IUPAC name for the following compound is Lithium 3-methyl-pentanoate
CH3CH2CH(CH3)CH2COOLi
Explanation is in the attached image.
8. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH2COOLI Enter your answer here
Be sure to answer all parts. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3
8. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH,COOLI Enter your answer here
help please What is the IUPAC name for this compound? CH3CH2CH=CHCH2CH2CH3
3. Provide the IUPAC name for the following compound. (3 points) H3C CH3 CH3 CH3 3. Provide the IUPAC name for the following compound. (3 points) H3C CH3 CH3 CH3
Give the IUPAC name for each compound 11.39 Give the IUPAC name for each compound. CH3 CH3 (CH3CH2)2C-CHCHCH2CHCH b. CH2 CCH2CH3 CH2CH2CH2CH2CH3 CH3 CH3 с. Cн,сс-Сн,— СH—С—сH,CH, CH2CH3
What is the IUPAC name for the following compound CH3-CH-CH3 with an OH attached to the second carbon?
need help ASAP please and thank you. Give the IUPAC name for the following compound: CH3CH2CH(OH)CH,CH,CHOH 1 ,4 - hexanediol
What is the IUPAC name of the following compound? CH3CH2 2CHCH CH3
What is the complete systematic IUPAC name for the following compound? HC CH3 -CH3 CH, HC