Explain why, despite each having 4 fluorines, XeF4, CF4, SF4, SiF4 and SnF4 did not all...
Explain why, despite each having 4 fluorines, XeF4, CF4, SF4, SiF4 and SnF4 did not all have the same molecular geometry.
**if you can draw the molecules would be great.
Homework Answers
Add Answer to:
Explain why, despite each having 4 fluorines, XeF4, CF4, SF4,
SiF4 and SnF4 did not all...
3. For each of the following molecules and ions, identify the Hybridization of the indicated atom...
3. For each of the following molecules and ions, identify the Hybridization of the indicated atom (sp, sp?, spº, spºd, spºd) (12 pts) a. H.CO Hybridization of C? b. XeF4 Hybridization of Xe? c. [F-I-F] Hybridization of I? d. H.COH Hybridization of O? (14 pts) 4. Consider the Carbon Monoxide molecule (CO) a. Draw and Label the Molecular Orbital Energy Line Diagram, starting with Is (0, 0,*, 0, 0, 0,*, 0,*). b. Calculate the Bond Order for CO c. Are...
Answer all. 1. Consider BrF3 and answer each of the following questions: a) How many regions...
Answer all.
1. Consider BrF3 and answer each of the following questions: a) How many regions of high electron density surround the central atom? b) Give the AXmE, notation. c) What is the electron pair geometry? d) What is the molecular geometry? e) What are the bond angles? (approximate) f) Is this molecule polar? 2. Are the electronic geometry and molecular geometry always the same? Explain. 3. Can a molecule have polar bonds and not be polar? Use NF3 and...
4. Draw an organic compound for each set of criteria, or explain why the criteria render...
4. Draw an organic compound for each set of criteria, or explain why the criteria render a structure impossible: a) What is a single structure that has a constitutional isomer, a geometric isomer, and an enantiomer? Please draw the original structure, along with its constitutional isomer, its geometric isomer, and its enantiomer - or explain why a single compound cannot have a constitutional isomer, a geometric isomer, and an enantiomer. b) What is a single structure which is chiral and...
Please answer all questions correctly especially question d. Also, explain if you can! Consider the following...
Please answer all questions correctly especially question d. Also,
explain if you can!
Consider the following compound with the molecular formula C4HgO2 OH a. Draw a constitutional isomer that you expect would be approximately one trillion (10) times more acidic than the compound above. What explains the increased acidity of this isomer? Draw a constitutional isomer that you expect will be less acidic than the compound above. Why would the acidity be decreased? b. Draw a constitutional isomer that you...
m an extensive or an intensive property? Explain why you chose what you did. 4. [1...
m an extensive or an intensive property? Explain why you chose what you did. 4. [1 pt] n the following equation, explain what each of the symbols means, and briefly describe how it is significant (that is, in what sort of situation would it be useful?). A drawing might be handy. 12 pt] On the axes below, draw a motion diagram (positions with velocity vectors) for a mug of frosty root beer that slides from a bartender at position -3...
For each of the scenarios please pick exercises and explain why you decided to use each...
For each of the scenarios please pick exercises and explain why you decided to use each exercise how many sets and repetitions you would have each athlete do. Give 2 modalities that you would use for each scenario and why you would use them. A men’s lacrosse player walked into the ATR complaining of pain in his great toe. The athlete states that he planted while changing directions and immediately felt pain. The ATC notices swelling, bruising and a decreased...
im confused on what to say for something like 5 and 6 and compleatly lost on...
im confused on what to say for something like 5 and 6 and
compleatly lost on 10 thanks for the help in advance
3. Draw the Lewis structure, using a line to represent a covalent bond and dots to represent electron lone pairs, for acetaldehyde, CH3CHO. - C - H ethanal - - - 4. Using the VSEPR model draw the three dimensional structure of methane. What is the molecular geometry about the carbon atom? contains 4-c-H bonds single carbon...
I have the answer to all of these, so can you just explain why those are...
I have the answer to all of these, so can you just explain why
those are the correct answers?
4. Which of the following does NOT necessarily affect the theoretical effusion) speed of a gas? A. Temperature C. Molar mass D. Kinetic Energy E. Effusion speeds are always the same 5. Which of the following will constant)? ncrease the pressure the most (assume all other varilables remain pressure A. Cutting the volume to a quarter (V4) C. Tripling the temperature...
Modeling Geometry and Polarity Post-Lab Exercise 1. The capsicum molecule is shown below, and one tetrahedral cent...
Modeling Geometry and Polarity Post-Lab Exercise 1. The capsicum molecule is shown below, and one tetrahedral center has been identified. Use arrows to identify three other centers and identify the molecular geometry of each one. You must choose centers that all have different molecular geometry from each other, and you may NOT use another tetrahedral center. tetrahedral center :öc =CHH 2. Two structural formulas for C2H4O2 were provided at the beginning of this document. Draw a third structural formula of...
8. For each of the following, either draw a undirected graph satisfying the given criteria or explain why it cannot be done. Your graphs should be simple, i.e. not having any multiple edges (more tha...
8. For each of the following, either draw a undirected graph satisfying the given criteria or explain why it cannot be done. Your graphs should be simple, i.e. not having any multiple edges (more than one edge between the same pair of vertices) or self-loops (edges with both ends at the same vertex). [10 points] a. A graph with 3 connected components, 11 vertices, and 10 edges. b. A graph with 4 connected components, 10 vertices, and 30 edges. c....
3. For each of the following molecules and ions, identify the Hybridization of the indicated atom (sp, sp?, spº, spºd, spºd) (12 pts) a. H.CO Hybridization of C? b. XeF4 Hybridization of Xe? c. [F-I-F] Hybridization of I? d. H.COH Hybridization of O? (14 pts) 4. Consider the Carbon Monoxide molecule (CO) a. Draw and Label the Molecular Orbital Energy Line Diagram, starting with Is (0, 0,*, 0, 0, 0,*, 0,*). b. Calculate the Bond Order for CO c. Are...
Answer all.
1. Consider BrF3 and answer each of the following questions: a) How many regions of high electron density surround the central atom? b) Give the AXmE, notation. c) What is the electron pair geometry? d) What is the molecular geometry? e) What are the bond angles? (approximate) f) Is this molecule polar? 2. Are the electronic geometry and molecular geometry always the same? Explain. 3. Can a molecule have polar bonds and not be polar? Use NF3 and...
4. Draw an organic compound for each set of criteria, or explain why the criteria render a structure impossible: a) What is a single structure that has a constitutional isomer, a geometric isomer, and an enantiomer? Please draw the original structure, along with its constitutional isomer, its geometric isomer, and its enantiomer - or explain why a single compound cannot have a constitutional isomer, a geometric isomer, and an enantiomer. b) What is a single structure which is chiral and...
Please answer all questions correctly especially question d. Also,
explain if you can!
Consider the following compound with the molecular formula C4HgO2 OH a. Draw a constitutional isomer that you expect would be approximately one trillion (10) times more acidic than the compound above. What explains the increased acidity of this isomer? Draw a constitutional isomer that you expect will be less acidic than the compound above. Why would the acidity be decreased? b. Draw a constitutional isomer that you...
m an extensive or an intensive property? Explain why you chose what you did. 4. [1 pt] n the following equation, explain what each of the symbols means, and briefly describe how it is significant (that is, in what sort of situation would it be useful?). A drawing might be handy. 12 pt] On the axes below, draw a motion diagram (positions with velocity vectors) for a mug of frosty root beer that slides from a bartender at position -3...
im confused on what to say for something like 5 and 6 and
compleatly lost on 10 thanks for the help in advance
3. Draw the Lewis structure, using a line to represent a covalent bond and dots to represent electron lone pairs, for acetaldehyde, CH3CHO. - C - H ethanal - - - 4. Using the VSEPR model draw the three dimensional structure of methane. What is the molecular geometry about the carbon atom? contains 4-c-H bonds single carbon...
I have the answer to all of these, so can you just explain why
those are the correct answers?
4. Which of the following does NOT necessarily affect the theoretical effusion) speed of a gas? A. Temperature C. Molar mass D. Kinetic Energy E. Effusion speeds are always the same 5. Which of the following will constant)? ncrease the pressure the most (assume all other varilables remain pressure A. Cutting the volume to a quarter (V4) C. Tripling the temperature...
Modeling Geometry and Polarity Post-Lab Exercise 1. The capsicum molecule is shown below, and one tetrahedral center has been identified. Use arrows to identify three other centers and identify the molecular geometry of each one. You must choose centers that all have different molecular geometry from each other, and you may NOT use another tetrahedral center. tetrahedral center :öc =CHH 2. Two structural formulas for C2H4O2 were provided at the beginning of this document. Draw a third structural formula of...
8. For each of the following, either draw a undirected graph satisfying the given criteria or explain why it cannot be done. Your graphs should be simple, i.e. not having any multiple edges (more than one edge between the same pair of vertices) or self-loops (edges with both ends at the same vertex). [10 points] a. A graph with 3 connected components, 11 vertices, and 10 edges. b. A graph with 4 connected components, 10 vertices, and 30 edges. c....
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago