Is the following statement true or false? Life proceeded onto land after oxygen was present.
Is the following statement true or false?
Life proceeded onto land after oxygen was present.
Homework Answers
This statement is true as oxygen is produced by the cyanobacteria in water then the level of oxygen increased in the atmosphere. Due to photosynthesis the levels of oxygen increased in the atmosphere.
2.3 billion years ago cyanobacteria evolved into other multicellular forms. This led to proceeding of life on land.
First plants were thallophytes then bryophytes were formed and then pteridophytes were formed which eventually formed pteridophytes and then eventually angiosperms were formed.
So, the correct answer is True.
Add Answer to:
Is the following statement true or false?
Life proceeded onto land after oxygen was present.
The early atmosphere had enough oxygen to support life. Is this true or false?
The early atmosphere had enough oxygen to support life. Is this true or false?
Is the following statement true or false? Justify your answer. "The reactant that is present in...
Is the following statement true or false? Justify your answer. "The reactant that is present in the lesser amount is always the limiting reagent." Problems 1) Consider the synthesis of water shown in model 3. A container is filled with 100,0 g of H2 and 50.0 g of Oz. (a) Which reactant is the limiting reactant? Show your work in detail. (b) What mass of water can be produced? Is this the theoretical yield or the actual yield? (c) Which...
Determine whether the following statement is true or false. If the statement is false, make the...
Determine whether the following statement is true or false. If the statement is false, make the necessary changes(s) to produce a true statement. In V5 = In 5 4 Choose the correct answer below. A. The statement is false. The correct statement is in 5 = In 54 B. The statement is true In 5 OC. The statement is false. The correct statement is in 54 OD. The statement is false. The correct statement is in 5 = 1 4...
Q1: if land is unlimited in supply, will there be no scarcity rents? True or false...
Q1: if land is unlimited in supply, will there be no scarcity rents? True or false Q2: with flow if annual rents of 50,000 and a discount rate of 2% what is the present value of land if you can own the land in perpetuity?
The following statement is either true or false. If the statement is true, prove it. If...
The following statement is either true or false. If the statement is true, prove it. If the statement is false, give a specific counterexample... If A, B, C and D are sets, then (A × B)∩(C × D) = (A ∩ C)×(B ∩ D).
7) Decide whether the statement concerning ionization energy is true or false. If the statement is...
7) Decide whether the statement concerning ionization energy is true or false. If the statement is false, correct the statement (4 points). True or False Correction if false Statement An oxygen (0) atom has larger first ionization energy than a fluorine (F) atom. A cesium (Cs) atom has smaller first ionization energy than lithium (Li) atom.
Determine whether the following statement is true or false. If it is false, rewrite it as...
Determine whether the following statement is true or false. If it is false, rewrite it as a true statement. A sample statistic will not change from sample to sample Choose the correct answer below O A. The statement is false. A sample statistic can change from sample to sample O B. The statement is true. C. The statement is false. A population statistic will not change from population to population. O D. The statement is false. A sample parameter will...
Determine whether the following statement is true or false. If the statement is false, make the...
Determine whether the following statement is true or false. If the statement is false, make the necessary change(s) to produce a true statement. If one or more data items are much greater than the other items, the mean, rather than the median, is more representative of the data.
rue or False: A is onto iff the columns of A span R". True or False:...
rue or False: A is onto iff the columns of A span R". True or False: If m- n, then A, necessarily a square matrix, is invertible (both one-to-one nd onto) iff R span(al,., an). 1. An m × n matrix A=[ai a2 an can be viewed as a function from Rn to Rm, sending x = (xi, , an) e Rn to Ax =
(5 pts) 3. Is the following statement true or false? "If there is no charge enclosed...
(5 pts) 3. Is the following statement true or false? "If there is no charge enclosed by a Gaussian surface, then there is no electric field present.” Justify your answer.
Is the following statement true or false? Justify your answer. "The reactant that is present in the lesser amount is always the limiting reagent." Problems 1) Consider the synthesis of water shown in model 3. A container is filled with 100,0 g of H2 and 50.0 g of Oz. (a) Which reactant is the limiting reactant? Show your work in detail. (b) What mass of water can be produced? Is this the theoretical yield or the actual yield? (c) Which...
Determine whether the following statement is true or false. If the statement is false, make the necessary changes(s) to produce a true statement. In V5 = In 5 4 Choose the correct answer below. A. The statement is false. The correct statement is in 5 = In 54 B. The statement is true In 5 OC. The statement is false. The correct statement is in 54 OD. The statement is false. The correct statement is in 5 = 1 4...
7) Decide whether the statement concerning ionization energy is true or false. If the statement is false, correct the statement (4 points). True or False Correction if false Statement An oxygen (0) atom has larger first ionization energy than a fluorine (F) atom. A cesium (Cs) atom has smaller first ionization energy than lithium (Li) atom.
Determine whether the following statement is true or false. If it is false, rewrite it as a true statement. A sample statistic will not change from sample to sample Choose the correct answer below O A. The statement is false. A sample statistic can change from sample to sample O B. The statement is true. C. The statement is false. A population statistic will not change from population to population. O D. The statement is false. A sample parameter will...
rue or False: A is onto iff the columns of A span R". True or False: If m- n, then A, necessarily a square matrix, is invertible (both one-to-one nd onto) iff R span(al,., an). 1. An m × n matrix A=[ai a2 an can be viewed as a function from Rn to Rm, sending x = (xi, , an) e Rn to Ax =
(5 pts) 3. Is the following statement true or false? "If there is no charge enclosed by a Gaussian surface, then there is no electric field present.” Justify your answer.
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 27 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago