help please What is the IUPAC name for this compound? CH3CH2CH=CHCH2CH2CH3
need help ASAP please and thank you. Give the IUPAC name for the following compound: CH3CH2CH(OH)CH,CH,CHOH 1 ,4 - hexanediol
IUPAC name for the following compound. CH3CH2CH(CH3)CH2COOLi
8. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH2COOLI Enter your answer here
Please Help!! QUESTION 1 What is the IUPAC name for this compound? CH3 CH3CH2 QUESTION 2 What is the IUPAC name for this compound? CH2CH3 QUESTION 3 What is the IUPAC name for this compound? снэ HE
8. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH,COOLI Enter your answer here
please help! thank you What is the IUPAC name for the compound shown? Ķ Ķ Ķ IUPAC name: about us ca
Be sure to answer all parts. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3
Can someone help me name this compound ? What is the IUPAC name for the compound shown below? butan-1, 3 -ol
please help me find the IUPAC name for this compound -CH₂ CHE the above compound:
What is the IUPAC name for the compound shown? What is the IUPAC name for the compound shown? What is the IUPAC name for the compound shown?