At 0°C the enthalpy of melting of water is 6.0 kJ·mol–1. The enthalpy change when 36...
At 0°C the enthalpy of melting of water is 6.0 kJ·mol–1. The enthalpy change when 36 g of water freezes is A. –6.0 kJ B. +6.0 kJ C. –12 kJ D. –216 kJ E. +12 kJ
Homework Answers
Add Answer to:
At 0°C the enthalpy of melting of water is 6.0 kJ·mol–1. The
enthalpy change when 36...
The standard enthalpy of formation of NO(g) is +90.3 kJ·mol-1 and that of NO2(g) is +33.2...
The standard enthalpy of formation of NO(g) is +90.3 kJ·mol-1 and that of NO2(g) is +33.2 kJ·mol-1. Calculate the reaction enthalpy for 2NO(g) + O2(g) ® 2NO2(g) A. -47.8 kJ B. -57.1 kJ C. +123.5 kJ D. -23.9 kJ E. -114.2 kJ Please explain why/steps.
The change in enthalpy when 1 mol of ice is melted at 273K is 6008 J Heat Capacity of liquid water, Cp_{L} = 75.44 J/mol K Heat Capacity of solid water, Cp_{S} = 38J/mol K Enthalpy chage of melting at...
The change in enthalpy when 1 mol of ice is melted at 273K is 6008 J Heat Capacity of liquid water, Cp_{L} = 75.44 J/mol K Heat Capacity of solid water, Cp_{S} = 38J/mol K Enthalpy chage of melting at 273K, \Delta H_{273}=6008 J Calculate the standard enthalpy of fusion for ice. Calculate the heat released when 100 g of water supercooled at 250K solidify Initial T=25°C=298K Thanks
Calculate the change in entropy that occurs in the system when 49.0 g of acetone (C3H6O) freezes at its melting point (-...
Calculate the change in entropy that occurs in the system when 49.0 g of acetone (C3H6O) freezes at its melting point (-94.8∘C). ΔH∘fus = 5.69 kJ/mol. Answer in J/K
Sample problems 3: How does the entropy of the system change when the following occur: a)...
Sample problems 3: How does the entropy of the system change when the following occur: a) a so vaporizes; ce) a solid dissolves in water; d) a gas liquefies? as 2. The normal boiling point of methanol (CHsOH) is 64.7 Co, and its molar enthalpy of vaporization is Hap -71.8 kJ/mol. A) When CHoOH 1) boils at its normal boiling point, does its entropy increase or decrease? B) Calculate the value of AS when 1.00 mol of CHOH() is vaporized...
What is the entropy change of the universe (in J K-1)when 2.00 mol of liquid water...
What is the entropy change of the universe (in J K-1)when 2.00 mol of liquid water at 0 °C freezes in a freezer compartment whose temperature is -15 °C? Assume the freezer is a perfect insulator. (AHfus = 6.01 kJ mol-1 for water) Select one: O a. +90.6 O b. +46.6 C. -2.6 O d. -44.0 o e. +2.6
1.) Determine the enthalpy change when 62.0 g of steam at 135.0 oC is cooled to...
1.) Determine the enthalpy change when 62.0 g of steam at 135.0 oC is cooled to ice at –15.0 oC. Use the actual enthalpy and heat capacity values 2.) A heater in a hot water tank gives off 30,000 KJ per hour. The initial temperature of 450 kg of water in the tank is 18.0 oC. If the tank is heated for 90 minutes, determine the final temperature of the water. 3.) In general boiling and melting points increase with...
Calculate the enthalpy change when 50.0g of water vaporizes, if the molar enthalpy of vaporization is...
Calculate the enthalpy change when 50.0g of water vaporizes, if the molar enthalpy of vaporization is 44.0 kJ/mol
10. Given the thermochemical data below, what is the change in enthalpy when 10.0 g of...
10. Given the thermochemical data below, what is the change in enthalpy when 10.0 g of H, are reacted? N; (g) + 3H2(g) → 2NH, (g): AH = -91.2 kJ (A) -452 kJ (B) +452 kJ (C) -151 kJ (D) -1357 kJ 11. Which of the following is NOT a state function? 1. Heat 2. Change in enthalpy 3. Change in internal energy 4. Change in pressure (A) 1 only (B) 2 only (C) 2 and 3 (D) 1 and...
The enthalpy of fusion of cadmium at its normal melting point of 321 °C is 6.11...
The enthalpy of fusion of cadmium at its normal melting point of 321 °C is 6.11 kJ mol? What is the entropy of fusion of cadmium at this temperature? ASfus = J mol-K-1 The molar enthalpy of fusion of solid cadmium is 6.11 kJ mol-1, and the molar entropy of fusion is 10.3 JK+mol-1. (a) Calculate the Gibbs free energy change for the melting of 1.00 mol of cadmium at 622 K. (b) Calculate the Gibbs free energy change for...
When 1.00 mole of NH4NO3 dissolves in water, the enthalpy change is ΔH = + 25.7...
When 1.00 mole of NH4NO3 dissolves in water, the enthalpy change is ΔH = + 25.7 kJ. What is the enthalpy change if 17.5 grams of NH4NO3 are dissolved in water?
Sample problems 3: How does the entropy of the system change when the following occur: a) a so vaporizes; ce) a solid dissolves in water; d) a gas liquefies? as 2. The normal boiling point of methanol (CHsOH) is 64.7 Co, and its molar enthalpy of vaporization is Hap -71.8 kJ/mol. A) When CHoOH 1) boils at its normal boiling point, does its entropy increase or decrease? B) Calculate the value of AS when 1.00 mol of CHOH() is vaporized...
What is the entropy change of the universe (in J K-1)when 2.00 mol of liquid water at 0 °C freezes in a freezer compartment whose temperature is -15 °C? Assume the freezer is a perfect insulator. (AHfus = 6.01 kJ mol-1 for water) Select one: O a. +90.6 O b. +46.6 C. -2.6 O d. -44.0 o e. +2.6
Calculate the enthalpy change when 50.0g of water vaporizes, if the molar enthalpy of vaporization is 44.0 kJ/mol
10. Given the thermochemical data below, what is the change in enthalpy when 10.0 g of H, are reacted? N; (g) + 3H2(g) → 2NH, (g): AH = -91.2 kJ (A) -452 kJ (B) +452 kJ (C) -151 kJ (D) -1357 kJ 11. Which of the following is NOT a state function? 1. Heat 2. Change in enthalpy 3. Change in internal energy 4. Change in pressure (A) 1 only (B) 2 only (C) 2 and 3 (D) 1 and...
The enthalpy of fusion of cadmium at its normal melting point of 321 °C is 6.11 kJ mol? What is the entropy of fusion of cadmium at this temperature? ASfus = J mol-K-1 The molar enthalpy of fusion of solid cadmium is 6.11 kJ mol-1, and the molar entropy of fusion is 10.3 JK+mol-1. (a) Calculate the Gibbs free energy change for the melting of 1.00 mol of cadmium at 622 K. (b) Calculate the Gibbs free energy change for...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 37 seconds from now -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 16 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 17 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 31 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago