Homework Answers
1.
![A cag) + Braga a Coopy + Drag) Given K= 3.4. TAJ -0.50OM [@] = 0-125M. Ccaq) + Drag) construct an ICE table. - A caq) + Beag)](http://img.homeworklib.com/questions/5a618ed0-d4a1-11eb-9c18-51f36e7bfc43.png?x-oss-process=image/resize,w_560)
Add Answer to:
Consider the reaction Areal + Blog > Clea + Diaal, which has an equilibrium constant, K,...
please answer all Consider the reaction Afaq) + B(ag) A3 C(aq) + (aq), which has an...
please answer all
Consider the reaction Afaq) + B(ag) A3 C(aq) + (aq), which has an equilibrium constant, K, equal to 3.4. 1. If one begins a reaction by placing 0.500 moles of A in a 1.0 L container as well as 0.125 moles of B, what will be the equilibrium concentrations of A, B, C, and D? Write your answers in the spaces provided below. a. [A] = b. [B]= c. [C]= d. [D]= 2. Once the reaction in...
consider the reaction A+B<----->C+D, which has an equilibrium constant K, equal to 3.4 x 10^2 1....
consider the reaction A+B<----->C+D, which has an equilibrium constant K, equal to 3.4 x 10^2 1. If one begins a reaction by placing 0.6000 moles of A in 1.0 L container as well as 0.150 moles of B, what will be the equilibrium concentrations of A, B, C, and D? 2 Once the reaction in problem one reaches equilibrium, some additional B is injected into the flask from an outside source. LeChatelier's principal says the reaction will be a) unchanged...
help please 1-4 consider the reaction A+B 3 C + D. which has an equilibrium constant,...
help please 1-4
consider the reaction A+B 3 C + D. which has an equilibrium constant, K, equal to 3.4 x 10. 1. IT one begins a reaction by placing 0.600 moles of A in a 1.0L container as well as 0.150 moles on , what will be the equilibrium concentrations of A.B.C. and D? Write your answers in the spaces provided below. a. (A) = b. [B]= = C. (C)= d. (D)= 2. Once the reaction in problem 1...
please help me out with #2 A . EE AU AaBbCctde AaBbCcD pri (B... 11 A...
please help me out with #2
A . EE AU AaBbCctde AaBbCcD pri (B... 11 A A Aa I Uab x x A A REL AaBbcc de No Spacing AaBbCcDdE Heading 2 = = Normal Heading 1 Styles Pana Consider the reaction Alag) + Blag) Claa) + Diag), which has an equilibrium constant, K, equal to 3.4. 1. If one begins a reaction by placing 0.500 moles of A in a 1.0 L container as well as 0.125 moles of...
Consider the Reaction A+B <--> C+D, which has an equilibrium constant, Kc = 3.4 x 10^2....
Consider the Reaction A+B <--> C+D, which has an equilibrium constant, Kc = 3.4 x 10^2. If one begins a reaction by placing 0.600 moles of A in a 1.0L container as well as 0.150 moles of B, what will be the equilibrium concentrations of A, B, C, D? Write your answer in the spaces below. a. [A] = ______ b. [B] = ______ c. [C] = ______ d. [D] = ______
6) Distrubuting Equilibrium a) The equilibrium constant, K, for the following reaction is 10.5 at...
6) Distrubuting Equilibrium a) The equilibrium constant, K, for the following reaction is 10.5 at 350 K 2CH2Cl2(g)CH4(g + CCl4(g) An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.32x10-2 M CH2C2, 0.172 M CH4 and 0.172 M CCI4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 9.58x102 mol of CH4(g is added to the flask? CH2Cl2l [CH4 [CCI4] b) The equilibrium constant, K, for the...
12. The equilibrium constant for the reaction of fluorine gas with bromine gas at 300 K...
12. The equilibrium constant for the reaction of fluorine gas with bromine gas at 300 K is 54.7 and the reaction is: Br2(g) +F2(g) 2 BrF(g) What is the equilibrium concentration of fluorine if the initial concentrations of bromine and fluorine were 0.125 moles/liter in a sealed container and no product was present initially? Submit Answer Tries 0/99
The equilibrium constant, Kc, for the following reaction is 55.6 at 698 K: H2(g) + I2(g)...
The equilibrium constant, Kc, for the following reaction is 55.6 at 698 K: H2(g) + I2(g) ---------->2HI(g) 1) Calculate the equilibrium concentrations of reactants and product when 0.309 moles of H2 and 0.309 moles of I2 are introduced into a 1.00 L vessel at 698 K. [H2] = M? [I2] = M? [HI] = M? 2.The equilibrium constant, K, for the following reaction is 1.20×10-2 at 500 K: PCl5(g)------->PCl3(g) + Cl2(g) An equilibrium mixture of the three gases in a...
1) The equilibrium constant, K, for the following reaction is 1.80×10-2 at 698 K. 2HI(g) H2(g)...
1) The equilibrium constant, K, for the following reaction is 1.80×10-2 at 698 K. 2HI(g) H2(g) + I2(g) An equilibrium mixture of the three gases in a 1.00 L flask at 698 K contains 0.311 M HI, 4.18×10-2 M H2 and 4.18×10-2 M I2. What will be the concentrations of the three gases once equilibrium has been reestablished, if 2.85×10-2 mol of I2(g) is added to the flask? 2) The equilibrium constant, K, for the following reaction is 1.20×10-2 at...
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u...
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u IIULS reaction: CÓ (g) + 3 H (g) + CH4 (g) + H2O (G) 1. At 25°C, Keq=4.0. What must be the Co] at equilibrium If the equilibrium concentrations of [H.]= 2.0M. (CH) = 5.0M, and (HO) = 3.OM? Answer: 0.469 M The ICE table is a way to keep track of what is happening in the reaction vessel. The initial concentrations if given...
please answer all
Consider the reaction Afaq) + B(ag) A3 C(aq) + (aq), which has an equilibrium constant, K, equal to 3.4. 1. If one begins a reaction by placing 0.500 moles of A in a 1.0 L container as well as 0.125 moles of B, what will be the equilibrium concentrations of A, B, C, and D? Write your answers in the spaces provided below. a. [A] = b. [B]= c. [C]= d. [D]= 2. Once the reaction in...
help please 1-4
consider the reaction A+B 3 C + D. which has an equilibrium constant, K, equal to 3.4 x 10. 1. IT one begins a reaction by placing 0.600 moles of A in a 1.0L container as well as 0.150 moles on , what will be the equilibrium concentrations of A.B.C. and D? Write your answers in the spaces provided below. a. (A) = b. [B]= = C. (C)= d. (D)= 2. Once the reaction in problem 1...
please help me out with #2
A . EE AU AaBbCctde AaBbCcD pri (B... 11 A A Aa I Uab x x A A REL AaBbcc de No Spacing AaBbCcDdE Heading 2 = = Normal Heading 1 Styles Pana Consider the reaction Alag) + Blag) Claa) + Diag), which has an equilibrium constant, K, equal to 3.4. 1. If one begins a reaction by placing 0.500 moles of A in a 1.0 L container as well as 0.125 moles of...
6) Distrubuting Equilibrium a) The equilibrium constant, K, for the following reaction is 10.5 at 350 K 2CH2Cl2(g)CH4(g + CCl4(g) An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.32x10-2 M CH2C2, 0.172 M CH4 and 0.172 M CCI4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 9.58x102 mol of CH4(g is added to the flask? CH2Cl2l [CH4 [CCI4] b) The equilibrium constant, K, for the...
12. The equilibrium constant for the reaction of fluorine gas with bromine gas at 300 K is 54.7 and the reaction is: Br2(g) +F2(g) 2 BrF(g) What is the equilibrium concentration of fluorine if the initial concentrations of bromine and fluorine were 0.125 moles/liter in a sealed container and no product was present initially? Submit Answer Tries 0/99
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u IIULS reaction: CÓ (g) + 3 H (g) + CH4 (g) + H2O (G) 1. At 25°C, Keq=4.0. What must be the Co] at equilibrium If the equilibrium concentrations of [H.]= 2.0M. (CH) = 5.0M, and (HO) = 3.OM? Answer: 0.469 M The ICE table is a way to keep track of what is happening in the reaction vessel. The initial concentrations if given...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 6 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 6 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 20 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago