Homework Answers
THC is non-hydrolyzable lipid. The lipid containing ester functional group are only hydrolyzable. Non-hydrolyzable lipids are lack of this ester functional group and they are fat soluble. That's why THC is non-hydrolyzable lipid.
Add Answer to:
3) Tetrahydrocannabinol (THC) is the principal is mostly fat-soluble, which is why it lasts a long...
1. Explain how soluble fiber lowers blood cholesterol, and list at least 3 foods high in...
1. Explain how soluble fiber lowers blood cholesterol, and list at least 3 foods high in soluble fiber: 2. Describe the health benefits of omega 3 fatty acids, and list at least 3 foods high in these. 3. Describe the health benefits of monounsaturated fats, and list at least 3 foods high in these. HTML EditorKeyboard Shortcuts 12pt Paragraph 0 words Flag this Question Question 386 pts Your roommate is in a hurry to lose 20 pounds, because her high...
Who is at highest risk for liver disease? What is the portal circulation? How/Why does portal...
Who is at highest risk for liver disease? What is the portal circulation? How/Why does portal hypertension occur? What role do the collateral vessels play in portal hypertension? Elevations of which 2 LFT are indicative of generalized liver inflammation? Which of these 2 tests is specific to the liver? Why does the albumin level help assess liver function? Why is PT (prothrombin time) a liver function test? Why might the GTT be elevated? What 2 diseases might the alkaline phosphatase...
write a detailed summary in an organized format. It must include 3-4 key points of the...
write a detailed summary in an organized format. It must include
3-4 key points of the controversy. Break up your summary in 3-4
paragraphs.
Must include specific reasons as to why a vegetarian diet can be
better and or worse than the meat heavy diets?
Explain briefly using examples how reading this controversy has
helped you in making better dietary choices in future?
CONTROVERSY 6 Table of Contents Vegetarian and Meat-Containing Diets: What Are the Benefits and Pitfalls? Notebook LO...
Using the book, write another paragraph or two: write 170 words: Q: Compare the assumptions of...
Using the book, write another paragraph or two: write 170
words:
Q: Compare the assumptions of physician-centered and
collaborative communication. How is the caregiver’s role different
in each model? How is the patient’s role different?
Answer: Physical-centered communication involves the specialists
taking control of the conversation. They decide on the topics of
discussion and when to end the process. The patient responds to the
issues raised by the caregiver and acts accordingly. On the other
hand, Collaborative communication involves a...
Hi there! I need to compare two essay into 1 essay, and make it interesting and...
Hi there! I need to compare two essay into 1 essay, and make it interesting and choose couple topics which im going to talk about in my essay FIRST ESSAY “Teaching New Worlds/New Words” bell hooks Like desire, language disrupts, refuses to be contained within boundaries. It speaks itself against our will, in words and thoughts that intrude, even violate the most private spaces of mind and body. It was in my first year of college that I read Adrienne...
10. Write a one-page summary of the attached paper? INTRODUCTION Many problems can develop in activated...
10. Write a one-page summary of the attached paper? INTRODUCTION Many problems can develop in activated sludge operation that adversely affect effluent quality with origins in the engineering, hydraulic and microbiological components of the process. The real "heart" of the activated sludge system is the development and maintenance of a mixed microbial culture (activated sludge) that treats wastewater and which can be managed. One definition of a wastewater treatment plant operator is a "bug farmer", one who controls the aeration...
1. According to the paper, what does lactate dehydrogenase (LDH) do and what does it allow...
1. According to the paper, what does lactate dehydrogenase
(LDH) do and what does it allow to happen within the myofiber? (5
points)
2. According to the paper, what is the major disadvantage of
relying on glycolysis during high-intensity exercise? (5
points)
3. Using Figure 1 in the paper, briefly describe the different
sources of ATP production at 50% versus 90% AND explain whether you
believe this depiction of ATP production applies to a Type IIX
myofiber in a human....
write a detailed summary in an organized format. It must include
3-4 key points of the controversy. Break up your summary in 3-4
paragraphs.
Must include specific reasons as to why a vegetarian diet can be
better and or worse than the meat heavy diets?
Explain briefly using examples how reading this controversy has
helped you in making better dietary choices in future?
CONTROVERSY 6 Table of Contents Vegetarian and Meat-Containing Diets: What Are the Benefits and Pitfalls? Notebook LO...
Using the book, write another paragraph or two: write 170
words:
Q: Compare the assumptions of physician-centered and
collaborative communication. How is the caregiver’s role different
in each model? How is the patient’s role different?
Answer: Physical-centered communication involves the specialists
taking control of the conversation. They decide on the topics of
discussion and when to end the process. The patient responds to the
issues raised by the caregiver and acts accordingly. On the other
hand, Collaborative communication involves a...
1. According to the paper, what does lactate dehydrogenase
(LDH) do and what does it allow to happen within the myofiber? (5
points)
2. According to the paper, what is the major disadvantage of
relying on glycolysis during high-intensity exercise? (5
points)
3. Using Figure 1 in the paper, briefly describe the different
sources of ATP production at 50% versus 90% AND explain whether you
believe this depiction of ATP production applies to a Type IIX
myofiber in a human....
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 8 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 39 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago