Homework Answers
Add Answer to:
2: Phosphate groups on the backbone of DNA are negatively charged at neutral pH. This suggests...
2. Phosphate groups on the backbone of DNA are negatively charged at neutral pH. This suggests...
2. Phosphate groups on the backbone of DNA are negatively charged at neutral pH. This suggests that DNA-binding proteins are often enriched in which amino acid? A. E B. G C. K D. L E. W 3. You are studying a particular reaction under conditions in which the AG = 12 kJ/mol. Which of the following statements best describes the equilibrium constant (K.) of this reaction? A. Keq < 0 B. Keq = 0 C. 0 < Keq <1 D....
A DNA molecule has many phosphate groups, as shown below What type of amino acid side...
A DNA molecule has many phosphate groups, as shown below What type of amino acid side chains would be most likely be involved in binding this substrate at the active site? Select one polar, negatively charged polar, positively charged hydrophobic polar neutral
1.histones are proteins that make up nucleosomes. they bind to the backbone of DNA in chromosomes....
1.histones are proteins that make up nucleosomes. they bind to the backbone of DNA in chromosomes. A majority of the residues in these proteins must be ___ for this to occur a) hydrophobic b) neg charged c)hydrophilic and neutral d)pos charged e)cytseines 2. the stability of a protein secondary structure is mostly due to a) the hydrogen bonding between the amide groups within the backbone of the protein b) the attraction for water molecules by hydrophobic amino acid residues c)...
ATP hydrolysis is highly ______ because it involves ______. A. Exergonic; separation of negatively charged phosphate...
ATP hydrolysis is highly ______ because it involves ______. A. Exergonic; separation of negatively charged phosphate groups B. Exergonic; alteration of the transition state C. Endergonic; breaking of covalent bonds D. Endergonic; removal of a phosphate group forming phosphoric acid, which decreases the pH
4. Which of the following statements best describes why the sugar phosphate nucleic acid backbone is...
4. Which of the following statements best describes why the sugar phosphate nucleic acid backbone is on the outer part of the DNA double helix while the nitrogen bases are on the inside of the double helix? A) The sugar phosphate backbone is hydrophilic while the bases are hydrophobic. B) The sugar phosphate backbone is hydrophobic while the bases are hydrophilic. C) The sugar phosphate backbones of the two strands are bonded together. D) The nitrogen bases are covalently bonded...
Question 2 (1 point) Amino acids can be classified as A. Hydrophobic amino acids with nonpolar...
Question 2 (1 point) Amino acids can be classified as A. Hydrophobic amino acids with nonpolar R groups B. Polar amino acids with neutral R groups but the charge is not evenly distributed C. Positively charged amino acids with R groups that have positive charge at physiological pH. D. Negatively charged amino acids with R groups that have a negative charge at physiological pH. How would the amino acid alanine be classified? Think through your reasoning. L-Alanine H2N-CHC-OH CH3
3-25. The function of DNA is to while the function of RNA is to A) store...
3-25. The function of DNA is to while the function of RNA is to A) store information about proteins: construct proteins based on the information in DNA B) build proteins break down proteins c) act as a blueprint for proteins act as a blueprint for other biomolecules D) act as a blueprint for the body: synthesize whatever biomolecules are required for the body to function E) construct and store proteins, transport proteins to needed locations in the body 326. A...
c) The steps or rungs of the DNA ladder are composed of phosphate group 4 Deoxyribose...
c) The steps or rungs of the DNA ladder are composed of phosphate group 4 Deoxyribose 15. Use Figure 2 and 3 of the lab to compare the genome of a human with a mouse, fruit fly and yeast. paired in a specific way. d) Adenine in one DNA strand always pain with thymine ) Bases in opposite strands of a DNA molecule are linked together by hydrogen in the other strand and bonds. Yeast Human Mouse Fruit Fly Number...
Question 1: In DNA, which of the following functional groups plays a key role in polymerization...
Question 1: In DNA, which of the following functional groups plays a key role in polymerization (covalent linkage of the monomer nucleotides)? A. phosphate B. methyl C. sulfhydryl D. hydrogen E. nitrogen Question 2. The named components of a nucleotide of RNA are A. ribose, phosphate, A,U,G or C base B. deoxyribose, phosphate, A, T, G or C base C. deoxyribose, phosphate, A, U, G, or C base D. ribose, phosphate, A, T, G or C base Question 3. In...
20. Which enzyme separates the strands of the DNA helix? A. DNA Polymerase E. Single Stranded...
20. Which enzyme separates the strands of the DNA helix? A. DNA Polymerase E. Single Stranded Binding Proteins B. Ligase F. Primase C. Helicase G. Lagging Strand D. Topoisomerase H. Leading Strand 21. Which enzyme joins newly synthesized DNA fragments on the lagging strand? A. DNA Polymerase E. Single Stranded Binding Proteins B. Ligase F. Primase C. Helicase G. Lagging Strand D. Topoisomerase H. Leading Strand 22. In a PCR reaction, at which temperature do the two strands of DNA...
2. Phosphate groups on the backbone of DNA are negatively charged at neutral pH. This suggests that DNA-binding proteins are often enriched in which amino acid? A. E B. G C. K D. L E. W 3. You are studying a particular reaction under conditions in which the AG = 12 kJ/mol. Which of the following statements best describes the equilibrium constant (K.) of this reaction? A. Keq < 0 B. Keq = 0 C. 0 < Keq <1 D....
A DNA molecule has many phosphate groups, as shown below What type of amino acid side chains would be most likely be involved in binding this substrate at the active site? Select one polar, negatively charged polar, positively charged hydrophobic polar neutral
4. Which of the following statements best describes why the sugar phosphate nucleic acid backbone is on the outer part of the DNA double helix while the nitrogen bases are on the inside of the double helix? A) The sugar phosphate backbone is hydrophilic while the bases are hydrophobic. B) The sugar phosphate backbone is hydrophobic while the bases are hydrophilic. C) The sugar phosphate backbones of the two strands are bonded together. D) The nitrogen bases are covalently bonded...
Question 2 (1 point) Amino acids can be classified as A. Hydrophobic amino acids with nonpolar R groups B. Polar amino acids with neutral R groups but the charge is not evenly distributed C. Positively charged amino acids with R groups that have positive charge at physiological pH. D. Negatively charged amino acids with R groups that have a negative charge at physiological pH. How would the amino acid alanine be classified? Think through your reasoning. L-Alanine H2N-CHC-OH CH3
3-25. The function of DNA is to while the function of RNA is to A) store information about proteins: construct proteins based on the information in DNA B) build proteins break down proteins c) act as a blueprint for proteins act as a blueprint for other biomolecules D) act as a blueprint for the body: synthesize whatever biomolecules are required for the body to function E) construct and store proteins, transport proteins to needed locations in the body 326. A...
c) The steps or rungs of the DNA ladder are composed of phosphate group 4 Deoxyribose 15. Use Figure 2 and 3 of the lab to compare the genome of a human with a mouse, fruit fly and yeast. paired in a specific way. d) Adenine in one DNA strand always pain with thymine ) Bases in opposite strands of a DNA molecule are linked together by hydrogen in the other strand and bonds. Yeast Human Mouse Fruit Fly Number...
20. Which enzyme separates the strands of the DNA helix? A. DNA Polymerase E. Single Stranded Binding Proteins B. Ligase F. Primase C. Helicase G. Lagging Strand D. Topoisomerase H. Leading Strand 21. Which enzyme joins newly synthesized DNA fragments on the lagging strand? A. DNA Polymerase E. Single Stranded Binding Proteins B. Ligase F. Primase C. Helicase G. Lagging Strand D. Topoisomerase H. Leading Strand 22. In a PCR reaction, at which temperature do the two strands of DNA...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 53 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago