Homework Answers
Add Answer to:
Net
Ionic equation for NH_4Cl and H_2O
Observed pH Net ionic equation for NHCl and H20...
For the chemical reaction 2 HBr(aq)BaOH)2(aq) >2 H20(1) + BaBr2(aq) write the net ionic equation, including...
For the chemical reaction 2 HBr(aq)BaOH)2(aq) >2 H20(1) + BaBr2(aq) write the net ionic equation, including the phases net ionic equation: Write the net ionic equation for the reaction shown. Include physical states 2 HNO (aq)Sr(OH)2(aq) 2 H2O) SrNO)2(aq) net ionic equation Zinc reacts with hydrochloric acid according to the reaction equation Zn(s)2 HCl(aq) » ZnCl2(aq) + H2(g) How many milliliters of 2.00 M HCl(aq) are required to react with 3.55 g Zn(s)? volume mL By titration, it is found...
C. Net lonic Equations-A Study Assignment 1. Strong Acid and Strong Base: equation: HCl(aq) NaOH(aq) NaCl(aq)H20(0)...
C. Net lonic Equations-A Study Assignment 1. Strong Acid and Strong Base: equation: HCl(aq) NaOH(aq) NaCl(aq)H20(0) total ionic: net ionic: 2. Strong Acid and Weak Base: equation: HCaq)NH OH(aqNHCI(aq) +H200) total ionic: net ionic: 3. Weak Acid and Strong Base: equation: HF(ag) + NaOH(a)NaF(aq)HO0) total ionic: net ionic: 4. Weak Acid and Weak Base: equation: HF(aq) +NH0H aqNHF(aq)H200) total ionic: net ionic:
else - Ionic Equations reaction below. write the molecular equation, the complete ionic equa For each reaction ioni...
else - Ionic Equations reaction below. write the molecular equation, the complete ionic equa For each reaction ionic equation: Equation 1 Pb(NO)(aq) + Nal(aq) - Pl(s) + NaNO (aq) Molecular equation Total lonic equation Net ionic equation Equation 2 Mg(s) + HCl(aq) -- MgClaq) + Hug) Molecular equation Total lonic equation Net ionic equation Equation 3 HCl(aq) + Ba(OH).(aq) --- BaCl(aq) + H2O(1) Molecular equation Total lonic equation Net ionic equation Equation 4 Cu(s) + AgNO3(aq) + Cu(NO3)(aq) + Ag(s)...
Which of the following in the net ionic equation for the titration of NH3(aq) with HCl(aq)?...
Which of the following in the net ionic equation for the titration of NH3(aq) with HCl(aq)? + NH4 (aq) a) H(aq) + OH(aq) → H2O(1) b) NH3(aq) + H (aq) c) NH3(aq) + HCl(aq) → NHCl(aq) d) NH3(aq) + H+ (aq) +Cl(aq) → NH4*(ng) + Cl(aq) OA B Ос OD
I dont understand which net ionic equation is correct. but the solutions tested are: NH4Cl NH3...
I dont understand which net ionic equation is correct. but the
solutions tested are:
NH4Cl
NH3
H3BO3
Na2B4O7
C6H8O7
HCl
NaHCO3
NaOH
Table 18.2A (continued) Question Write a balanced net ionic equation to explain the observed pH for each of the solutions tested. -N444 : P reet पुर्ण NH NH(aq) to lis t y (aq) + OH rads Aging-op+मासे उपयो+ NHAC NH₃C1- + H+ H3803 THB05 + A NH3NH₂ + H+ म)
15. Determine the net ionic equation for the following chemical reaction: NaOH(aq) + HCl(aq) ----------> NaCl(aq)...
15. Determine the net ionic equation for the following chemical reaction: NaOH(aq) + HCl(aq) ----------> NaCl(aq) + H20 hint: NaOH(aq) is strong base HCl(aq) is a strong acid OH-(aq) + H+ (aq) ----> H2O(1) 20H-(aq) + 2C1-(aq) -----> H2O(l) + C12(8) NaOH(aq) + CIO-(aq) -----> C12(g) + O2(g) + H2(g) + Na(s) H+(aq) + NaOH(aq)- H2O(1)+ Na(s) 13. A compound contains 20.24% Al and 79.76% Cl. Calculate the empirical formula. molar masses: Al = 26.98 g/mole and Cl = 35.45...
Total ionic equation: Net ionic equation: Post-lab: 1. Explain how it is possible for two reactants...
Total ionic equation: Net ionic equation: Post-lab: 1. Explain how it is possible for two reactants that are each strong electrolytes to react and form products that are nonelectrolytes. by double replacement reactions. 2. Balance the equations and then write total and net ionic equations for each of the following: a. FeCl(aq) + 3NaOH(aq) → Fe(OH), (s) + 3NaCl (aq) Total ionic equation: Fe mg Bet Can + 3 Ath Tha) + 30th Fe (on), a + Station 3 tan...
Part A Which is a net ionic equation for the neutralization reaction of a strong acid...
Part A Which is a net ionic equation for the neutralization reaction of a strong acid with a weak base? Which is a net ionic equation for the neutralization reaction of a strong acid with a weak base? HCl(aq) + NH3(aq) ↔ NH4Cl(aq) H3O+(aq) + NH3(aq) ↔ NH4+(aq) + H2O(l) HCl(aq) + NaOH(aq) ↔ H2O(l) + NaCl(aq) H3O+(aq) + OH-(aq) ↔ 2 H2O(l)
the net ionic equation for each of the equations please!!! TIA net ionic equation of each formula Hidily, Tou...
the net ionic equation for each of the equations please!!!
TIA
net
ionic equation of each formula
Hidily, Tou your Unbalanced Chemical Reaction Al(s) + KOH(aq) + H2O(l) → KAl(OH),(aq) + H2(g) Balanced Chemical Reaction We were unable to transcribe this imageTotal Ionic Equation 2 Al(OH),(s) + [6 H+ + 3 90,2-H(aq) → [2 A13+ +3 30,2-)(aq) + 6 H,0(1) Net Ionic Equation Unbalanced Chemical Reaction Al2(SO2)3(aq) + K,SO,(aq) + 24 H,O(1) ► 2 KAl(SO2: 12 H,0(s) 5. Combining eutn...
Which of the following reactions has a net lonic equation of H^+ (aq)+OH^- (aq)-> H20(l) a)...
Which of the following reactions has a net lonic equation of H^+ (aq)+OH^- (aq)-> H20(l) a) 2NaOH(s)+CO2(g)-> Na2CO3 (s)+ H2O (l) b) NH3 (aq)+H2O(l)-> NH4OH(aq) c) KOH(aq)+ HClO4 (aq)-> H2O (l) +KClO4 (aq) d) MgH2 (s)+ 2H2O (l)->2H2(g)+Mg(OH)2 (aq) e) none of the above
For the chemical reaction 2 HBr(aq)BaOH)2(aq) >2 H20(1) + BaBr2(aq) write the net ionic equation, including the phases net ionic equation: Write the net ionic equation for the reaction shown. Include physical states 2 HNO (aq)Sr(OH)2(aq) 2 H2O) SrNO)2(aq) net ionic equation Zinc reacts with hydrochloric acid according to the reaction equation Zn(s)2 HCl(aq) » ZnCl2(aq) + H2(g) How many milliliters of 2.00 M HCl(aq) are required to react with 3.55 g Zn(s)? volume mL By titration, it is found...
C. Net lonic Equations-A Study Assignment 1. Strong Acid and Strong Base: equation: HCl(aq) NaOH(aq) NaCl(aq)H20(0) total ionic: net ionic: 2. Strong Acid and Weak Base: equation: HCaq)NH OH(aqNHCI(aq) +H200) total ionic: net ionic: 3. Weak Acid and Strong Base: equation: HF(ag) + NaOH(a)NaF(aq)HO0) total ionic: net ionic: 4. Weak Acid and Weak Base: equation: HF(aq) +NH0H aqNHF(aq)H200) total ionic: net ionic:
else - Ionic Equations reaction below. write the molecular equation, the complete ionic equa For each reaction ionic equation: Equation 1 Pb(NO)(aq) + Nal(aq) - Pl(s) + NaNO (aq) Molecular equation Total lonic equation Net ionic equation Equation 2 Mg(s) + HCl(aq) -- MgClaq) + Hug) Molecular equation Total lonic equation Net ionic equation Equation 3 HCl(aq) + Ba(OH).(aq) --- BaCl(aq) + H2O(1) Molecular equation Total lonic equation Net ionic equation Equation 4 Cu(s) + AgNO3(aq) + Cu(NO3)(aq) + Ag(s)...
Which of the following in the net ionic equation for the titration of NH3(aq) with HCl(aq)? + NH4 (aq) a) H(aq) + OH(aq) → H2O(1) b) NH3(aq) + H (aq) c) NH3(aq) + HCl(aq) → NHCl(aq) d) NH3(aq) + H+ (aq) +Cl(aq) → NH4*(ng) + Cl(aq) OA B Ос OD
I dont understand which net ionic equation is correct. but the
solutions tested are:
NH4Cl
NH3
H3BO3
Na2B4O7
C6H8O7
HCl
NaHCO3
NaOH
Table 18.2A (continued) Question Write a balanced net ionic equation to explain the observed pH for each of the solutions tested. -N444 : P reet पुर्ण NH NH(aq) to lis t y (aq) + OH rads Aging-op+मासे उपयो+ NHAC NH₃C1- + H+ H3803 THB05 + A NH3NH₂ + H+ म)
15. Determine the net ionic equation for the following chemical reaction: NaOH(aq) + HCl(aq) ----------> NaCl(aq) + H20 hint: NaOH(aq) is strong base HCl(aq) is a strong acid OH-(aq) + H+ (aq) ----> H2O(1) 20H-(aq) + 2C1-(aq) -----> H2O(l) + C12(8) NaOH(aq) + CIO-(aq) -----> C12(g) + O2(g) + H2(g) + Na(s) H+(aq) + NaOH(aq)- H2O(1)+ Na(s) 13. A compound contains 20.24% Al and 79.76% Cl. Calculate the empirical formula. molar masses: Al = 26.98 g/mole and Cl = 35.45...
Total ionic equation: Net ionic equation: Post-lab: 1. Explain how it is possible for two reactants that are each strong electrolytes to react and form products that are nonelectrolytes. by double replacement reactions. 2. Balance the equations and then write total and net ionic equations for each of the following: a. FeCl(aq) + 3NaOH(aq) → Fe(OH), (s) + 3NaCl (aq) Total ionic equation: Fe mg Bet Can + 3 Ath Tha) + 30th Fe (on), a + Station 3 tan...
the net ionic equation for each of the equations please!!!
TIA
net
ionic equation of each formula
Hidily, Tou your Unbalanced Chemical Reaction Al(s) + KOH(aq) + H2O(l) → KAl(OH),(aq) + H2(g) Balanced Chemical Reaction We were unable to transcribe this imageTotal Ionic Equation 2 Al(OH),(s) + [6 H+ + 3 90,2-H(aq) → [2 A13+ +3 30,2-)(aq) + 6 H,0(1) Net Ionic Equation Unbalanced Chemical Reaction Al2(SO2)3(aq) + K,SO,(aq) + 24 H,O(1) ► 2 KAl(SO2: 12 H,0(s) 5. Combining eutn...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 11 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago