Draw the d-orbital energy diagram for a square planar complex [M(L)4]2+. Draw a schematic representation (i.e....
Draw the d-orbital energy diagram for a square planar complex [M(L)4]2+. Draw a schematic representation (i.e. simple 2D picture) of the metal-ligand antibonding orbital that corresponds to the highest energy orbital of the splitting diagram. How is this square planar splitting diagram related to the d-orbital splitting diagram for a Jahn-Teller distorted octahedral complex?
Homework Answers
Add Answer to:
Draw the d-orbital energy diagram for a square planar complex
[M(L)4]2+. Draw a schematic representation
(i.e....
Using the crystal field theory approach, draw the d-orbital splitting diagram for octahedral [Cu(...
Using the crystal field theory approach, draw the d-orbital splitting diagram for octahedral [Cu(OH2)6+, properly label each of the orbitals (i.e. dky etc.), and fill in the electrons. Show the changes in energy of all the d-orbitals under the influence of Jahn-Teller distortions resulting in both axial elongation and in axial compression (tetragonal distortions).
Using the crystal field theory approach, draw the d-orbital splitting diagram for octahedral [Cu(OH2)6+, properly label each of the orbitals (i.e. dky etc.), and fill in...
a. Predict the structure of [Cr(OH2)6]2+ - I wrote that the complex will undergo Jahn-Teller distortion,...
a. Predict the structure of [Cr(OH2)6]2+ - I wrote that the complex will undergo Jahn-Teller distortion, making the octahedral complex become tetragonal (don't know if that's correct) b. Account for the variation in the lattice enthalpy of Mn (2780 kJ/mol), Fe (2926 kJ/mol), Co (2976 kJ/mol), Ni (3060 kJ/mol), and Zn (2985 kJ/mol) flouride given that the metal center in all of the flourides is surrounded by an octahedral array of F-ions. c. Explain the effect on the d-orbital energies...
Construct the d-orbital energy diagram of octahedral complex [CoCl_6]^4-. How many unpaired electrons are there in...
Construct the d-orbital energy diagram of octahedral complex [CoCl_6]^4-. How many unpaired electrons are there in [CoCl_6]^4-? Calculate the Ligand Field Stabilization Energy (LFSE) of this octahedral complex with respect to delta_0.
1. Consider the following 4-coordinate complexes. For each of these: a. Do you expect the complex...
1. Consider the following 4-coordinate complexes. For each of these: a. Do you expect the complex to be tetrahedral or square planar? Why? b. Draw an electron-orbital occupancy diagram for the d orbitals. c. If the complex is tetrahedral, calculate an LFSE in units of 4. Note that, for tetrahedral complexes, e orbitals are -3/54 relative to the average d-orbital energy, and t, orbitals are +2/54 relative to the average d-orbital energy. Ni(CO). [Rh(PPh.) (CO), [Rec] [PdCl.Bry] 2. Which of...
1. Consider [Re2Cls]f, a dimer with metal-metal bond a) Draw the energy ordering of the d...
1. Consider [Re2Cls]f, a dimer with metal-metal bond a) Draw the energy ordering of the d orbitals in [ReCL] and label each energy level with the appropriate d orbital label and an orbital picture. Consider ? b) Use your diagram from part (a) to generate an energy level diagram for a bimetallic complex [M2Clsl in which two square pl MC] units are stacked as shown in 2. Assume there are no Cl-Cl interactions and consider only the d-based orbitals in...
a-c 32. Consider the complex ion [CoF (OH)2]3 (4 pts) What is the oxidation state of cobalt in this compound? How many d electrons does the cobalt ion have? a. (4 pts) Draw a d orbital splitting d...
a-c
32. Consider the complex ion [CoF (OH)2]3 (4 pts) What is the oxidation state of cobalt in this compound? How many d electrons does the cobalt ion have? a. (4 pts) Draw a d orbital splitting diagram for this ion. How many unpaired electrons are in the complex ion? b. (2 pts) Can this ion exhibit isomerization? If so, what type? c. 10 of 14
32. Consider the complex ion [CoF (OH)2]3 (4 pts) What is the oxidation state...
Using the crystal field theory approach, draw the d-orbital splitting diagram for octahedral [Cu(OH2)6+, properly label each of the orbitals (i.e. dky etc.), and fill in the electrons. Show the changes in energy of all the d-orbitals under the influence of Jahn-Teller distortions resulting in both axial elongation and in axial compression (tetragonal distortions).
Using the crystal field theory approach, draw the d-orbital splitting diagram for octahedral [Cu(OH2)6+, properly label each of the orbitals (i.e. dky etc.), and fill in...
Construct the d-orbital energy diagram of octahedral complex [CoCl_6]^4-. How many unpaired electrons are there in [CoCl_6]^4-? Calculate the Ligand Field Stabilization Energy (LFSE) of this octahedral complex with respect to delta_0.
1. Consider the following 4-coordinate complexes. For each of these: a. Do you expect the complex to be tetrahedral or square planar? Why? b. Draw an electron-orbital occupancy diagram for the d orbitals. c. If the complex is tetrahedral, calculate an LFSE in units of 4. Note that, for tetrahedral complexes, e orbitals are -3/54 relative to the average d-orbital energy, and t, orbitals are +2/54 relative to the average d-orbital energy. Ni(CO). [Rh(PPh.) (CO), [Rec] [PdCl.Bry] 2. Which of...
1. Consider [Re2Cls]f, a dimer with metal-metal bond a) Draw the energy ordering of the d orbitals in [ReCL] and label each energy level with the appropriate d orbital label and an orbital picture. Consider ? b) Use your diagram from part (a) to generate an energy level diagram for a bimetallic complex [M2Clsl in which two square pl MC] units are stacked as shown in 2. Assume there are no Cl-Cl interactions and consider only the d-based orbitals in...
a-c
32. Consider the complex ion [CoF (OH)2]3 (4 pts) What is the oxidation state of cobalt in this compound? How many d electrons does the cobalt ion have? a. (4 pts) Draw a d orbital splitting diagram for this ion. How many unpaired electrons are in the complex ion? b. (2 pts) Can this ion exhibit isomerization? If so, what type? c. 10 of 14
32. Consider the complex ion [CoF (OH)2]3 (4 pts) What is the oxidation state...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 10 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 42 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago