These ones as well please, thank you!
Homework Answers
Add Answer to:
These ones as well please, thank you!
Write a balanced equation from cell notation, then calculate...
4. Write a balanced equation from each cell notation, then calculate thee of the cell, is...
4. Write a balanced equation from each cell notation, then calculate thee of the cell, is it spontaneous or nonspontaneous? A. Cr(s) Crot || Cui Cu(s) B. Al(s) Al* | Ce Ce Pt C. Cu (s) Cu? || Al Al (s) Useful information: F= 96485 J/V mol electrons, AG ----F-Ecell AG --RTINK: Ece 0.0592/n*logK; EcellEcett -0.0592/n*logQ Ce (aq) + Ag+ (aq) + e Fet (aq) + Cu" (aq) + Cu (aq) + 2e 2H(aq) + 2 Pb (aq) + 2e...
please answer the full question. 2. You measured cell potentials (voltages) for reactions of metals and...
please answer the full question.
2. You measured cell potentials (voltages) for reactions of metals and metal ions. We will use the standard date and practice calculating these. Recall: E-Ecathode - Eanode Remember reduction occurs at the cathode; oxidation occurs at the anode For the anode reactions, your reactant will be on the product side of the standard equation, but don't change any sign. The equation does that for you. Cathode Reaction Agt + e → Ag Ecathode Anode Reaction...
What is the balanced chemical equation for the electrochemical cell reaction expressed using shorthand notation below?...
What is the balanced chemical equation for the electrochemical cell reaction expressed using shorthand notation below? Al(s) | A13+(aq) || Ni2+(aq) | Ni(s) O 2 Al(s) + 3 Ni2+(aq) + 2 A13+(aq) + 3 Ni(s) 3 Al(s) + 2 Ni2+(aq) → 3 A13+(aq) + 2 Ni(s) O 2 Ni(s) + 3 A13+(aq) + 2 Ni2+(aq) + 3 Al(s) O 3 Ni(s) + 2 A13+(aq) → 3 Ni2+(aq) + 2 Al(s)
Write net equation for the spontaneous redox reaction and determine the standard cell potential that results...
Write net equation for the spontaneous redox reaction and determine the standard cell potential that results when each of the following redox couples are connected in an electrochemical cell. Instructions: • Enter all substances in the order listed at the top of the column. • Use a carot to indicate a superscript, but do nothing for subscripts. • Use a hyphen + greater than (->) for yields. . Click on the eye symbol to check your formatting. Couples Rxn: Ox(1)...
For the following cell, write a balanced equation for the cell reaction and calculate E degree...
For the following cell, write a balanced equation for the cell reaction and calculate E degree and Delta G degree at 25 degree C: Pt(s) | H_2(1.0 atm) | H^+(1.00 M) ||Cu^2+(1.00 M)|Cu(s)
Write a balanced net ionic equation for the overall reaction represented by the cell notation below...
Write a balanced net ionic equation for the overall reaction represented by the cell notation below 4. Zn(s) I ZnCl2(aq) II HCl(aq) I Halg) | Pt(s)
Given the following line notation for an electrochemical cell, write the balanced net equation: Zn(s) |...
Given the following line notation for an electrochemical cell, write the balanced net equation: Zn(s) | Zn2+ (aq, 1 M) || H+ (aq, 1 M), MnO4 - (1 M), Mn2+ (1 M) | Pt
b. Write the cell notation for the following redox reaction. Here, Cu+ or CuNO3 is oxidized...
b. Write the cell notation for the following redox reaction. Here, Cu+ or CuNO3 is oxidized to Cu2+ or Cu(NO3)2in the oxidation half-cell. Since there is only aqueous species and there is no electrode (metal) in the oxidation half-cell, use platinum (Pt) as an inert electrode in the oxidation half-cell. 3CuNO3(aq) + Au(NO3)3(aq) ⟶ 3Cu(NO3)2(aq) + Au(s)
please help the standrad reduction provided down What is the calculated value of the cell potential...
please help the standrad reduction provided down
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2+ concentration is 9.24x10 + M and the Cr3+ concentration is 1.47 M? 3Cu2+ (aq) + 2Cr(s) Answer: 3Cu(s) + 2Cr +(aq) v The cell reaction as written above is spontaneous for the concentrations given: What is the calculated value of the cell potential at 298K for an electrochemical cell with the...
Name: Chem 1120 Electrochemical Potentials Perform each of the following calculations, showing all work. Use the...
Name: Chem 1120 Electrochemical Potentials Perform each of the following calculations, showing all work. Use the Electrochemical Potentials table provided on D2L if values are not provided. Standard State Electrochemical Cells 1. In each of the following systems two half-reactions are provided. For each system, a) write the balanced reaction occurring for a spontaneous system, and b) calculate the overall standard cell potential. a. Half Reaction Zn2+(aq) + 2e = Zn(s) Cr3+ (aq) + 38 = Cr(s) Eºred (V) -0.76...
4. Write a balanced equation from each cell notation, then calculate thee of the cell, is it spontaneous or nonspontaneous? A. Cr(s) Crot || Cui Cu(s) B. Al(s) Al* | Ce Ce Pt C. Cu (s) Cu? || Al Al (s) Useful information: F= 96485 J/V mol electrons, AG ----F-Ecell AG --RTINK: Ece 0.0592/n*logK; EcellEcett -0.0592/n*logQ Ce (aq) + Ag+ (aq) + e Fet (aq) + Cu" (aq) + Cu (aq) + 2e 2H(aq) + 2 Pb (aq) + 2e...
please answer the full question.
2. You measured cell potentials (voltages) for reactions of metals and metal ions. We will use the standard date and practice calculating these. Recall: E-Ecathode - Eanode Remember reduction occurs at the cathode; oxidation occurs at the anode For the anode reactions, your reactant will be on the product side of the standard equation, but don't change any sign. The equation does that for you. Cathode Reaction Agt + e → Ag Ecathode Anode Reaction...
What is the balanced chemical equation for the electrochemical cell reaction expressed using shorthand notation below? Al(s) | A13+(aq) || Ni2+(aq) | Ni(s) O 2 Al(s) + 3 Ni2+(aq) + 2 A13+(aq) + 3 Ni(s) 3 Al(s) + 2 Ni2+(aq) → 3 A13+(aq) + 2 Ni(s) O 2 Ni(s) + 3 A13+(aq) + 2 Ni2+(aq) + 3 Al(s) O 3 Ni(s) + 2 A13+(aq) → 3 Ni2+(aq) + 2 Al(s)
Write net equation for the spontaneous redox reaction and determine the standard cell potential that results when each of the following redox couples are connected in an electrochemical cell. Instructions: • Enter all substances in the order listed at the top of the column. • Use a carot to indicate a superscript, but do nothing for subscripts. • Use a hyphen + greater than (->) for yields. . Click on the eye symbol to check your formatting. Couples Rxn: Ox(1)...
For the following cell, write a balanced equation for the cell reaction and calculate E degree and Delta G degree at 25 degree C: Pt(s) | H_2(1.0 atm) | H^+(1.00 M) ||Cu^2+(1.00 M)|Cu(s)
Write a balanced net ionic equation for the overall reaction represented by the cell notation below 4. Zn(s) I ZnCl2(aq) II HCl(aq) I Halg) | Pt(s)
please help the standrad reduction provided down
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2+ concentration is 9.24x10 + M and the Cr3+ concentration is 1.47 M? 3Cu2+ (aq) + 2Cr(s) Answer: 3Cu(s) + 2Cr +(aq) v The cell reaction as written above is spontaneous for the concentrations given: What is the calculated value of the cell potential at 298K for an electrochemical cell with the...
Name: Chem 1120 Electrochemical Potentials Perform each of the following calculations, showing all work. Use the Electrochemical Potentials table provided on D2L if values are not provided. Standard State Electrochemical Cells 1. In each of the following systems two half-reactions are provided. For each system, a) write the balanced reaction occurring for a spontaneous system, and b) calculate the overall standard cell potential. a. Half Reaction Zn2+(aq) + 2e = Zn(s) Cr3+ (aq) + 38 = Cr(s) Eºred (V) -0.76...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago