Homework Answers
Add Answer to:
draw the structures of the following compunds:
1. Draw the structures of the following compounds: a....
1. Draw the structures of the following compounds: a. 3-ethyl-4-methyl-2-hexene b.2-chloro-butyl acetate c. Ethylbenzene d. 2-methyl-3-pentanol...
1. Draw the structures of the following compounds: a. 3-ethyl-4-methyl-2-hexene b.2-chloro-butyl acetate c. Ethylbenzene d. 2-methyl-3-pentanol e. 2-methylpropyl methyl ether 2. A) Distinguish between photodissociation and photoionization B) Use energy requirements of these two processes to explain why photodissociation of oxygen is more important than photoionization of oxygen at altitudes below about 90 km.
24. Draw the structures for 4 of the following 5 compounds. a. 4-(1,1-dimethylethyl)heptane b. 2,...
PLEASE PROVIDE EXPLANATION
24. Draw the structures for 4 of the following 5 compounds. a. 4-(1,1-dimethylethyl)heptane b. 2,6-dimethyl-4-(2-methylpropyl)decane c. 1-bromo-4-(3,3,3-trifluoro-2-methylpropyl)-7-fluorooctane d. 6-ethyl-2,6,7-trimethyl-5-propylnonane e. 4-sec-butyl-1,2-dimethylcyclohexane
24. Draw the structures for 4 of the following 5 compounds. a. 4-(1,1-dimethylethyl)heptane b. 2,6-dimethyl-4-(2-methylpropyl)decane c. 1-bromo-4-(3,3,3-trifluoro-2-methylpropyl)-7-fluorooctane d. 6-ethyl-2,6,7-trimethyl-5-propylnonane e. 4-sec-butyl-1,2-dimethylcyclohexane
9.19 Draw structures corresponding to the following names: (b) 3-Ethyl-5-methyl-1,6,8-decatriyne ...
Draw structures corresponding to the following names:
9.19 Draw structures corresponding to the following names: (b) 3-Ethyl-5-methyl-1,6,8-decatriyne (a) 3,3-Dimethyl-4-octyne (c) 2,2,5,5-Tetramethyl-3-hexyne (d) 3,4-Dimethylcyclodecyne (e) 3,5-Heptadien-1-yne (g) 3-sec-Butyl-1-heptyne (f) 3-Chloro-4,4-dimethyl-1-nonen-6-yne (h) S-tert-Butyl-2-methyl-3-octyne
9.19 Draw structures corresponding to the following names: (b) 3-Ethyl-5-methyl-1,6,8-decatriyne (a) 3,3-Dimethyl-4-octyne (c) 2,2,5,5-Tetramethyl-3-hexyne (d) 3,4-Dimethylcyclodecyne (e) 3,5-Heptadien-1-yne (g) 3-sec-Butyl-1-heptyne (f) 3-Chloro-4,4-dimethyl-1-nonen-6-yne (h) S-tert-Butyl-2-methyl-3-octyne
Homework Problems 8.1 Draw the structural formula for each of the following: a. 5-chloro-4-methyl-2-hexanol b. 2,3-dimethylcyclopentanol...
Homework Problems 8.1 Draw the structural formula for each of the following: a. 5-chloro-4-methyl-2-hexanol b. 2,3-dimethylcyclopentanol c. 5,5-diethyl-1-heptanol d. 2-ethyl-4-isopropylcyclohexanol e. 4-ethylphenol f. 2-nitrophenol g. cyclopropyl methyl ether h. isopropyl propyl ether 8.2 Give the product for the dehydration of each of the following alcohols. CH-CH2-CH3 a. ОН b. ОН C. OH d. 8.3 What product would result from the oxidation of each of the following alcohols? Write the chemical equations. a. 2-butanol b. 2-methyl-2-pentanol c. cyclohexanol d. 3-ethylcyclopentanol Name...
30) Which of the following compounds is (are) symmetrical ethers? B)Only D) Only I, IIl, and...
30) Which of the following compounds is (are) symmetrical ethers? B)Only D) Only I, IIl, and IV A) Only III and IV C) Only I 31) What is the IUPAC of the following compound? но B) 1,1,4-Trimethyl-2-cyclohexanol D) 3,3,6-Trimethylcyclohexanol A) 2,5,5-Trimethylcyclohexanol ) 1,4,4-Trimethyl-2-cyclohexanol 32) What is the IUPAC of the following compound? он A) (R)-2,2-Dimethyl-3-pentanol C) (S)-2,2-Dimethyl-3-pentanol B) (S)-1-tert-Butyl-1-propanol D) (R)-4,4-Dimethyl-3-pentanol 33) What is the common name of the following compound? A) Methyl sec-butyl ether C) Isobutyl methyl ether B)...
Draw the structures of the following carbonyl compounds: 4-hydroxypentanoic acid ethyl ethanoate methyl 2-aminobenzoate 4-bromocyclohexanone 1-bromo-2-chloro-cyclopentane...
Draw the structures of the following carbonyl compounds: 4-hydroxypentanoic acid ethyl ethanoate methyl 2-aminobenzoate 4-bromocyclohexanone 1-bromo-2-chloro-cyclopentane carboxylic acid
Write structural formulas for the following compounds: a. 6-chloro-2,2-diiodo-3-heptyne b. toulene (methylbenzene) c. m-divinylbenzene d. 4-chloro-2-butyne...
Write structural formulas for the following compounds: a. 6-chloro-2,2-diiodo-3-heptyne b. toulene (methylbenzene) c. m-divinylbenzene d. 4-chloro-2-butyne e. 2-ethyl-3-methyl-1-pentanol f. ortho-dinitrobenzene
14. Which of the following reagents should be used to prepare tert-butyl ethyl ether a) tert-butyl...
14. Which of the following reagents should be used to prepare tert-butyl ethyl ether a) tert-butyl bromide and sodium ethoxide b) tert-butyl alcohol and ethyl bromide c) tert-butyl alcohol and ethanol d) potassium tert-butoxide and ethyl bromide 15. What is the major organic product obtained from the following reaction? A) 1 B) 2 C) 3 D) 4 16. What product is formed when methyloxirane is treated with ethylmannesium bromide followed by treatment with aqueous acid? A) 1-pentanol B) 2-pentanol C)...
1. Draw line-angle structures for the following compounds: a) (20,4E)-1-chloro-3-methyl-2,4-hexadiene b) (32,5E)-4-meth...
1. Draw line-angle structures for the following compounds: a) (20,4E)-1-chloro-3-methyl-2,4-hexadiene b) (32,5E)-4-methyl-3,5-nonadiene c) (32,5Z)-4,5-dimethyl-3,5-nonadiene d) (35,5E)-2,5-dibromo-3,5-octadiene
1)- Give the correct names for the structures drawn (i.e. A-E) or draw the structure for...
1)- Give the correct names for the structures drawn (i.e. A-E) or draw the structure for each of the names given (i.e.. T) for the compounds below, and use the cis/trans, R/S labeling when appropriate. E T D F 1a-Bromo-2-(trans) Chloro-4-(trans) Ethyl-3-(trans) Methyl-6-(Cis) 2-Hydroxypropyl-5-(trans)- (n-Propyl) Cyclohexane. Note, all of the groups orientations are in reference to la-Bromo Group all of the conformers specifications (e.g., axi the chair conformers of
1)- Give the correct names for the structures drawn (i.e. A-E)...
1. Draw the structures of the following compounds: a. 3-ethyl-4-methyl-2-hexene b.2-chloro-butyl acetate c. Ethylbenzene d. 2-methyl-3-pentanol e. 2-methylpropyl methyl ether 2. A) Distinguish between photodissociation and photoionization B) Use energy requirements of these two processes to explain why photodissociation of oxygen is more important than photoionization of oxygen at altitudes below about 90 km.
PLEASE PROVIDE EXPLANATION
24. Draw the structures for 4 of the following 5 compounds. a. 4-(1,1-dimethylethyl)heptane b. 2,6-dimethyl-4-(2-methylpropyl)decane c. 1-bromo-4-(3,3,3-trifluoro-2-methylpropyl)-7-fluorooctane d. 6-ethyl-2,6,7-trimethyl-5-propylnonane e. 4-sec-butyl-1,2-dimethylcyclohexane
24. Draw the structures for 4 of the following 5 compounds. a. 4-(1,1-dimethylethyl)heptane b. 2,6-dimethyl-4-(2-methylpropyl)decane c. 1-bromo-4-(3,3,3-trifluoro-2-methylpropyl)-7-fluorooctane d. 6-ethyl-2,6,7-trimethyl-5-propylnonane e. 4-sec-butyl-1,2-dimethylcyclohexane
Draw structures corresponding to the following names:
9.19 Draw structures corresponding to the following names: (b) 3-Ethyl-5-methyl-1,6,8-decatriyne (a) 3,3-Dimethyl-4-octyne (c) 2,2,5,5-Tetramethyl-3-hexyne (d) 3,4-Dimethylcyclodecyne (e) 3,5-Heptadien-1-yne (g) 3-sec-Butyl-1-heptyne (f) 3-Chloro-4,4-dimethyl-1-nonen-6-yne (h) S-tert-Butyl-2-methyl-3-octyne
9.19 Draw structures corresponding to the following names: (b) 3-Ethyl-5-methyl-1,6,8-decatriyne (a) 3,3-Dimethyl-4-octyne (c) 2,2,5,5-Tetramethyl-3-hexyne (d) 3,4-Dimethylcyclodecyne (e) 3,5-Heptadien-1-yne (g) 3-sec-Butyl-1-heptyne (f) 3-Chloro-4,4-dimethyl-1-nonen-6-yne (h) S-tert-Butyl-2-methyl-3-octyne
Homework Problems 8.1 Draw the structural formula for each of the following: a. 5-chloro-4-methyl-2-hexanol b. 2,3-dimethylcyclopentanol c. 5,5-diethyl-1-heptanol d. 2-ethyl-4-isopropylcyclohexanol e. 4-ethylphenol f. 2-nitrophenol g. cyclopropyl methyl ether h. isopropyl propyl ether 8.2 Give the product for the dehydration of each of the following alcohols. CH-CH2-CH3 a. ОН b. ОН C. OH d. 8.3 What product would result from the oxidation of each of the following alcohols? Write the chemical equations. a. 2-butanol b. 2-methyl-2-pentanol c. cyclohexanol d. 3-ethylcyclopentanol Name...
30) Which of the following compounds is (are) symmetrical ethers? B)Only D) Only I, IIl, and IV A) Only III and IV C) Only I 31) What is the IUPAC of the following compound? но B) 1,1,4-Trimethyl-2-cyclohexanol D) 3,3,6-Trimethylcyclohexanol A) 2,5,5-Trimethylcyclohexanol ) 1,4,4-Trimethyl-2-cyclohexanol 32) What is the IUPAC of the following compound? он A) (R)-2,2-Dimethyl-3-pentanol C) (S)-2,2-Dimethyl-3-pentanol B) (S)-1-tert-Butyl-1-propanol D) (R)-4,4-Dimethyl-3-pentanol 33) What is the common name of the following compound? A) Methyl sec-butyl ether C) Isobutyl methyl ether B)...
14. Which of the following reagents should be used to prepare tert-butyl ethyl ether a) tert-butyl bromide and sodium ethoxide b) tert-butyl alcohol and ethyl bromide c) tert-butyl alcohol and ethanol d) potassium tert-butoxide and ethyl bromide 15. What is the major organic product obtained from the following reaction? A) 1 B) 2 C) 3 D) 4 16. What product is formed when methyloxirane is treated with ethylmannesium bromide followed by treatment with aqueous acid? A) 1-pentanol B) 2-pentanol C)...
1. Draw line-angle structures for the following compounds: a) (20,4E)-1-chloro-3-methyl-2,4-hexadiene b) (32,5E)-4-methyl-3,5-nonadiene c) (32,5Z)-4,5-dimethyl-3,5-nonadiene d) (35,5E)-2,5-dibromo-3,5-octadiene
1)- Give the correct names for the structures drawn (i.e. A-E) or draw the structure for each of the names given (i.e.. T) for the compounds below, and use the cis/trans, R/S labeling when appropriate. E T D F 1a-Bromo-2-(trans) Chloro-4-(trans) Ethyl-3-(trans) Methyl-6-(Cis) 2-Hydroxypropyl-5-(trans)- (n-Propyl) Cyclohexane. Note, all of the groups orientations are in reference to la-Bromo Group all of the conformers specifications (e.g., axi the chair conformers of
1)- Give the correct names for the structures drawn (i.e. A-E)...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 11 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 42 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago