a. carbohydrate ( it consists of only C, H and O)
b. aminoacid ( because it has one amino terminal and one carboxyl terminal)
c. lipid ( presence of long hydrocarbon chains bound to glycerol molecule , in this case also phosphate group- phospholipid) .
your choosing. (5Pts) 5. Below are 3 molecules. Which one is a lipid? Which one is...
Please can someone help me with this? I can not figure out which molecules match up with the terms in A) and B) James Howland CHEM 1121: General, Organic, & Biochemistry Identifying Biomolecules A) Label each of the molecules shown according to which type it is: carbohydrate lipid fatty acid water-soluble vitamin B) with one exception, all of the molecules shown are also one of these sub-types. Label the molecules with the appropriate sub-types. disaccharide fat-soluble vitamin monosaccharide phospholipid saturated...
PLEASE ANSWER 5-8 1. Casein is a type of proteln, lipid or carbohydrate? Circle one. 2. Albumin is a type of protein, lipid or carbohydrate? Circle one. 3. Lactose is a type of protein, lipid or carbohydrate? Circle one. 4. Why is it important to maintain the milk temperature at 40°C for the initial part of the lab? What happens if the initial mixture is heated too much, above 40°c? 5. 6. What happens if too much acid is added?...
Which of the below molecules would be expected to be membrane permeable and freely pass through a lipid bilayer? Select all that apply Which of the below molecules would be expected to be membrane permeable and freely pass through a lipid bilayer? Select all that apply. O=C=0 Nat NEN K+ * H-C-OH Ο Ι Ι HHHHHH
In studying a particular biomolecule (a protein, nucleic acid, carbohydrate, or lipid) in the laboratory, the biochemist first needs to separate it from other biomolecules in the sample (that is, it needs to be purified). Specific purification techniques are described later in the text. However, by looking at the monomeric subunits and functional groups of a biomolecule, you should have some ideas about the characteristics of the molecule that would allow you to separate it from other molecules. Look for...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
In studying a particular biomolecule (a protein, nucleic acid, carbohydrate, or lipid) in the laboratory, the biochemist first needs to separate it from other biomolecules in the sample (that is, it needs to be purified). Specific purification techniques are described later in the text. However, by looking at the monomeric subunits and functional groups of a biomolecule, you should have some ideas about the characteristics of the molecule that would allow you to separate it from other molecules. Look for...
Which lipid is synthesized using Ser, an amino acid, as the backbone? Select one: a. sphingomyelin b. phosphatidylserine c. triacylglycerol d. All of these e. None of these
5) Carboxylic acids often exist as dimers, where two molecules are attached to each other a. Propose a reason. b. Draw an example of this phenomenon between two molecules of acetic acid (CH,COOH) 6) Answer the following questions about the amino acid, alanine: (shown) CH3O H3C Y OH NH2 a. Does this amino acid in this form in nature? b. If not, draw the form that exists in nature.
(a) Into which channel is Fe2+ most likely to travel? Briefly explain your answer by including the dominant interparticle force between it and the amino acid R groups that line the channel. (b) Into which channel is O2 most likely to travel? Briefly explain your answer by including the dominant interparticle force between it and the amino acid R groups that line the channel. (c) Suppose there is a region in a protein where a significant amount of H bonding...
LockDown Browser Kadidiatou Bane: Attempt 1 Question 7 11 PUNI Classify this molecule which contains a glycosidic bond: ҫН,ОН CH OH OH HO OH OH OH OH carbohydrate fatty acid bile salt none are correct amino acid 21 000 DOO FA & A % 5 6 $