Homework Answers
Add Answer to:
What is the main product of this reaction! CH,CH,CH3 1. KMnO4, NaOH 2. Hot Me,c? CO,H...
What is the major product of the following reaction? 1.HT, HOT 2.KMnO4, NaOH OH HO но...
What is the major product of the following reaction? 1.HT, HOT 2.KMnO4, NaOH OH HO но Үн 3.H30, 4 ora organ olyan hyn rolyn LIV
organic chemistry help! 1) for each reaction give the expected product 2) consider the conjugate bases,...
organic chemistry help!
1) for each reaction give the expected product
2) consider the conjugate bases, then arrange in order of
weakest to strongest
1. For each reaction give the expected product. 1. N(CH3)3 2. CICH,CH(CH3)2 CH3MgBr a) HO 1. KMnO4 2.SOCI2 d) CH 1. NaCN, DMSO (solvent) 2. LiAIHA 3. H₂O 2. Consider the conjugate bases of each of the following weak acids, then arrange the acids in order of weakest to strongest CI OH он OH
Carboxylic acid problems 1) KMnO4, NaOH 1) KMnO4. NaOH Heat 2) H30 Cr Heat 2) H2O*cr...
Carboxylic acid problems 1) KMnO4, NaOH 1) KMnO4. NaOH Heat 2) H30 Cr Heat 2) H2O*cr 1) Ag20 or Ag(NH3)2*OH 1) Og 2) H,02 H2) H30°C KMnO4 CH3(CH2)6CH2 CH2(CH2)CH2COH C=C HH H30+ Oleic acid HO 1) KMnO4, NaOH Heat 2) H30*cr CH3 CH3CHCH2CH2CH2OH 4-Methyl-1-pentanol H30+ OH 1) H.CO. CH3CH2CH2CH2CH2CH Hexanal CHE 212 CH 15 & 16 Cathexaulic Acids. 22
1) Order the following from least reactive o most CH-8-0-8-CH, -OCHCH, CH-8-a 2) What is the...
1) Order the following from least reactive o most CH-8-0-8-CH, -OCHCH, CH-8-a 2) What is the IUPAC name? CHO CH3-CH=CH-CH-C-OH 3) Which is the strongest acid? CF,CH,COH CF,COH CCI,COH 4) What is the product of this reaction? (CH3),CHCH_Li-2.990 Ft 5) What is the missing reagent? W CH OH ~ CO,H 6) What is the product? CH,CH, Mgr 7) What is the product of the following reaction? CH,-&- COMME 8) Draw the structure of a 4 carbon containing lactone. 9) Provide...
3. CU Which is the major product for the following reaction? НАС -CH₃ + NaOH CH3 но но H₃ C CH₃ H₃C CH HO CH3 НАС,...
3. CU Which is the major product for the following reaction? НАС -CH₃ + NaOH CH3 но но H₃ C CH₃ H₃C CH HO CH3 НАС, Хе " CH₂ CHE CHE
system: (1) (CH2=CH-CHCH-COH (2) HO_CCHCH(CH2CH=CH,)CH2CH(CH3)CO,H (3) CH2CH(CO2H)CH(CO,H)CH,CO,H Enter the IUPAC name Enter the IUPAC name Enter...
system: (1) (CH2=CH-CHCH-COH (2) HO_CCHCH(CH2CH=CH,)CH2CH(CH3)CO,H (3) CH2CH(CO2H)CH(CO,H)CH,CO,H Enter the IUPAC name Enter the IUPAC name Enter the IUPAC name
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all...
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid
1. What substitution mechanism will the following reaction likely proceed through? (1pt) CH3 HU. : N=C:...
1. What substitution mechanism will the following reaction likely proceed through? (1pt) CH3 HU. : N=C: +3C-Br - NC-C WH + Br HT 2. Label the componetns of the above reation as: Nucleophile, electrophile, leaving group (3pt) 3. Assign R and S configuration to the following reactant and products (2pt) NaOH HO + HO-COCH3 H.COwc-OH + HO-6 H2COCCI H H 4. What ratio should the two above products be formed in and what is their stereochemical relationship? (2pt) 5. Predict...
1) Order the following from least reactive o most | ca, -o--CH, CH --CH-CH, CH3-8-a 2) What is the IUPAC name? CH,...
1) Order the following from least reactive o most | ca, -o--CH, CH --CH-CH, CH3-8-a 2) What is the IUPAC name? CH, . CH3-CH=CH-CH-C-OH 3) Which is the strongest acid? CF,CH.CH CECOH cc.,ČOH 4) What is the product of this reaction? (CH3),CHCH,Li 2.490. 5) What is the missing reagent? CH,он л соно 6) What is the product? CH,CH-MgBr 7) What is the product of the following reaction? CH,-6-g ĐH,CH,NH, . 8) Draw the structure of a 4 carbon containing lactone....
Question 6 (1 point) Which of the following can be prepared by acetoacetic ester synthesis? CO,...
Question 6 (1 point) Which of the following can be prepared by acetoacetic ester synthesis? CO, 1 Question 7 (1 point) What is the order of acid strength from strongest to weakest acid? floath the oth OA) 2>1>4>3 OB) 1>2>3>4 C) 3>4>1>2 D) 2>4>1>3 O R H V B N Question 8 (1 point) What is the IUPAC name for this compound? COH CH,CH,CHCH,CH.CH O2-Ethyl-2-propyl-acetic acid 3-Hexylcarboxylic acid 2 Ethylpentanoic acid 2-Propylbutanoic acid Question 9 (1 point) 16 O 7...
What is the major product of the following reaction? 1.HT, HOT 2.KMnO4, NaOH OH HO но Үн 3.H30, 4 ora organ olyan hyn rolyn LIV
organic chemistry help!
1) for each reaction give the expected product
2) consider the conjugate bases, then arrange in order of
weakest to strongest
1. For each reaction give the expected product. 1. N(CH3)3 2. CICH,CH(CH3)2 CH3MgBr a) HO 1. KMnO4 2.SOCI2 d) CH 1. NaCN, DMSO (solvent) 2. LiAIHA 3. H₂O 2. Consider the conjugate bases of each of the following weak acids, then arrange the acids in order of weakest to strongest CI OH он OH
Carboxylic acid problems 1) KMnO4, NaOH 1) KMnO4. NaOH Heat 2) H30 Cr Heat 2) H2O*cr 1) Ag20 or Ag(NH3)2*OH 1) Og 2) H,02 H2) H30°C KMnO4 CH3(CH2)6CH2 CH2(CH2)CH2COH C=C HH H30+ Oleic acid HO 1) KMnO4, NaOH Heat 2) H30*cr CH3 CH3CHCH2CH2CH2OH 4-Methyl-1-pentanol H30+ OH 1) H.CO. CH3CH2CH2CH2CH2CH Hexanal CHE 212 CH 15 & 16 Cathexaulic Acids. 22
1) Order the following from least reactive o most CH-8-0-8-CH, -OCHCH, CH-8-a 2) What is the IUPAC name? CHO CH3-CH=CH-CH-C-OH 3) Which is the strongest acid? CF,CH,COH CF,COH CCI,COH 4) What is the product of this reaction? (CH3),CHCH_Li-2.990 Ft 5) What is the missing reagent? W CH OH ~ CO,H 6) What is the product? CH,CH, Mgr 7) What is the product of the following reaction? CH,-&- COMME 8) Draw the structure of a 4 carbon containing lactone. 9) Provide...
3. CU Which is the major product for the following reaction? НАС -CH₃ + NaOH CH3 но но H₃ C CH₃ H₃C CH HO CH3 НАС, Хе " CH₂ CHE CHE
system: (1) (CH2=CH-CHCH-COH (2) HO_CCHCH(CH2CH=CH,)CH2CH(CH3)CO,H (3) CH2CH(CO2H)CH(CO,H)CH,CO,H Enter the IUPAC name Enter the IUPAC name Enter the IUPAC name
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid
1. What substitution mechanism will the following reaction likely proceed through? (1pt) CH3 HU. : N=C: +3C-Br - NC-C WH + Br HT 2. Label the componetns of the above reation as: Nucleophile, electrophile, leaving group (3pt) 3. Assign R and S configuration to the following reactant and products (2pt) NaOH HO + HO-COCH3 H.COwc-OH + HO-6 H2COCCI H H 4. What ratio should the two above products be formed in and what is their stereochemical relationship? (2pt) 5. Predict...
1) Order the following from least reactive o most | ca, -o--CH, CH --CH-CH, CH3-8-a 2) What is the IUPAC name? CH, . CH3-CH=CH-CH-C-OH 3) Which is the strongest acid? CF,CH.CH CECOH cc.,ČOH 4) What is the product of this reaction? (CH3),CHCH,Li 2.490. 5) What is the missing reagent? CH,он л соно 6) What is the product? CH,CH-MgBr 7) What is the product of the following reaction? CH,-6-g ĐH,CH,NH, . 8) Draw the structure of a 4 carbon containing lactone....
Question 6 (1 point) Which of the following can be prepared by acetoacetic ester synthesis? CO, 1 Question 7 (1 point) What is the order of acid strength from strongest to weakest acid? floath the oth OA) 2>1>4>3 OB) 1>2>3>4 C) 3>4>1>2 D) 2>4>1>3 O R H V B N Question 8 (1 point) What is the IUPAC name for this compound? COH CH,CH,CHCH,CH.CH O2-Ethyl-2-propyl-acetic acid 3-Hexylcarboxylic acid 2 Ethylpentanoic acid 2-Propylbutanoic acid Question 9 (1 point) 16 O 7...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 46 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago