3. Propose a reaction scheme that will convert n-propanol into acetone. (10pts)
Q5: How will you convert the following? (0.5 mark each) a) Acetone to 2-methyl-2-propanol b) Acetone to 2-propanol c) Acetaldehyde to acetic acid d) Formaldehyde to 1-propanol e) Acetaldehyde to 2-butanol 1) Draw the structure of the following molecules i. Phenyl benzoate ii. Propanoic anhydride iii. Isopropyl acetate iv. 3-formylcyclopentane carboxylic acid v. 2,2-dimethylbutane dioic acid
5. Identify the reactants needed to convert acetone to each
product. 6. Propose a mechanism for each:
Identify the reactants needed to convert acetone (left) to each product (right): Propose a mechanism for each:
3) Propose a synthesis scheme for the following molecule from benzene using any reaction conditions. 4) Propose a synthesis scheme for the following molecule from benzene using any reaction conditions. NH2
starting with only 1-propanol as your ONLY organic starting material, come up with a reaction scheme to produce: CH3-CH2-C(=0)-O-CH2-CH2-CH3 As your final product Show all work
Propose a one-step synthesis of chloroacetone from acetone. Why can this reaction not be run under basic conditions? If the synthesis were attempted under basic conditions, what would the product be? Propose a mechanism for that process.
QUESTION 22 Select the major product of the following reaction scheme: Reaction NaOH H H3C Acetone, EtOH 25 °C ora voda HEC B E OH O CHE нс нус CH F с H HC (No Reaction) CI CI ol. A oll. B o III.C IV.D .V. E o VI.F
1. Draw compounds B and C from the following reaction
scheme.
2. Propose a structure for the product of this reaction.
Br2. NaOH H2O CH3 excess NH3 SOCl2 CH3
For each reaction scheme, propose a pathway to obtain the
desired product from the indicated starting material, by filling in
the missing intermediate products and reagents.
OH Reagents to use for each step
Select the major product of the following reaction scheme: Reaction H NaOH |H₃C' Acetone, EtOH 25°C CH3 CH3 H3C H3C B E он о CH H3C H3C CH3 F с H3C (No Reaction) ol. A oll. B olII. IV.D OV. E O VI.F
12.) Propose a reaction scheme/conditions (all reagents for each step) to synthesize the following product from benzene. (8 points) SO3H