Suppose you graph Vs. and get a slope m = 0.413. If the second material is...
Suppose you graph Vs.
and get a slope m =
0.413. If the second material is air (n2 =
1.0003), use equation 2 in the manual to calculate
n1.
|
n1 = 1 |
||
|
n1 = 2.42 |
||
|
n1 = 1.46 |
||
|
n1 = 1.47 |
||
|
n1 = 1.49 |
||
|
n1 = 0.413 |
Homework Answers
Here, According to snells law
=> n1 * sin(theta1) = n2 * sin(theta2)
=> n1 * sin(theta1) = 1.0003 * sin(theta2)
=> n1 = 1.0003 * sin(theta2)/sin(theta1)
= 1.0003 * 1/0.413
= 2.42
=> n1 = 2.42
Add Answer to:
Suppose you graph Vs. and get a slope m =
0.413. If the second material is...
When asked to graph current vs voltage what variable goes on the x axis a. Resistance...
When asked to graph current vs voltage what variable goes on the x axis a. Resistance b. Voltage c. Resistivity d. Current 2.5 points QUESTION 2 Given that a graph of voltage vs current is a straight line, what are the units of the slope? a. Amps b. Volts/Amps c. Amps/Volts d. Volts 2.5 points QUESTION 3 Given that a graph of sin(θ1) vs sin(θ2) is a straight line graph, and that Snell's law is n1sin(θ1) =n2sinθ2 and knowing that...
If you were to plot the coulomb’s law formula on a graph , where the slope...
If you were to plot the coulomb’s law formula on a graph , where the slope is equal to kq1q2. Y axis is F and x-axis is 1/r. The equation for the graph is a linear equation where m=slope and b=intercept. What is the meaning/value of this intercept. Example Graph : F vs 1/r y= mx + b y=(k*2.6x10^-9)x + 2.3x10^-6 Where m=kq1q2 , what would b represent ?
There are two graphs that needs to be made in this lab: 1. Total Energy Vs...
There are two graphs that needs to be made in this lab:
1. Total Energy Vs time with m = 20g
2. Total Energy Vs time with m = 40g
A) Explain the nature of the plots .(Linear or non
linear?) The expected slope is zero in both cases. Why? Explain
with the use of law of conservation of energy. What is the
significance of the intercept?
B) Suppose you drew the Kinetic Energy Vs potential
Energy graph: The expected...
Need help with the graph and slope? Data Table 41 Calculation Table 2 L M (g)...
Need help with the graph and slope?
Data Table 41 Calculation Table 2 L M (g) M (kg) 2 3 4 5 6 7 8 22022 K 2156 N 830M1 3 3 4In 089734 N 122cm 22m 385 5965 K4N 40 309 030 79 040 9 0 3921N D05 K ? I. Using at least 75% of the graph paper, make a graph with ? on Y axis and VT, on the X axis. 2. Draw a best fit line...
I wanna understand if I got the slope right and how to answer the next questions Measurement of the Gas Constant and Molar Volume Volume of Oxygen Gas s. What is the slope, m, of graph...
I wanna understand if I got the slope right and how to
answer the next questions
Measurement of the Gas Constant and Molar Volume Volume of Oxygen Gas s. What is the slope, m, of graph 2? Show your calculations here and include the correct units. Remember that logarithms do not have units! 6. What is the y-intercept, b, of graph 27 Show your calculations here and include the correct Write the equation of the straight line of graph 2....
5 What are the units of the rate constant (k) for first, second, or zero order reaction? Show how you determined the...
5 What are the units of the rate constant (k) for first, second, or zero order reaction? Show how you determined the units of each rate constant. >SO2 + Cla: 6. The following data were obtained at 320°C for the reaction of: SO Cla 0.00 4.00 3,00 2.00 Time, hour 1.00 0.874 [SO Cl), M 0.946 1.024 1,200 1.109 Graph: (a) In [SO Cl2] vs. time Label and attach the graphs to the worksheet. If using Excel, provide the equation...
A plot of volume vs time, on semi-log graph paper, produced a slope of 14.2 +0.2s-1...
A plot of volume vs time, on semi-log graph paper, produced a slope of 14.2 +0.2s-1 and an intercept of 0.011+0.002 m 3. What is the final form of the exponential equation that relates these variables? Select one: O a. V=(0.011+0.002m3)e(14.2+0.25-1)t ob. t=(0.011+0.002m3)e(14.2+0.25-1)V O c. t=(14.20.25-1)e(0.011=0.002m3)V O d. V=(14.240.25-11e(0.011+0.002m3)t
Use Snell’s law to calculate the angle of the refracted wave in the material. What angle...
Use Snell’s law to calculate the angle of the refracted wave in
the material. What angle does the refracted wave make with the
reflected wave outside the material? So why is there no reflected
wave (hint: think of the consequences of Maxwell’s equation #»∇ ·
#»E = 0)? Why is the Brewster’s angle dependent on the
polarization? Use Fig 1 for help
Refer to Fig 1. What is the time t1 that the beam takes to
travel from A to...
Part 2: Velocity vs. Time 1. For each velocity vs. time graph (Graph 3 and 4), describe how you w...
Part 2: Velocity vs. Time 1. For each velocity vs. time graph (Graph 3 and 4), describe how you would walk in order to replicate the 1-D motion graph. Use words such as away, toward, at rest, speeding up, slowing down, constant speed. Be specific with your time periods. 2. For each velocity vs. time graph, create the corresponding position and acceleration versus time graphs. Construct your graph on a computer program such as Microsoft ExcelB. If you do not...
Square both sides of the equation above. If we plot T2 vs. m, What is the...
Square both sides of the equation above. If we plot
T2 vs. m, What is the expression for the slope of this
graph?
An unstretched vertical spring has length of L1 =
7.35 +/- 0.05 cm. A 500.0 +/- 0.1 g mass is hung on the spring
which then stretches it to a length L2 = 12.50 +/- 0.05
cm. Calculate the spring constant k and its uncertainty. Show your
workings.
Square both sides of the equation above. If we...
There are two graphs that needs to be made in this lab:
1. Total Energy Vs time with m = 20g
2. Total Energy Vs time with m = 40g
A) Explain the nature of the plots .(Linear or non
linear?) The expected slope is zero in both cases. Why? Explain
with the use of law of conservation of energy. What is the
significance of the intercept?
B) Suppose you drew the Kinetic Energy Vs potential
Energy graph: The expected...
Need help with the graph and slope?
Data Table 41 Calculation Table 2 L M (g) M (kg) 2 3 4 5 6 7 8 22022 K 2156 N 830M1 3 3 4In 089734 N 122cm 22m 385 5965 K4N 40 309 030 79 040 9 0 3921N D05 K ? I. Using at least 75% of the graph paper, make a graph with ? on Y axis and VT, on the X axis. 2. Draw a best fit line...
I wanna understand if I got the slope right and how to
answer the next questions
Measurement of the Gas Constant and Molar Volume Volume of Oxygen Gas s. What is the slope, m, of graph 2? Show your calculations here and include the correct units. Remember that logarithms do not have units! 6. What is the y-intercept, b, of graph 27 Show your calculations here and include the correct Write the equation of the straight line of graph 2....
5 What are the units of the rate constant (k) for first, second, or zero order reaction? Show how you determined the units of each rate constant. >SO2 + Cla: 6. The following data were obtained at 320°C for the reaction of: SO Cla 0.00 4.00 3,00 2.00 Time, hour 1.00 0.874 [SO Cl), M 0.946 1.024 1,200 1.109 Graph: (a) In [SO Cl2] vs. time Label and attach the graphs to the worksheet. If using Excel, provide the equation...
A plot of volume vs time, on semi-log graph paper, produced a slope of 14.2 +0.2s-1 and an intercept of 0.011+0.002 m 3. What is the final form of the exponential equation that relates these variables? Select one: O a. V=(0.011+0.002m3)e(14.2+0.25-1)t ob. t=(0.011+0.002m3)e(14.2+0.25-1)V O c. t=(14.20.25-1)e(0.011=0.002m3)V O d. V=(14.240.25-11e(0.011+0.002m3)t
Use Snell’s law to calculate the angle of the refracted wave in
the material. What angle does the refracted wave make with the
reflected wave outside the material? So why is there no reflected
wave (hint: think of the consequences of Maxwell’s equation #»∇ ·
#»E = 0)? Why is the Brewster’s angle dependent on the
polarization? Use Fig 1 for help
Refer to Fig 1. What is the time t1 that the beam takes to
travel from A to...
Part 2: Velocity vs. Time 1. For each velocity vs. time graph (Graph 3 and 4), describe how you would walk in order to replicate the 1-D motion graph. Use words such as away, toward, at rest, speeding up, slowing down, constant speed. Be specific with your time periods. 2. For each velocity vs. time graph, create the corresponding position and acceleration versus time graphs. Construct your graph on a computer program such as Microsoft ExcelB. If you do not...
Square both sides of the equation above. If we plot
T2 vs. m, What is the expression for the slope of this
graph?
An unstretched vertical spring has length of L1 =
7.35 +/- 0.05 cm. A 500.0 +/- 0.1 g mass is hung on the spring
which then stretches it to a length L2 = 12.50 +/- 0.05
cm. Calculate the spring constant k and its uncertainty. Show your
workings.
Square both sides of the equation above. If we...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 30 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago