Homework Answers
The highlighted pair of electrons are nonbonding electrons.
It is the 2pz orbital of fluorine interact with 1s orbital of hydrogen to form ag. The hydrogen only has 1s orbital (ag), so remaining other orbitals except ag are non-bonding electrons from FHF.
ag is symmetrical and found to be a very weak bond.
Add Answer to:
Explain why in the MO diagram of FHF-, the highlighted orbitals are not like normal nonbonding...
Draw the MO diagram for F,2.Use your MO diagram to explain why F2+ has a stronger...
Draw the MO diagram for F,2.Use your MO diagram to explain why F2+ has a stronger bond than F
Draw an MO diagram for the [FeH6]2- complex. Sketch the group orbitals of the 6 H ligands and show how they overlap wi...
Draw an MO diagram for the [FeH6]2- complex. Sketch the group orbitals of the 6 H ligands and show how they overlap with valence orbitals on Fe.
Antibonding MOS 3. The energy diagram (right) depicts the molecular orbitals for the pi electrons in...
Antibonding MOS 3. The energy diagram (right) depicts the molecular orbitals for the pi electrons in a molecule with a cyclic, fully-conjugated pi system. Would you expect the molecule to be unusually stable or unusually unstable? Why? Explain in 1-2 sentences. (2 pts) Energy - ----Nonbonding MOs y Bonding MOs
2. (40 points) The MO diagrams for homonuclear diatomic molecules are given below. LUMO Lowes Unceaupiad...
2. (40 points) The MO diagrams for homonuclear diatomic molecules are given below. LUMO Lowes Unceaupiad 2P HOMD (tHighast ocaupied No No mixing Mixing of og orbitals (a) (b) Bo BongNon 8-2 Va) (15 pts) Choose the appropriate diagram for the N2 molecule and place the right number of electrons. Indicate the frontier orbitals (HOMO and LUMO) and the bond order. b) (20 pts) Sketch a qualitative MO diagram for the heteronuclear diatomic anion CN; place the right number of...
2. (40 points) The MO diagrams for homon omonuclear diatomic molecules is given below. umolt Anh...
2. (40 points) The MO diagrams for homon omonuclear diatomic molecules is given below. umolt Anh HOMO Homo a) Bo 8 4 2 No mixing Mixing of, orbitals (a) (b) U2 36 zire .02=642=2e- va) (15 pts) Choose the appropriate diagram for the O molecule and place the right number of electrons. Indicate the frontier orbitals (HOMO and LUMO) and the bond order. b) (20 pts) Sketch a qualitative MO diagram for the heteronuclear diatomic anion CN; place the right...
explain why the recurrence relation for number of ternary strings of length n contains "01" 7....
explain why the recurrence relation for number of ternary strings
of length n contains "01"
7. (10 points) Extra credit: Explain why the recurrence relation for number of ternary strings of length n that contain "01" is bn = 3n-1-bn-2 +31-2?
1. (30 points) You are modeling the biceps of a new life-like robot you are designing. The geomet...
1. (30 points) You are modeling the biceps of a new life-like robot you are designing. The geometry of the arm has been defined as follow: Di - 5 cm, D2- 15 cm, D325 cm and D4- 18.66 cm (distances in the diagram are shown for the elbow positioned at 90°). The dumbbell weighs 7 kg and the weight of the forearm is 2 kg. (F - ma) a. Plot the moment arm values as a function of the angle...
Can any one explain the claim for me please? I cannot see why thats true as p is greater than 1, surely we will have extra terms. To me its like it is calming (a+b)^2 <= a^2 + b^2 Any help will be...
Can any one explain the claim for me please? I cannot see why
thats true as p is greater than 1, surely we will have extra
terms.
To me its like it is calming (a+b)^2 <= a^2 + b^2
Any help will be much appreciated.
Let Take f, g E B: then for any λ E (0, 1) we have CL
Let Take f, g E B: then for any λ E (0, 1) we have CL
Please answer both questions and explain why is like that your answer. QUESTION 1 0.5 points...
Please answer both questions and explain why is like that your answer.
QUESTION 1 0.5 points Save Answer Which of the following is true for the carbon bonded to the bromine and the chlorine? Br CI O R/S O R Not chiral QUESTION 2 0.5 points Save Answer Which of the following is the correct chirality for the carbons indicated by the rs(the chirality is given as 1, 2 in the answer choices] OSR ORR OSS ORS
1. Describe in few steps the formation of milky way galaxy 2. Give contrast between Normal galaxies and Active Galaxies. only) of galaxies. (Picture Only 4. Draw and explain the possible fat...
1. Describe in few steps the formation of milky way galaxy 2. Give contrast between Normal galaxies and Active Galaxies. only) of galaxies. (Picture Only 4. Draw and explain the possible fate of the universe. 9. Elucidate the stellar evolution of Sun 10. Draw HR diagram. Label the axis and locate the followings: Red giant, Red Supergiant, Blue Giant, Main sequence, White Dwarf. Extra credit: 10 Points Explain your ideas about blackhole. discuss what do you know about it, how...
Draw the MO diagram for F,2.Use your MO diagram to explain why F2+ has a stronger bond than F
Antibonding MOS 3. The energy diagram (right) depicts the molecular orbitals for the pi electrons in a molecule with a cyclic, fully-conjugated pi system. Would you expect the molecule to be unusually stable or unusually unstable? Why? Explain in 1-2 sentences. (2 pts) Energy - ----Nonbonding MOs y Bonding MOs
2. (40 points) The MO diagrams for homonuclear diatomic molecules are given below. LUMO Lowes Unceaupiad 2P HOMD (tHighast ocaupied No No mixing Mixing of og orbitals (a) (b) Bo BongNon 8-2 Va) (15 pts) Choose the appropriate diagram for the N2 molecule and place the right number of electrons. Indicate the frontier orbitals (HOMO and LUMO) and the bond order. b) (20 pts) Sketch a qualitative MO diagram for the heteronuclear diatomic anion CN; place the right number of...
2. (40 points) The MO diagrams for homon omonuclear diatomic molecules is given below. umolt Anh HOMO Homo a) Bo 8 4 2 No mixing Mixing of, orbitals (a) (b) U2 36 zire .02=642=2e- va) (15 pts) Choose the appropriate diagram for the O molecule and place the right number of electrons. Indicate the frontier orbitals (HOMO and LUMO) and the bond order. b) (20 pts) Sketch a qualitative MO diagram for the heteronuclear diatomic anion CN; place the right...
explain why the recurrence relation for number of ternary strings
of length n contains "01"
7. (10 points) Extra credit: Explain why the recurrence relation for number of ternary strings of length n that contain "01" is bn = 3n-1-bn-2 +31-2?
1. (30 points) You are modeling the biceps of a new life-like robot you are designing. The geometry of the arm has been defined as follow: Di - 5 cm, D2- 15 cm, D325 cm and D4- 18.66 cm (distances in the diagram are shown for the elbow positioned at 90°). The dumbbell weighs 7 kg and the weight of the forearm is 2 kg. (F - ma) a. Plot the moment arm values as a function of the angle...
Can any one explain the claim for me please? I cannot see why
thats true as p is greater than 1, surely we will have extra
terms.
To me its like it is calming (a+b)^2 <= a^2 + b^2
Any help will be much appreciated.
Let Take f, g E B: then for any λ E (0, 1) we have CL
Let Take f, g E B: then for any λ E (0, 1) we have CL
Please answer both questions and explain why is like that your answer.
QUESTION 1 0.5 points Save Answer Which of the following is true for the carbon bonded to the bromine and the chlorine? Br CI O R/S O R Not chiral QUESTION 2 0.5 points Save Answer Which of the following is the correct chirality for the carbons indicated by the rs(the chirality is given as 1, 2 in the answer choices] OSR ORR OSS ORS
1. Describe in few steps the formation of milky way galaxy 2. Give contrast between Normal galaxies and Active Galaxies. only) of galaxies. (Picture Only 4. Draw and explain the possible fate of the universe. 9. Elucidate the stellar evolution of Sun 10. Draw HR diagram. Label the axis and locate the followings: Red giant, Red Supergiant, Blue Giant, Main sequence, White Dwarf. Extra credit: 10 Points Explain your ideas about blackhole. discuss what do you know about it, how...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago