Compare peer to peer network FastTrack to Napter.
Compare peer to peer network FastTrack to Napter.
Homework Answers
Napster
- Used a centralized directory.
- Files located on a centralized server(s).
- Basically used for sharing music files in mp3 formats
- Had many copyright violations.
- Didn't have any encryption.
Fastrack
- Uses a two-tiered system of supernodes and nodes.
- Uses Supernodes to have P2P sharing and improves scalability using supernodes.
- Used for very large files also.
- Uses UU Hash Algorithm.
- Uses Encryption.
Please do upvote this answer by giving it a thumbs up.
1. What is Blockcahin? 2. What is Peer-to-Peer network? 3. What are the properties of a...
1. What is Blockcahin? 2. What is Peer-to-Peer network? 3. What are the properties of a hash? 4. How the public and private keys work in Public-key Encryption (PKE)?
Please compare and contrast the hierarchical trust model, peer-to-peer trust model, and hybrid trust model.
Please compare and contrast the hierarchical trust model, peer-to-peer trust model, and hybrid trust model.
Compare client-server systems and peer-to-peer systems in terms of performance, scalability, fault tolerance, and any other...
Compare client-server systems and peer-to-peer systems in terms of performance, scalability, fault tolerance, and any other feature you think is important.
B1) List the benefits of networking. B2) List the responsibilities of a network administrator. B3) What...
B1) List the benefits of networking. B2) List the responsibilities of a network administrator. B3) What is a local area network? B4) Define the following terms: (i) Point to Point link (ii) Topology (iii) MAC B5) What is a wide area network? B6) List the advantages of a peer to peer network. B7) List the advantages of a client/server network. B8) List the disadvantages of a peer to peer network. B9) Briefly explain client program and server program.
2 File distribution time: Server-Client vs. P2P (10 pts) Consider distribution of a file to N peers on a network....
2 File distribution time: Server-Client vs. P2P (10 pts) Consider distribution of a file to N peers on a network. The network parameters are as below File size, F 1 Gbits Upload rate of the server, u10 Mbps Download rate of each peer, d Mbps Upload rate of each peer, Mbps 1. Calculate the file distribution time in a client-server network for each of N = 100, 1000, and 10000, 5 pts) 2. Calculate the file distribution time in a...
. Compare and contrast the types of addresses used in a network and explain how address...
. Compare and contrast the types of addresses used in a network and explain how address resolution works. Give an example.
Internal Password Sensitivity Restricted Sensitive Secret - Confidential Describe the importance of peer review in scientific...
Internal Password Sensitivity Restricted Sensitive Secret - Confidential Describe the importance of peer review in scientific research and how to determine if the information is peer-reviewed. Analyze another two criteria to determine quality information and how does it compare with the peer review requirement. What is the correct way to evaluate the data, and why?
Networking Drawing Tool: Visio Create a network diagram that illustrates a LAN that supports ten clients...
Networking
Drawing Tool: Visio Create a network diagram that illustrates a LAN that supports ten clients in a client server environment with a server running Windows Server 2016. The network uses a switch and a router, and networked printer. If Visio is not available on your computer, use creately. Link provided below. https://creately.com/lp/network-diagram-software-online Network Diagram should be clearly labeled 1. Diagram. 2. What is a peer-to-peer network? How does it differ from a client-server?
4. Compare the radial basis functions neural network and back propagation in term of various aspects related to trainin...
4. Compare the radial basis functions neural network and back propagation in term of various aspects related to training, convergence, and applications.
4. Compare the radial basis functions neural network and back propagation in term of various aspects related to training, convergence, and applications.
Compare your network to that of your group members (two to four people in your class)....
Compare your network to that of your group members (two to four people in your class). Do you find any commonalities in your networks? Who has the greatest social capital, and why? What can you do to "optimize" your network structure?
B1) List the benefits of networking. B2) List the responsibilities of a network administrator. B3) What is a local area network? B4) Define the following terms: (i) Point to Point link (ii) Topology (iii) MAC B5) What is a wide area network? B6) List the advantages of a peer to peer network. B7) List the advantages of a client/server network. B8) List the disadvantages of a peer to peer network. B9) Briefly explain client program and server program.
2 File distribution time: Server-Client vs. P2P (10 pts) Consider distribution of a file to N peers on a network. The network parameters are as below File size, F 1 Gbits Upload rate of the server, u10 Mbps Download rate of each peer, d Mbps Upload rate of each peer, Mbps 1. Calculate the file distribution time in a client-server network for each of N = 100, 1000, and 10000, 5 pts) 2. Calculate the file distribution time in a...
Internal Password Sensitivity Restricted Sensitive Secret - Confidential Describe the importance of peer review in scientific research and how to determine if the information is peer-reviewed. Analyze another two criteria to determine quality information and how does it compare with the peer review requirement. What is the correct way to evaluate the data, and why?
Networking
Drawing Tool: Visio Create a network diagram that illustrates a LAN that supports ten clients in a client server environment with a server running Windows Server 2016. The network uses a switch and a router, and networked printer. If Visio is not available on your computer, use creately. Link provided below. https://creately.com/lp/network-diagram-software-online Network Diagram should be clearly labeled 1. Diagram. 2. What is a peer-to-peer network? How does it differ from a client-server?
4. Compare the radial basis functions neural network and back propagation in term of various aspects related to training, convergence, and applications.
4. Compare the radial basis functions neural network and back propagation in term of various aspects related to training, convergence, and applications.
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 36 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago