Please helpHomework Answers
Add Answer to:
Please help
What product is formed in the following reaction? What type of catalyst is used...
help with all please 3. Explain the difference in reactivity between organolithium reagents (eg CH Li)...
help with all please
3. Explain the difference in reactivity between organolithium reagents (eg CH Li) and grignard reagents (e.g CHMOX). In other words, which one is more reactive and why? hos Molecular Weight 181.31 Molecular Weight: 106.55 Density: 1.03 g/mL Molecular Weight: 226.32 4. In the above reaction, assume that you plan to use 0.5 mL of the starting acid chloride with 10 mL of 1.0 M phenylmagnesium bromide. Which would be the limiting reagent? What is the theoretical...
What type of reaction could not be used to accomplish the following transformation? A. Gillman ((CH2=CH),...
What type of reaction could not be used to accomplish the following transformation? A. Gillman ((CH2=CH), Culi) B. Grignard (CH2=CHMgBr) C. Heck (CH2=CH2) D. Suzuki (CH2=CHB(OR)) E. All of the above could be used. OI. A II. B O III. IV.D OVE
13. What is the major organic product of the following reaction? ma POCI OH 16-POCIE CIZOPO...
13. What is the major organic product of the following reaction? ma POCI OH 16-POCIE CIZOPO 14. Which of the following statements about Grignard reagents (R-Mg-X) is true? (i) because of the highly polar nature of the Mg-X and Mg-C bonds in Grignard reagents, water and CH3OH are good solvents for Grignard reactions. (ii) reaction of a Grignard reagent with an aldehyde yields a secondary alcohol; (iii) Grignard reagents are strongly nucleophilic; (a) only () is true (d) only (i)...
please answer the following: 1. Give the reagents for the following reaction sequence: O obco 2....
please answer the following:
1. Give the reagents for the following reaction sequence: O obco 2. Rank the following compounds in increasing order of reactivity towards nucleophilic acyl substitution (least to most reactive) goblok 3. Give the products for the following reactions: OH 1. KMnO/H* protection H01 pTSA 2. MeMgBr (excess) 3. H30* 2. SOCIzpyr. 1. deprotect. HCI PPh Good Luck Homework 3-Spring 2020 W Downloads/Homework%203-Spring%202020.pdf 4. Give the products for the following reactions: 1. H30+ ethene 2. H.Cro 1....
This is for the Grignard Reaction laboratory. Please help me answer this question, much appreciated. 1....
This is for the Grignard Reaction laboratory. Please help me answer this question, much appreciated. 1. If a student performing Laboratory with Grignard reaction accidently used acetone as the reaction solvent instead of diethyl ether, what would the major organic product(s) be? Draw the structure of the product(s) (no mechanism necessary). b. What was the purpose of adding magnesium sulfate in this experiment? c. Grignard reagents react with both aldehyde and ketone functional groups. How do you predict the reaction...
please help in all sections!! What would be the product of the following reaction? H 1....
please help in all sections!!
What would be the product of the following reaction? H 1. LAIH 2. H₂O OH OH What would be the product of the following reaction? H NaBH,/CH3OH OH Which of the following compounds is least reactive towards a nucleophilic addition reaction? Both I and IV Predict the product for the following reaction. CH3CH2NH2 H2SO4 CH-CH2NH2 ΝΗ, HO NH HẠN Which of the following compounds can be classified as a hemiacetal? 0 он Provide the structure...
What is the major product produced in the following reaction? EMOH w ho acid catalyst =...
What is the major product produced in the following reaction? EMOH w ho acid catalyst = ? 0 0 0 تیم تبلت است
Choose the product and what type of reaction is it (a Fisher Esterification, Saponification, or a...
Choose the product and what type of reaction is it (a Fisher
Esterification, Saponification, or a regular Acyl
Addition-Elimination)
ОН. CI HN ů NH2 'N CI 'N H + & ethylamine base H+/Cl/Ethylamine (by-product salt) H+/CI/Ethylamine H+/CI/Ethylamine (by-product salt) (by-product salt) ů Lien ich Ph Ph Ph он (CH3)2CHOH Ph OH + + & H3O+ catalyst HOT ОН HOH . io io NaOH ين + + + & H2O H-OH HO HO
Please help! For the reaction in step 2, how do i find the theoretical yield of...
Please help! For the reaction
in step 2, how do i find the theoretical yield of the product for
this reaction? 0.07 moles of the reactant (ethyl acetoacetate
ethylene ketal) was used. What is that keto alcohol product
(circled) called? what is the molar mass of that circled product??
thank you!!
(TsOH) as catalyst. . Check your organic textbook for the mechanism- acid-catalvzed addition of alcohol to aldehydes or ketones to form acetals or ketals. The ketone carbonyl, significantly more...
What type of product is formed in this reaction? alcohol amine ester ether sulfide t...
What type of product is formed in this reaction?
alcohol
amine
ester
ether
sulfide
thiol
NaNHCH3 LOTS
help with all please
3. Explain the difference in reactivity between organolithium reagents (eg CH Li) and grignard reagents (e.g CHMOX). In other words, which one is more reactive and why? hos Molecular Weight 181.31 Molecular Weight: 106.55 Density: 1.03 g/mL Molecular Weight: 226.32 4. In the above reaction, assume that you plan to use 0.5 mL of the starting acid chloride with 10 mL of 1.0 M phenylmagnesium bromide. Which would be the limiting reagent? What is the theoretical...
What type of reaction could not be used to accomplish the following transformation? A. Gillman ((CH2=CH), Culi) B. Grignard (CH2=CHMgBr) C. Heck (CH2=CH2) D. Suzuki (CH2=CHB(OR)) E. All of the above could be used. OI. A II. B O III. IV.D OVE
13. What is the major organic product of the following reaction? ma POCI OH 16-POCIE CIZOPO 14. Which of the following statements about Grignard reagents (R-Mg-X) is true? (i) because of the highly polar nature of the Mg-X and Mg-C bonds in Grignard reagents, water and CH3OH are good solvents for Grignard reactions. (ii) reaction of a Grignard reagent with an aldehyde yields a secondary alcohol; (iii) Grignard reagents are strongly nucleophilic; (a) only () is true (d) only (i)...
please answer the following:
1. Give the reagents for the following reaction sequence: O obco 2. Rank the following compounds in increasing order of reactivity towards nucleophilic acyl substitution (least to most reactive) goblok 3. Give the products for the following reactions: OH 1. KMnO/H* protection H01 pTSA 2. MeMgBr (excess) 3. H30* 2. SOCIzpyr. 1. deprotect. HCI PPh Good Luck Homework 3-Spring 2020 W Downloads/Homework%203-Spring%202020.pdf 4. Give the products for the following reactions: 1. H30+ ethene 2. H.Cro 1....
please help in all sections!!
What would be the product of the following reaction? H 1. LAIH 2. H₂O OH OH What would be the product of the following reaction? H NaBH,/CH3OH OH Which of the following compounds is least reactive towards a nucleophilic addition reaction? Both I and IV Predict the product for the following reaction. CH3CH2NH2 H2SO4 CH-CH2NH2 ΝΗ, HO NH HẠN Which of the following compounds can be classified as a hemiacetal? 0 он Provide the structure...
What is the major product produced in the following reaction? EMOH w ho acid catalyst = ? 0 0 0 تیم تبلت است
Choose the product and what type of reaction is it (a Fisher
Esterification, Saponification, or a regular Acyl
Addition-Elimination)
ОН. CI HN ů NH2 'N CI 'N H + & ethylamine base H+/Cl/Ethylamine (by-product salt) H+/CI/Ethylamine H+/CI/Ethylamine (by-product salt) (by-product salt) ů Lien ich Ph Ph Ph он (CH3)2CHOH Ph OH + + & H3O+ catalyst HOT ОН HOH . io io NaOH ين + + + & H2O H-OH HO HO
Please help! For the reaction
in step 2, how do i find the theoretical yield of the product for
this reaction? 0.07 moles of the reactant (ethyl acetoacetate
ethylene ketal) was used. What is that keto alcohol product
(circled) called? what is the molar mass of that circled product??
thank you!!
(TsOH) as catalyst. . Check your organic textbook for the mechanism- acid-catalvzed addition of alcohol to aldehydes or ketones to form acetals or ketals. The ketone carbonyl, significantly more...
What type of product is formed in this reaction?
alcohol
amine
ester
ether
sulfide
thiol
NaNHCH3 LOTS
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 5 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago