Homework Answers
Add Answer to:
Hello! Can someone answer this question and explain it? Thank
you!
8. Consider the following equilibrium....
Hello! Can someone help me and solve these? Thank you! 4. The following mechanism has been...
Hello! Can someone help me and solve these? Thank you!
4. The following mechanism has been proposed for a reaction: Step 1 H2(g) + Step 2 O(g) + O2(g) H2(g) → O(g) H2O(g) + H2O(g) → (a) What is the equation for the overall reaction? (b) What are the expected rate laws for Step 1 and Step 2? Step 1 - Step 2 (c) What if any intermediates are there? (d) If step 1 is slow and step 2 is...
Hello! Can someone help me with this question? Thank you! 6 Consider the following equilibrium at...
Hello! Can someone help me with this question? Thank
you!
6 Consider the following equilibrium at 200 °C in an 80.0 L vessel. 2 NO2 (8) H 2NO(g) + O2(g) At equilibrium, there are 1.88 mol of NO2, 0.120 mol NO, and 0.0600 mol O2 in the reaction vessel Calculate Kc for the reaction at this temperature.
1 Normal 1 No Spac... Heading 1 + x, x² AO-A- -- AL Paragraph Styles Font...
1 Normal 1 No Spac... Heading 1 + x, x² AO-A- -- AL Paragraph Styles Font TOR Consider the reaction and predict the net reaction shift with the changes to the system: CyHa (g) + Cl2 (g) = C2H4Cl2(g) AH = -89.5 kJ/mol a. The volume is increased in the system b. The temperature is decreased in the system C. Cl2 is added to the system d. C2H4Cl2 is removed from the system e. The pressure is increased on the...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) +...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) + 02(s) Assume that the chemical reaction is at equilibrium. How will each of the follow- Kp)? Fill in the blanks by PNO ing changes affect the indicated quantities (PNo2 Po answering: increase, decrease, or no change. Poa PO К, PNO2 Pos PNO2 PM No hange (a) temperature is lowered (b) remove NO gas from the reaction flask (a) double the volume of the reaction...
When the volume is decreased for the following reaction at equilibrium which direction will the reaction...
When the volume is decreased for the following reaction at equilibrium which direction will the reaction shift to return to equilibrium? 2N0(g) + O2 (g) = 2NO2 (g) Toward reactants O No shift will occur because this equilibrium is not affected by volume changes. Toward products
i need 2,3,4,5,and 6. 2. (6 Pts) Write the equilibrium expression, Kp, for the reactions in...
i
need 2,3,4,5,and 6.
2. (6 Pts) Write the equilibrium expression, Kp, for the reactions in problem 1. 3. (8 Pts) At 127°C, Kc = 2.6 x 10-5 for the reaction: 2 NH3(g) + N2(g) + 3 H2(g) Calculate Kp at this temperature. 4. (10 Pts) A 1.00-L flask was filled with 2.00 mol gaseous SO2 and 2.00 mol gaseous NO, and heated. After equilibrium was reached, it was found that 1.30 mol gaseous NO was present. Assume that the...
For the following equilibrium: N_2(g) + H_2(g) rightarrow NH_3(g) delta H= -386 kJ/mole Predict the direction...
For the following equilibrium: N_2(g) + H_2(g) rightarrow NH_3(g) delta H= -386 kJ/mole Predict the direction the equilibrium will shift if: N_2 is added? H_2 is removed? NH_3 is added? NH_3 is removed? the volume of the container is decreased? the pressure is increased by adding Argon gas? the reaction is cooled? equal number of moles of H_2 and NH_3 are added? a catalyst is added The equilibrium constant for the following reaction is 5.0 at 400 degree C. CO_(g)...
Consider the following reaction which is at equilibrium at 25 degree C: NH_4(NH_2CO_2)(s) 2 NH_3(g) +...
Consider the following reaction which is at equilibrium at 25 degree C: NH_4(NH_2CO_2)(s) 2 NH_3(g) + CO_2(g), delta H degree = 152.2 kJ In which direction will the reaction shift if? *(a) the pressure is increased (b) the pressure decreased (c) the temperature is increased (d) the temperature is decreased (e) some CO_2 is added (f) NH_3 is removed (g) a catalyst is added (h) some NH_4(NH_2CO_2) is added (i) some Ne is added; and, (j) the volume is increased
I NEED HELP WITH THIS PROBLEM SOMEONE HELP PLEASE!!! Consider the following reaction at equilibrium. What...
I
NEED HELP WITH THIS PROBLEM SOMEONE HELP PLEASE!!!
Consider the following reaction at equilibrium. What effect will decreasing the temperature have on the system? CO2(g) + 2 H20(I) = CH4(g) + 2 - AH° - +890 kJ O2(g) No effect will be observed. The reaction will shift to the right in the direction of products. The equilibrium constant will increase. The reaction will shift to the left in the direction of reactants.
QUESTION 18 Consider the following reversible reaction equation: 2502(g) + O2(g) → 2503(g) Ka = 1.2...
QUESTION 18 Consider the following reversible reaction equation: 2502(g) + O2(g) → 2503(g) Ka = 1.2 x 103 Complete the following sentences (a-e) by selecting the best choice from the dropdown menus. a) This is an example of a equilibrium b) At equilibrium, this system will contain mostly c) If more SO2 is added to this system at equilibrium, the reaction will shift towards the d) If oxygen gas is removed from this system at equilibrium, the reaction will shift...
Hello! Can someone help me and solve these? Thank you!
4. The following mechanism has been proposed for a reaction: Step 1 H2(g) + Step 2 O(g) + O2(g) H2(g) → O(g) H2O(g) + H2O(g) → (a) What is the equation for the overall reaction? (b) What are the expected rate laws for Step 1 and Step 2? Step 1 - Step 2 (c) What if any intermediates are there? (d) If step 1 is slow and step 2 is...
Hello! Can someone help me with this question? Thank
you!
6 Consider the following equilibrium at 200 °C in an 80.0 L vessel. 2 NO2 (8) H 2NO(g) + O2(g) At equilibrium, there are 1.88 mol of NO2, 0.120 mol NO, and 0.0600 mol O2 in the reaction vessel Calculate Kc for the reaction at this temperature.
1 Normal 1 No Spac... Heading 1 + x, x² AO-A- -- AL Paragraph Styles Font TOR Consider the reaction and predict the net reaction shift with the changes to the system: CyHa (g) + Cl2 (g) = C2H4Cl2(g) AH = -89.5 kJ/mol a. The volume is increased in the system b. The temperature is decreased in the system C. Cl2 is added to the system d. C2H4Cl2 is removed from the system e. The pressure is increased on the...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) + 02(s) Assume that the chemical reaction is at equilibrium. How will each of the follow- Kp)? Fill in the blanks by PNO ing changes affect the indicated quantities (PNo2 Po answering: increase, decrease, or no change. Poa PO К, PNO2 Pos PNO2 PM No hange (a) temperature is lowered (b) remove NO gas from the reaction flask (a) double the volume of the reaction...
When the volume is decreased for the following reaction at equilibrium which direction will the reaction shift to return to equilibrium? 2N0(g) + O2 (g) = 2NO2 (g) Toward reactants O No shift will occur because this equilibrium is not affected by volume changes. Toward products
i
need 2,3,4,5,and 6.
2. (6 Pts) Write the equilibrium expression, Kp, for the reactions in problem 1. 3. (8 Pts) At 127°C, Kc = 2.6 x 10-5 for the reaction: 2 NH3(g) + N2(g) + 3 H2(g) Calculate Kp at this temperature. 4. (10 Pts) A 1.00-L flask was filled with 2.00 mol gaseous SO2 and 2.00 mol gaseous NO, and heated. After equilibrium was reached, it was found that 1.30 mol gaseous NO was present. Assume that the...
For the following equilibrium: N_2(g) + H_2(g) rightarrow NH_3(g) delta H= -386 kJ/mole Predict the direction the equilibrium will shift if: N_2 is added? H_2 is removed? NH_3 is added? NH_3 is removed? the volume of the container is decreased? the pressure is increased by adding Argon gas? the reaction is cooled? equal number of moles of H_2 and NH_3 are added? a catalyst is added The equilibrium constant for the following reaction is 5.0 at 400 degree C. CO_(g)...
Consider the following reaction which is at equilibrium at 25 degree C: NH_4(NH_2CO_2)(s) 2 NH_3(g) + CO_2(g), delta H degree = 152.2 kJ In which direction will the reaction shift if? *(a) the pressure is increased (b) the pressure decreased (c) the temperature is increased (d) the temperature is decreased (e) some CO_2 is added (f) NH_3 is removed (g) a catalyst is added (h) some NH_4(NH_2CO_2) is added (i) some Ne is added; and, (j) the volume is increased
I
NEED HELP WITH THIS PROBLEM SOMEONE HELP PLEASE!!!
Consider the following reaction at equilibrium. What effect will decreasing the temperature have on the system? CO2(g) + 2 H20(I) = CH4(g) + 2 - AH° - +890 kJ O2(g) No effect will be observed. The reaction will shift to the right in the direction of products. The equilibrium constant will increase. The reaction will shift to the left in the direction of reactants.
QUESTION 18 Consider the following reversible reaction equation: 2502(g) + O2(g) → 2503(g) Ka = 1.2 x 103 Complete the following sentences (a-e) by selecting the best choice from the dropdown menus. a) This is an example of a equilibrium b) At equilibrium, this system will contain mostly c) If more SO2 is added to this system at equilibrium, the reaction will shift towards the d) If oxygen gas is removed from this system at equilibrium, the reaction will shift...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 22 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 53 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago