which of these reactions is a double displacement reaction A Hide Time Remaining A Question 18...
Part A Classily the following reactions as synthesis, decomposition, single-displacement, or double-displacement reactions Drag the items to their respective bins. View Available Hint(s) Reset Help CH,+Br2 - CH_Br2 2H, 0 2H2 +02 2Pb(NO3)2 - 2PbO + 4NO2 + O2 8C + S 8Cas Na2CO3 + 2HCI 2NaCl + H2CO, Mg + 2HCI - MgCl2 + H2 2NO - N2+0) NOM Pb(NO3)2 + 2Naci - 2NaNO3 + PbCl2 Synthesis Decomposition Single-displacement Double-displacement Submit
Which of the following reactions has a net lonic equation of H^+ (aq)+OH^- (aq)-> H20(l) a) 2NaOH(s)+CO2(g)-> Na2CO3 (s)+ H2O (l) b) NH3 (aq)+H2O(l)-> NH4OH(aq) c) KOH(aq)+ HClO4 (aq)-> H2O (l) +KClO4 (aq) d) MgH2 (s)+ 2H2O (l)->2H2(g)+Mg(OH)2 (aq) e) none of the above
46. Which species in the reaction below undergoes reduction? H2O(g) + CO(g) -H2(g) + CO2(g) a. H20 b.CO CH2 d. co2 e. None 47. Which species is reduced in the reaction below? (aq) + CIO (aq) + 10 (aq) + C (aq) a. b. H20 c.cr d. 10 e. CIO 48. Which of the following elements generally acts as an oxidizing agent? a. Br2 b.H2 c. Fed . C e. Li 49. What is the oxidation number of Fe in...
using double displacement predict the solid given by the following chemical reactions. Then give the correct name of the solid Part 1: Using double displacement predict the solid given by the following chemical reactions. Then give the correct name of the solid 1. Ba(NO3)2 (aq) + K2SO4 (aq) Chemical Formula: (s) Name: 2. AgNO3 (aq) + NaBr (aq) Chemical Formula: (s) Name: (s) Name: Chemical Formula: 3. FeCl3 (aq)+3 KOH (aq) Name (s) Chemical Formula: 4. Pb (NO3)2 (aq)+ K2SO4...
plz answer all questions ASAP plz A Hide Time Remaining A Question 6 of 20 5 Points For which of the following isotopes would it be unlikely to observe B decay? O ABN OB. 190 OC. 27 MB D. OF E. 200 Reset Selection Time Remaining: 01:04:44 A Hide Time Remaining A Part 2 of 2 Question 7 of 20 5 Points 175pt undergoes alpha decay, what is the daughter nucleus? Previous Next Save Events Map Apply Search/A-Z 2.20 Site...
Question 32 2 pts Which response includes all of the following that are single displacement reactions, and no other reactions? I. BaO(s) + SO2 (g) -BaSO3(s) II. 2Rb(s) + 2H2O(1) ► 2RbOH(aq) + H2(9) III. 2Hl(aq) + Ca(OH)2(aq) → Cal2(aq) + 2H2O(1) 2HgO(s) → 2Hg() + O2(9) IV. O II, II and IV O I, II, and IV O II Oll and IV I and IV
2. Classify each of the following reactions as precipitation, gas forming, redox, acid/base, combination, decomposition, double displacement or single displacement. Each reaction will have at least two classifications. a. Zn(s) + CuSO4(aq) → ZnSO4(aq) + Cu(s) b. H2SO3(aq) → SO2(g) + H2O(1) C. N2(g) + H2(g) → NH3(g) d. AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq) ii. e. HCl(aq) + Ba(OH)2(aq) + H2O(l) + BaCl2(aq)
1. For each of the reactions below, classify as a combination, decomposition, single replacement, or double replacement. 2CAO(s) a. 2Ca(s)O2(g) b. AgNOs(aq) + KC|(aq) Cl c. Zn(s)+2HCI (aq) AgCI(s)+KNO3(aq) ZnCl2(aq) + H2(g) CO2(g) + H20() d. H2CO3(aq)
1. Determine if each of the following reactions is a redox reaction, or is not a redox reaction. a. C4H8 (g) + O2 + H20 (g) + CO2 (g) b. HCl (aq) + NaOH (aq) → H20 (1) + NaCl (aq) c. Fe2O3 + H2 → Fe + H2O d. Cu (s) + HNO3 (aq) → Cu(NO3)2 (aq) + NO2 (g) + H20 (1) e. CzHe(g) + 5 O2 (g) → 3 CO2 (g) + 4 H20 (g)
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...