microstates and the entropy S of the combined system if i. (1 point) ΩΑ-2 and Ω13 3; ii. (1 point) A0204 and 2B 103x104 (b) A 20 Ω resistor is held at constant temperature of 300 K. A 10 A current is passed through the resistor for a minute i. (1 point) What is the change in entropy of the resistor? ii. (1...
02 Question (1 point) a See page 866 Entropy, S, is related to the number of accessible microstates, W, by the following equation: s-kg InW where kB is the Boltzmann constant and has a value of 1.381 ×10-23 J/K. 1st attempt d See Periodic Table Q See Hint Use the appropriate standard molar entropy 238.8 J/mol.K to calculate how many microstates are accessible to a single molecule of O3 (8) at 298 K.
4. Configurational Entropy. 25 points. The following is an isolated system: a six-digit number consisting of 4 sevens and 2 threes in any sequence. a. What is the probability that the system is in the following microstate: 373777? Give your answer in percent (%). b. Which microstate is more likely: 373777 or 777733? c. What is the probability that the system is in any one of the many microstates where the 2 threes are together (e.g., 777733)? Give your answer...
calculate the number of microstates corresponding to each of the
following combinations:
Calculate the number of microstates corresponding to each of the following combinations: 4. a. b. c. d. e. A system with three particles and four energy bands A system with 15 particles and four energy levels A system with four particles and 15 energy levels A cluster of 50 particles each of which may reside in any of 30 energy levels 1000 particles that may reside in 100...
Let's say we have 4 small interacting systems. I've already calculated the number of microstates for each independent system which are as follows; Ohm_1 = 6 Times 10^5, Ohm_2 = 3 Times 10^6, Ohm_3 = 5 Times 10^5, and Ohm_4 = 8 Times 10^6. a) When the 4 systems are interacting what is the total number of states (microstates, Ohm_T) accessible? b) What are S_1, S_2, S_3, and S_4 (entropy of each system independently) in terms of Boltzmann's Constant, k?...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 57 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago